8889841cPK     „«[rêog  g    Color/BIFF5.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;

class BIFF5
{
    protected static $map = [
        0x08 => '000000',
        0x09 => 'FFFFFF',
        0x0A => 'FF0000',
        0x0B => '00FF00',
        0x0C => '0000FF',
        0x0D => 'FFFF00',
        0x0E => 'FF00FF',
        0x0F => '00FFFF',
        0x10 => '800000',
        0x11 => '008000',
        0x12 => '000080',
        0x13 => '808000',
        0x14 => '800080',
        0x15 => '008080',
        0x16 => 'C0C0C0',
        0x17 => '808080',
        0x18 => '8080FF',
        0x19 => '802060',
        0x1A => 'FFFFC0',
        0x1B => 'A0E0F0',
        0x1C => '600080',
        0x1D => 'FF8080',
        0x1E => '0080C0',
        0x1F => 'C0C0FF',
        0x20 => '000080',
        0x21 => 'FF00FF',
        0x22 => 'FFFF00',
        0x23 => '00FFFF',
        0x24 => '800080',
        0x25 => '800000',
        0x26 => '008080',
        0x27 => '0000FF',
        0x28 => '00CFFF',
        0x29 => '69FFFF',
        0x2A => 'E0FFE0',
        0x2B => 'FFFF80',
        0x2C => 'A6CAF0',
        0x2D => 'DD9CB3',
        0x2E => 'B38FEE',
        0x2F => 'E3E3E3',
        0x30 => '2A6FF9',
        0x31 => '3FB8CD',
        0x32 => '488436',
        0x33 => '958C41',
        0x34 => '8E5E42',
        0x35 => 'A0627A',
        0x36 => '624FAC',
        0x37 => '969696',
        0x38 => '1D2FBE',
        0x39 => '286676',
        0x3A => '004500',
        0x3B => '453E01',
        0x3C => '6A2813',
        0x3D => '85396A',
        0x3E => '4A3285',
        0x3F => '424242',
    ];

    /**
     * Map color array from BIFF5 built-in color index.
     *
     * @param int $color
     *
     * @return array
     */
    public static function lookup($color)
    {
        if (isset(self::$map[$color])) {
            return ['rgb' => self::$map[$color]];
        }

        return ['rgb' => '000000'];
    }
}
PK     „«[#íŒ¯ù  ù    Color/BuiltIn.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;

class BuiltIn
{
    protected static $map = [
        0x00 => '000000',
        0x01 => 'FFFFFF',
        0x02 => 'FF0000',
        0x03 => '00FF00',
        0x04 => '0000FF',
        0x05 => 'FFFF00',
        0x06 => 'FF00FF',
        0x07 => '00FFFF',
        0x40 => '000000', // system window text color
        0x41 => 'FFFFFF', // system window background color
    ];

    /**
     * Map built-in color to RGB value.
     *
     * @param int $color Indexed color
     *
     * @return array
     */
    public static function lookup($color)
    {
        if (isset(self::$map[$color])) {
            return ['rgb' => self::$map[$color]];
        }

        return ['rgb' => '000000'];
    }
}
PK     „«[$pg  g    Color/BIFF8.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;

class BIFF8
{
    protected static $map = [
        0x08 => '000000',
        0x09 => 'FFFFFF',
        0x0A => 'FF0000',
        0x0B => '00FF00',
        0x0C => '0000FF',
        0x0D => 'FFFF00',
        0x0E => 'FF00FF',
        0x0F => '00FFFF',
        0x10 => '800000',
        0x11 => '008000',
        0x12 => '000080',
        0x13 => '808000',
        0x14 => '800080',
        0x15 => '008080',
        0x16 => 'C0C0C0',
        0x17 => '808080',
        0x18 => '9999FF',
        0x19 => '993366',
        0x1A => 'FFFFCC',
        0x1B => 'CCFFFF',
        0x1C => '660066',
        0x1D => 'FF8080',
        0x1E => '0066CC',
        0x1F => 'CCCCFF',
        0x20 => '000080',
        0x21 => 'FF00FF',
        0x22 => 'FFFF00',
        0x23 => '00FFFF',
        0x24 => '800080',
        0x25 => '800000',
        0x26 => '008080',
        0x27 => '0000FF',
        0x28 => '00CCFF',
        0x29 => 'CCFFFF',
        0x2A => 'CCFFCC',
        0x2B => 'FFFF99',
        0x2C => '99CCFF',
        0x2D => 'FF99CC',
        0x2E => 'CC99FF',
        0x2F => 'FFCC99',
        0x30 => '3366FF',
        0x31 => '33CCCC',
        0x32 => '99CC00',
        0x33 => 'FFCC00',
        0x34 => 'FF9900',
        0x35 => 'FF6600',
        0x36 => '666699',
        0x37 => '969696',
        0x38 => '003366',
        0x39 => '339966',
        0x3A => '003300',
        0x3B => '333300',
        0x3C => '993300',
        0x3D => '993366',
        0x3E => '333399',
        0x3F => '333333',
    ];

    /**
     * Map color array from BIFF8 built-in color index.
     *
     * @param int $color
     *
     * @return array
     */
    public static function lookup($color)
    {
        if (isset(self::$map[$color])) {
            return ['rgb' => self::$map[$color]];
        }

        return ['rgb' => '000000'];
    }
}
PK     „«[Hl—Ž  Ž  	  Color.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls;

use PhpOffice\PhpSpreadsheet\Reader\Xls;

class Color
{
    /**
     * Read color.
     *
     * @param int $color Indexed color
     * @param array $palette Color palette
     * @param int $version
     *
     * @return array RGB color value, example: ['rgb' => 'FF0000']
     */
    public static function map($color, $palette, $version)
    {
        if ($color <= 0x07 || $color >= 0x40) {
            // special built-in color
            return Color\BuiltIn::lookup($color);
        } elseif (isset($palette[$color - 8])) {
            // palette color, color index 0x08 maps to pallete index 0
            return $palette[$color - 8];
        }

        // default color table
        if ($version == Xls::XLS_BIFF8) {
            return Color\BIFF8::lookup($color);
        }

        // BIFF5
        return Color\BIFF5::lookup($color);
    }
}
PK     „«[Àÿ›Â  Â    RC4.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls;

class RC4
{
    // Context
    protected $s = [];

    protected $i = 0;

    protected $j = 0;

    /**
     * RC4 stream decryption/encryption constrcutor.
     *
     * @param string $key Encryption key/passphrase
     */
    public function __construct($key)
    {
        $len = strlen($key);

        for ($this->i = 0; $this->i < 256; ++$this->i) {
            $this->s[$this->i] = $this->i;
        }

        $this->j = 0;
        for ($this->i = 0; $this->i < 256; ++$this->i) {
            $this->j = ($this->j + $this->s[$this->i] + ord($key[$this->i % $len])) % 256;
            $t = $this->s[$this->i];
            $this->s[$this->i] = $this->s[$this->j];
            $this->s[$this->j] = $t;
        }
        $this->i = $this->j = 0;
    }

    /**
     * Symmetric decryption/encryption function.
     *
     * @param string $data Data to encrypt/decrypt
     *
     * @return string
     */
    public function RC4($data)
    {
        $len = strlen($data);
        for ($c = 0; $c < $len; ++$c) {
            $this->i = ($this->i + 1) % 256;
            $this->j = ($this->j + $this->s[$this->i]) % 256;
            $t = $this->s[$this->i];
            $this->s[$this->i] = $this->s[$this->j];
            $this->s[$this->j] = $t;

            $t = ($this->s[$this->i] + $this->s[$this->j]) % 256;

            $data[$c] = chr(ord($data[$c]) ^ $this->s[$t]);
        }

        return $data;
    }
}
PK     „«[:Ì$M  M    MD5.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls;

class MD5
{
    // Context

    /**
     * @var int
     */
    private $a;

    /**
     * @var int
     */
    private $b;

    /**
     * @var int
     */
    private $c;

    /**
     * @var int
     */
    private $d;

    /**
     * MD5 stream constructor.
     */
    public function __construct()
    {
        $this->reset();
    }

    /**
     * Reset the MD5 stream context.
     */
    public function reset(): void
    {
        $this->a = 0x67452301;
        $this->b = 0xEFCDAB89;
        $this->c = 0x98BADCFE;
        $this->d = 0x10325476;
    }

    /**
     * Get MD5 stream context.
     *
     * @return string
     */
    public function getContext()
    {
        $s = '';
        foreach (['a', 'b', 'c', 'd'] as $i) {
            $v = $this->{$i};
            $s .= chr($v & 0xff);
            $s .= chr(($v >> 8) & 0xff);
            $s .= chr(($v >> 16) & 0xff);
            $s .= chr(($v >> 24) & 0xff);
        }

        return $s;
    }

    /**
     * Add data to context.
     *
     * @param string $data Data to add
     */
    public function add(string $data): void
    {
        $words = array_values(unpack('V16', $data));

        $A = $this->a;
        $B = $this->b;
        $C = $this->c;
        $D = $this->d;

        $F = ['self', 'f'];
        $G = ['self', 'g'];
        $H = ['self', 'h'];
        $I = ['self', 'i'];

        // ROUND 1
        self::step($F, $A, $B, $C, $D, $words[0], 7, 0xd76aa478);
        self::step($F, $D, $A, $B, $C, $words[1], 12, 0xe8c7b756);
        self::step($F, $C, $D, $A, $B, $words[2], 17, 0x242070db);
        self::step($F, $B, $C, $D, $A, $words[3], 22, 0xc1bdceee);
        self::step($F, $A, $B, $C, $D, $words[4], 7, 0xf57c0faf);
        self::step($F, $D, $A, $B, $C, $words[5], 12, 0x4787c62a);
        self::step($F, $C, $D, $A, $B, $words[6], 17, 0xa8304613);
        self::step($F, $B, $C, $D, $A, $words[7], 22, 0xfd469501);
        self::step($F, $A, $B, $C, $D, $words[8], 7, 0x698098d8);
        self::step($F, $D, $A, $B, $C, $words[9], 12, 0x8b44f7af);
        self::step($F, $C, $D, $A, $B, $words[10], 17, 0xffff5bb1);
        self::step($F, $B, $C, $D, $A, $words[11], 22, 0x895cd7be);
        self::step($F, $A, $B, $C, $D, $words[12], 7, 0x6b901122);
        self::step($F, $D, $A, $B, $C, $words[13], 12, 0xfd987193);
        self::step($F, $C, $D, $A, $B, $words[14], 17, 0xa679438e);
        self::step($F, $B, $C, $D, $A, $words[15], 22, 0x49b40821);

        // ROUND 2
        self::step($G, $A, $B, $C, $D, $words[1], 5, 0xf61e2562);
        self::step($G, $D, $A, $B, $C, $words[6], 9, 0xc040b340);
        self::step($G, $C, $D, $A, $B, $words[11], 14, 0x265e5a51);
        self::step($G, $B, $C, $D, $A, $words[0], 20, 0xe9b6c7aa);
        self::step($G, $A, $B, $C, $D, $words[5], 5, 0xd62f105d);
        self::step($G, $D, $A, $B, $C, $words[10], 9, 0x02441453);
        self::step($G, $C, $D, $A, $B, $words[15], 14, 0xd8a1e681);
        self::step($G, $B, $C, $D, $A, $words[4], 20, 0xe7d3fbc8);
        self::step($G, $A, $B, $C, $D, $words[9], 5, 0x21e1cde6);
        self::step($G, $D, $A, $B, $C, $words[14], 9, 0xc33707d6);
        self::step($G, $C, $D, $A, $B, $words[3], 14, 0xf4d50d87);
        self::step($G, $B, $C, $D, $A, $words[8], 20, 0x455a14ed);
        self::step($G, $A, $B, $C, $D, $words[13], 5, 0xa9e3e905);
        self::step($G, $D, $A, $B, $C, $words[2], 9, 0xfcefa3f8);
        self::step($G, $C, $D, $A, $B, $words[7], 14, 0x676f02d9);
        self::step($G, $B, $C, $D, $A, $words[12], 20, 0x8d2a4c8a);

        // ROUND 3
        self::step($H, $A, $B, $C, $D, $words[5], 4, 0xfffa3942);
        self::step($H, $D, $A, $B, $C, $words[8], 11, 0x8771f681);
        self::step($H, $C, $D, $A, $B, $words[11], 16, 0x6d9d6122);
        self::step($H, $B, $C, $D, $A, $words[14], 23, 0xfde5380c);
        self::step($H, $A, $B, $C, $D, $words[1], 4, 0xa4beea44);
        self::step($H, $D, $A, $B, $C, $words[4], 11, 0x4bdecfa9);
        self::step($H, $C, $D, $A, $B, $words[7], 16, 0xf6bb4b60);
        self::step($H, $B, $C, $D, $A, $words[10], 23, 0xbebfbc70);
        self::step($H, $A, $B, $C, $D, $words[13], 4, 0x289b7ec6);
        self::step($H, $D, $A, $B, $C, $words[0], 11, 0xeaa127fa);
        self::step($H, $C, $D, $A, $B, $words[3], 16, 0xd4ef3085);
        self::step($H, $B, $C, $D, $A, $words[6], 23, 0x04881d05);
        self::step($H, $A, $B, $C, $D, $words[9], 4, 0xd9d4d039);
        self::step($H, $D, $A, $B, $C, $words[12], 11, 0xe6db99e5);
        self::step($H, $C, $D, $A, $B, $words[15], 16, 0x1fa27cf8);
        self::step($H, $B, $C, $D, $A, $words[2], 23, 0xc4ac5665);

        // ROUND 4
        self::step($I, $A, $B, $C, $D, $words[0], 6, 0xf4292244);
        self::step($I, $D, $A, $B, $C, $words[7], 10, 0x432aff97);
        self::step($I, $C, $D, $A, $B, $words[14], 15, 0xab9423a7);
        self::step($I, $B, $C, $D, $A, $words[5], 21, 0xfc93a039);
        self::step($I, $A, $B, $C, $D, $words[12], 6, 0x655b59c3);
        self::step($I, $D, $A, $B, $C, $words[3], 10, 0x8f0ccc92);
        self::step($I, $C, $D, $A, $B, $words[10], 15, 0xffeff47d);
        self::step($I, $B, $C, $D, $A, $words[1], 21, 0x85845dd1);
        self::step($I, $A, $B, $C, $D, $words[8], 6, 0x6fa87e4f);
        self::step($I, $D, $A, $B, $C, $words[15], 10, 0xfe2ce6e0);
        self::step($I, $C, $D, $A, $B, $words[6], 15, 0xa3014314);
        self::step($I, $B, $C, $D, $A, $words[13], 21, 0x4e0811a1);
        self::step($I, $A, $B, $C, $D, $words[4], 6, 0xf7537e82);
        self::step($I, $D, $A, $B, $C, $words[11], 10, 0xbd3af235);
        self::step($I, $C, $D, $A, $B, $words[2], 15, 0x2ad7d2bb);
        self::step($I, $B, $C, $D, $A, $words[9], 21, 0xeb86d391);

        $this->a = ($this->a + $A) & 0xffffffff;
        $this->b = ($this->b + $B) & 0xffffffff;
        $this->c = ($this->c + $C) & 0xffffffff;
        $this->d = ($this->d + $D) & 0xffffffff;
    }

    private static function f(int $X, int $Y, int $Z)
    {
        return ($X & $Y) | ((~$X) & $Z); // X AND Y OR NOT X AND Z
    }

    private static function g(int $X, int $Y, int $Z)
    {
        return ($X & $Z) | ($Y & (~$Z)); // X AND Z OR Y AND NOT Z
    }

    private static function h(int $X, int $Y, int $Z)
    {
        return $X ^ $Y ^ $Z; // X XOR Y XOR Z
    }

    private static function i(int $X, int $Y, int $Z)
    {
        return $Y ^ ($X | (~$Z)); // Y XOR (X OR NOT Z)
    }

    private static function step($func, int &$A, int $B, int $C, int $D, int $M, int $s, int $t): void
    {
        $A = ($A + call_user_func($func, $B, $C, $D) + $M + $t) & 0xffffffff;
        $A = self::rotate($A, $s);
        $A = ($B + $A) & 0xffffffff;
    }

    private static function rotate(int $decimal, int $bits)
    {
        $binary = str_pad(decbin($decimal), 32, '0', STR_PAD_LEFT);

        return bindec(substr($binary, $bits) . substr($binary, 0, $bits));
    }
}
PK     „«[ŽiºŸ4  4    ErrorCode.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

class ErrorCode
{
    /**
     * @var array<string, int>
     */
    protected static $errorCodeMap = [
        '#NULL!' => 0x00,
        '#DIV/0!' => 0x07,
        '#VALUE!' => 0x0F,
        '#REF!' => 0x17,
        '#NAME?' => 0x1D,
        '#NUM!' => 0x24,
        '#N/A' => 0x2A,
    ];

    public static function error(string $errorCode): int
    {
        if (array_key_exists($errorCode, self::$errorCodeMap)) {
            return self::$errorCodeMap[$errorCode];
        }

        return 0;
    }
}
PK     „«[Ä{îÈA  ÈA  
  Escher.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer\SpgrContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer\SpgrContainer\SpContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer\BSE;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer\BSE\Blip;

class Escher
{
    /**
     * The object we are writing.
     */
    private $object;

    /**
     * The written binary data.
     */
    private $data;

    /**
     * Shape offsets. Positions in binary stream where a new shape record begins.
     *
     * @var array
     */
    private $spOffsets;

    /**
     * Shape types.
     *
     * @var array
     */
    private $spTypes;

    /**
     * Constructor.
     *
     * @param mixed $object
     */
    public function __construct($object)
    {
        $this->object = $object;
    }

    /**
     * Process the object to be written.
     *
     * @return string
     */
    public function close()
    {
        // initialize
        $this->data = '';

        switch (get_class($this->object)) {
            case \PhpOffice\PhpSpreadsheet\Shared\Escher::class:
                if ($dggContainer = $this->object->getDggContainer()) {
                    $writer = new self($dggContainer);
                    $this->data = $writer->close();
                } elseif ($dgContainer = $this->object->getDgContainer()) {
                    $writer = new self($dgContainer);
                    $this->data = $writer->close();
                    $this->spOffsets = $writer->getSpOffsets();
                    $this->spTypes = $writer->getSpTypes();
                }

                break;
            case DggContainer::class:
                // this is a container record

                // initialize
                $innerData = '';

                // write the dgg
                $recVer = 0x0;
                $recInstance = 0x0000;
                $recType = 0xF006;

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                // dgg data
                $dggData =
                    pack(
                        'VVVV',
                        $this->object->getSpIdMax(), // maximum shape identifier increased by one
                        $this->object->getCDgSaved() + 1, // number of file identifier clusters increased by one
                        $this->object->getCSpSaved(),
                        $this->object->getCDgSaved() // count total number of drawings saved
                    );

                // add file identifier clusters (one per drawing)
                $IDCLs = $this->object->getIDCLs();

                foreach ($IDCLs as $dgId => $maxReducedSpId) {
                    $dggData .= pack('VV', $dgId, $maxReducedSpId + 1);
                }

                $header = pack('vvV', $recVerInstance, $recType, strlen($dggData));
                $innerData .= $header . $dggData;

                // write the bstoreContainer
                if ($bstoreContainer = $this->object->getBstoreContainer()) {
                    $writer = new self($bstoreContainer);
                    $innerData .= $writer->close();
                }

                // write the record
                $recVer = 0xF;
                $recInstance = 0x0000;
                $recType = 0xF000;
                $length = strlen($innerData);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header . $innerData;

                break;
            case BstoreContainer::class:
                // this is a container record

                // initialize
                $innerData = '';

                // treat the inner data
                if ($BSECollection = $this->object->getBSECollection()) {
                    foreach ($BSECollection as $BSE) {
                        $writer = new self($BSE);
                        $innerData .= $writer->close();
                    }
                }

                // write the record
                $recVer = 0xF;
                $recInstance = count($this->object->getBSECollection());
                $recType = 0xF001;
                $length = strlen($innerData);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header . $innerData;

                break;
            case BSE::class:
                // this is a semi-container record

                // initialize
                $innerData = '';

                // here we treat the inner data
                if ($blip = $this->object->getBlip()) {
                    $writer = new self($blip);
                    $innerData .= $writer->close();
                }

                // initialize
                $data = '';

                $btWin32 = $this->object->getBlipType();
                $btMacOS = $this->object->getBlipType();
                $data .= pack('CC', $btWin32, $btMacOS);

                $rgbUid = pack('VVVV', 0, 0, 0, 0); // todo
                $data .= $rgbUid;

                $tag = 0;
                $size = strlen($innerData);
                $cRef = 1;
                $foDelay = 0; //todo
                $unused1 = 0x0;
                $cbName = 0x0;
                $unused2 = 0x0;
                $unused3 = 0x0;
                $data .= pack('vVVVCCCC', $tag, $size, $cRef, $foDelay, $unused1, $cbName, $unused2, $unused3);

                $data .= $innerData;

                // write the record
                $recVer = 0x2;
                $recInstance = $this->object->getBlipType();
                $recType = 0xF007;
                $length = strlen($data);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header;

                $this->data .= $data;

                break;
            case Blip::class:
                // this is an atom record

                // write the record
                switch ($this->object->getParent()->getBlipType()) {
                    case BSE::BLIPTYPE_JPEG:
                        // initialize
                        $innerData = '';

                        $rgbUid1 = pack('VVVV', 0, 0, 0, 0); // todo
                        $innerData .= $rgbUid1;

                        $tag = 0xFF; // todo
                        $innerData .= pack('C', $tag);

                        $innerData .= $this->object->getData();

                        $recVer = 0x0;
                        $recInstance = 0x46A;
                        $recType = 0xF01D;
                        $length = strlen($innerData);

                        $recVerInstance = $recVer;
                        $recVerInstance |= $recInstance << 4;

                        $header = pack('vvV', $recVerInstance, $recType, $length);

                        $this->data = $header;

                        $this->data .= $innerData;

                        break;
                    case BSE::BLIPTYPE_PNG:
                        // initialize
                        $innerData = '';

                        $rgbUid1 = pack('VVVV', 0, 0, 0, 0); // todo
                        $innerData .= $rgbUid1;

                        $tag = 0xFF; // todo
                        $innerData .= pack('C', $tag);

                        $innerData .= $this->object->getData();

                        $recVer = 0x0;
                        $recInstance = 0x6E0;
                        $recType = 0xF01E;
                        $length = strlen($innerData);

                        $recVerInstance = $recVer;
                        $recVerInstance |= $recInstance << 4;

                        $header = pack('vvV', $recVerInstance, $recType, $length);

                        $this->data = $header;

                        $this->data .= $innerData;

                        break;
                }

                break;
            case DgContainer::class:
                // this is a container record

                // initialize
                $innerData = '';

                // write the dg
                $recVer = 0x0;
                $recInstance = $this->object->getDgId();
                $recType = 0xF008;
                $length = 8;

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                // number of shapes in this drawing (including group shape)
                $countShapes = count($this->object->getSpgrContainer()->getChildren());
                $innerData .= $header . pack('VV', $countShapes, $this->object->getLastSpId());

                // write the spgrContainer
                if ($spgrContainer = $this->object->getSpgrContainer()) {
                    $writer = new self($spgrContainer);
                    $innerData .= $writer->close();

                    // get the shape offsets relative to the spgrContainer record
                    $spOffsets = $writer->getSpOffsets();
                    $spTypes = $writer->getSpTypes();

                    // save the shape offsets relative to dgContainer
                    foreach ($spOffsets as &$spOffset) {
                        $spOffset += 24; // add length of dgContainer header data (8 bytes) plus dg data (16 bytes)
                    }

                    $this->spOffsets = $spOffsets;
                    $this->spTypes = $spTypes;
                }

                // write the record
                $recVer = 0xF;
                $recInstance = 0x0000;
                $recType = 0xF002;
                $length = strlen($innerData);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header . $innerData;

                break;
            case SpgrContainer::class:
                // this is a container record

                // initialize
                $innerData = '';

                // initialize spape offsets
                $totalSize = 8;
                $spOffsets = [];
                $spTypes = [];

                // treat the inner data
                foreach ($this->object->getChildren() as $spContainer) {
                    $writer = new self($spContainer);
                    $spData = $writer->close();
                    $innerData .= $spData;

                    // save the shape offsets (where new shape records begin)
                    $totalSize += strlen($spData);
                    $spOffsets[] = $totalSize;

                    $spTypes = array_merge($spTypes, $writer->getSpTypes());
                }

                // write the record
                $recVer = 0xF;
                $recInstance = 0x0000;
                $recType = 0xF003;
                $length = strlen($innerData);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header . $innerData;
                $this->spOffsets = $spOffsets;
                $this->spTypes = $spTypes;

                break;
            case SpContainer::class:
                // initialize
                $data = '';

                // build the data

                // write group shape record, if necessary?
                if ($this->object->getSpgr()) {
                    $recVer = 0x1;
                    $recInstance = 0x0000;
                    $recType = 0xF009;
                    $length = 0x00000010;

                    $recVerInstance = $recVer;
                    $recVerInstance |= $recInstance << 4;

                    $header = pack('vvV', $recVerInstance, $recType, $length);

                    $data .= $header . pack('VVVV', 0, 0, 0, 0);
                }
                $this->spTypes[] = ($this->object->getSpType());

                // write the shape record
                $recVer = 0x2;
                $recInstance = $this->object->getSpType(); // shape type
                $recType = 0xF00A;
                $length = 0x00000008;

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $data .= $header . pack('VV', $this->object->getSpId(), $this->object->getSpgr() ? 0x0005 : 0x0A00);

                // the options
                if ($this->object->getOPTCollection()) {
                    $optData = '';

                    $recVer = 0x3;
                    $recInstance = count($this->object->getOPTCollection());
                    $recType = 0xF00B;
                    foreach ($this->object->getOPTCollection() as $property => $value) {
                        $optData .= pack('vV', $property, $value);
                    }
                    $length = strlen($optData);

                    $recVerInstance = $recVer;
                    $recVerInstance |= $recInstance << 4;

                    $header = pack('vvV', $recVerInstance, $recType, $length);
                    $data .= $header . $optData;
                }

                // the client anchor
                if ($this->object->getStartCoordinates()) {
                    $clientAnchorData = '';

                    $recVer = 0x0;
                    $recInstance = 0x0;
                    $recType = 0xF010;

                    // start coordinates
                    [$column, $row] = Coordinate::indexesFromString($this->object->getStartCoordinates());
                    $c1 = $column - 1;
                    $r1 = $row - 1;

                    // start offsetX
                    $startOffsetX = $this->object->getStartOffsetX();

                    // start offsetY
                    $startOffsetY = $this->object->getStartOffsetY();

                    // end coordinates
                    [$column, $row] = Coordinate::indexesFromString($this->object->getEndCoordinates());
                    $c2 = $column - 1;
                    $r2 = $row - 1;

                    // end offsetX
                    $endOffsetX = $this->object->getEndOffsetX();

                    // end offsetY
                    $endOffsetY = $this->object->getEndOffsetY();

                    $clientAnchorData = pack('vvvvvvvvv', $this->object->getSpFlag(), $c1, $startOffsetX, $r1, $startOffsetY, $c2, $endOffsetX, $r2, $endOffsetY);

                    $length = strlen($clientAnchorData);

                    $recVerInstance = $recVer;
                    $recVerInstance |= $recInstance << 4;

                    $header = pack('vvV', $recVerInstance, $recType, $length);
                    $data .= $header . $clientAnchorData;
                }

                // the client data, just empty for now
                if (!$this->object->getSpgr()) {
                    $clientDataData = '';

                    $recVer = 0x0;
                    $recInstance = 0x0;
                    $recType = 0xF011;

                    $length = strlen($clientDataData);

                    $recVerInstance = $recVer;
                    $recVerInstance |= $recInstance << 4;

                    $header = pack('vvV', $recVerInstance, $recType, $length);
                    $data .= $header . $clientDataData;
                }

                // write the record
                $recVer = 0xF;
                $recInstance = 0x0000;
                $recType = 0xF004;
                $length = strlen($data);

                $recVerInstance = $recVer;
                $recVerInstance |= $recInstance << 4;

                $header = pack('vvV', $recVerInstance, $recType, $length);

                $this->data = $header . $data;

                break;
        }

        return $this->data;
    }

    /**
     * Gets the shape offsets.
     *
     * @return array
     */
    public function getSpOffsets()
    {
        return $this->spOffsets;
    }

    /**
     * Gets the shape types.
     *
     * @return array
     */
    public function getSpTypes()
    {
        return $this->spTypes;
    }
}
PK     „«[ñ?Û!¥  ¥    Style/CellFont.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Font;

class CellFont
{
    public static function escapement(Font $font, int $escapement): void
    {
        switch ($escapement) {
            case 0x0001:
                $font->setSuperscript(true);

                break;
            case 0x0002:
                $font->setSubscript(true);

                break;
        }
    }

    /**
     * @var array<int, string>
     */
    protected static $underlineMap = [
        0x01 => Font::UNDERLINE_SINGLE,
        0x02 => Font::UNDERLINE_DOUBLE,
        0x21 => Font::UNDERLINE_SINGLEACCOUNTING,
        0x22 => Font::UNDERLINE_DOUBLEACCOUNTING,
    ];

    public static function underline(Font $font, int $underline): void
    {
        if (array_key_exists($underline, self::$underlineMap)) {
            $font->setUnderline(self::$underlineMap[$underline]);
        }
    }
}
PK     „«[ð[æH  H    Style/Border.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Border as StyleBorder;

class Border
{
    /**
     * @var array<int, string>
     */
    protected static $borderStyleMap = [
        0x00 => StyleBorder::BORDER_NONE,
        0x01 => StyleBorder::BORDER_THIN,
        0x02 => StyleBorder::BORDER_MEDIUM,
        0x03 => StyleBorder::BORDER_DASHED,
        0x04 => StyleBorder::BORDER_DOTTED,
        0x05 => StyleBorder::BORDER_THICK,
        0x06 => StyleBorder::BORDER_DOUBLE,
        0x07 => StyleBorder::BORDER_HAIR,
        0x08 => StyleBorder::BORDER_MEDIUMDASHED,
        0x09 => StyleBorder::BORDER_DASHDOT,
        0x0A => StyleBorder::BORDER_MEDIUMDASHDOT,
        0x0B => StyleBorder::BORDER_DASHDOTDOT,
        0x0C => StyleBorder::BORDER_MEDIUMDASHDOTDOT,
        0x0D => StyleBorder::BORDER_SLANTDASHDOT,
    ];

    public static function lookup(int $index): string
    {
        if (isset(self::$borderStyleMap[$index])) {
            return self::$borderStyleMap[$index];
        }

        return StyleBorder::BORDER_NONE;
    }
}
PK     „«[¬¸u¹›  ›    Style/FillPattern.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Fill;

class FillPattern
{
    /**
     * @var array<int, string>
     */
    protected static $fillPatternMap = [
        0x00 => Fill::FILL_NONE,
        0x01 => Fill::FILL_SOLID,
        0x02 => Fill::FILL_PATTERN_MEDIUMGRAY,
        0x03 => Fill::FILL_PATTERN_DARKGRAY,
        0x04 => Fill::FILL_PATTERN_LIGHTGRAY,
        0x05 => Fill::FILL_PATTERN_DARKHORIZONTAL,
        0x06 => Fill::FILL_PATTERN_DARKVERTICAL,
        0x07 => Fill::FILL_PATTERN_DARKDOWN,
        0x08 => Fill::FILL_PATTERN_DARKUP,
        0x09 => Fill::FILL_PATTERN_DARKGRID,
        0x0A => Fill::FILL_PATTERN_DARKTRELLIS,
        0x0B => Fill::FILL_PATTERN_LIGHTHORIZONTAL,
        0x0C => Fill::FILL_PATTERN_LIGHTVERTICAL,
        0x0D => Fill::FILL_PATTERN_LIGHTDOWN,
        0x0E => Fill::FILL_PATTERN_LIGHTUP,
        0x0F => Fill::FILL_PATTERN_LIGHTGRID,
        0x10 => Fill::FILL_PATTERN_LIGHTTRELLIS,
        0x11 => Fill::FILL_PATTERN_GRAY125,
        0x12 => Fill::FILL_PATTERN_GRAY0625,
    ];

    /**
     * Get fill pattern from index
     * OpenOffice documentation: 2.5.12.
     *
     * @param int $index
     *
     * @return string
     */
    public static function lookup($index)
    {
        if (isset(self::$fillPatternMap[$index])) {
            return self::$fillPatternMap[$index];
        }

        return Fill::FILL_NONE;
    }
}
PK     „«[•YòÃ      Style/CellAlignment.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Alignment;

class CellAlignment
{
    /**
     * @var array<string, int>
     */
    private static $horizontalMap = [
        Alignment::HORIZONTAL_GENERAL => 0,
        Alignment::HORIZONTAL_LEFT => 1,
        Alignment::HORIZONTAL_RIGHT => 3,
        Alignment::HORIZONTAL_CENTER => 2,
        Alignment::HORIZONTAL_CENTER_CONTINUOUS => 6,
        Alignment::HORIZONTAL_JUSTIFY => 5,
    ];

    /**
     * @var array<string, int>
     */
    private static $verticalMap = [
        Alignment::VERTICAL_BOTTOM => 2,
        Alignment::VERTICAL_TOP => 0,
        Alignment::VERTICAL_CENTER => 1,
        Alignment::VERTICAL_JUSTIFY => 3,
    ];

    public static function horizontal(Alignment $alignment): int
    {
        $horizontalAlignment = $alignment->getHorizontal();

        if (is_string($horizontalAlignment) && array_key_exists($horizontalAlignment, self::$horizontalMap)) {
            return self::$horizontalMap[$horizontalAlignment];
        }

        return self::$horizontalMap[Alignment::HORIZONTAL_GENERAL];
    }

    public static function wrap(Alignment $alignment): int
    {
        $wrap = $alignment->getWrapText();

        return ($wrap === true) ? 1 : 0;
    }

    public static function vertical(Alignment $alignment): int
    {
        $verticalAlignment = $alignment->getVertical();

        if (is_string($verticalAlignment) && array_key_exists($verticalAlignment, self::$verticalMap)) {
            return self::$verticalMap[$verticalAlignment];
        }

        return self::$verticalMap[Alignment::VERTICAL_BOTTOM];
    }
}
PK     «[s|dã”	  ”	    CellDataValidation.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Cell\DataValidation;

class CellDataValidation
{
    /**
     * @var array<string, int>
     */
    protected static $validationTypeMap = [
        DataValidation::TYPE_NONE => 0x00,
        DataValidation::TYPE_WHOLE => 0x01,
        DataValidation::TYPE_DECIMAL => 0x02,
        DataValidation::TYPE_LIST => 0x03,
        DataValidation::TYPE_DATE => 0x04,
        DataValidation::TYPE_TIME => 0x05,
        DataValidation::TYPE_TEXTLENGTH => 0x06,
        DataValidation::TYPE_CUSTOM => 0x07,
    ];

    /**
     * @var array<string, int>
     */
    protected static $errorStyleMap = [
        DataValidation::STYLE_STOP => 0x00,
        DataValidation::STYLE_WARNING => 0x01,
        DataValidation::STYLE_INFORMATION => 0x02,
    ];

    /**
     * @var array<string, int>
     */
    protected static $operatorMap = [
        DataValidation::OPERATOR_BETWEEN => 0x00,
        DataValidation::OPERATOR_NOTBETWEEN => 0x01,
        DataValidation::OPERATOR_EQUAL => 0x02,
        DataValidation::OPERATOR_NOTEQUAL => 0x03,
        DataValidation::OPERATOR_GREATERTHAN => 0x04,
        DataValidation::OPERATOR_LESSTHAN => 0x05,
        DataValidation::OPERATOR_GREATERTHANOREQUAL => 0x06,
        DataValidation::OPERATOR_LESSTHANOREQUAL => 0x07,
    ];

    public static function type(DataValidation $dataValidation): int
    {
        $validationType = $dataValidation->getType();

        if (is_string($validationType) && array_key_exists($validationType, self::$validationTypeMap)) {
            return self::$validationTypeMap[$validationType];
        }

        return self::$validationTypeMap[DataValidation::TYPE_NONE];
    }

    public static function errorStyle(DataValidation $dataValidation): int
    {
        $errorStyle = $dataValidation->getErrorStyle();

        if (is_string($errorStyle) && array_key_exists($errorStyle, self::$errorStyleMap)) {
            return self::$errorStyleMap[$errorStyle];
        }

        return self::$errorStyleMap[DataValidation::STYLE_STOP];
    }

    public static function operator(DataValidation $dataValidation): int
    {
        $operator = $dataValidation->getOperator();

        if (is_string($operator) && array_key_exists($operator, self::$operatorMap)) {
            return self::$operatorMap[$operator];
        }

        return self::$operatorMap[DataValidation::OPERATOR_BETWEEN];
    }
}
PK     «[ÔØœÂ Â   Worksheet.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use GdImage;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\RichText\Run;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Shared\Xls;
use PhpOffice\PhpSpreadsheet\Style\Border;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Conditional;
use PhpOffice\PhpSpreadsheet\Style\Protection;
use PhpOffice\PhpSpreadsheet\Worksheet\PageSetup;
use PhpOffice\PhpSpreadsheet\Worksheet\SheetView;
use PhpOffice\PhpSpreadsheet\Writer\Exception as WriterException;

// Original file header of PEAR::Spreadsheet_Excel_Writer_Worksheet (used as the base for this class):
// -----------------------------------------------------------------------------------------
// /*
// *  Module written/ported by Xavier Noguer <xnoguer@rezebra.com>
// *
// *  The majority of this is _NOT_ my code.  I simply ported it from the
// *  PERL Spreadsheet::WriteExcel module.
// *
// *  The author of the Spreadsheet::WriteExcel module is John McNamara
// *  <jmcnamara@cpan.org>
// *
// *  I _DO_ maintain this code, and John McNamara has nothing to do with the
// *  porting of this code to PHP.  Any questions directly related to this
// *  class library should be directed to me.
// *
// *  License Information:
// *
// *    Spreadsheet_Excel_Writer:  A library for generating Excel Spreadsheets
// *    Copyright (c) 2002-2003 Xavier Noguer xnoguer@rezebra.com
// *
// *    This library is free software; you can redistribute it and/or
// *    modify it under the terms of the GNU Lesser General Public
// *    License as published by the Free Software Foundation; either
// *    version 2.1 of the License, or (at your option) any later version.
// *
// *    This library is distributed in the hope that it will be useful,
// *    but WITHOUT ANY WARRANTY; without even the implied warranty of
// *    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// *    Lesser General Public License for more details.
// *
// *    You should have received a copy of the GNU Lesser General Public
// *    License along with this library; if not, write to the Free Software
// *    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
// */
class Worksheet extends BIFFwriter
{
    /**
     * Formula parser.
     *
     * @var \PhpOffice\PhpSpreadsheet\Writer\Xls\Parser
     */
    private $parser;

    /**
     * Maximum number of characters for a string (LABEL record in BIFF5).
     *
     * @var int
     */
    private $xlsStringMaxLength;

    /**
     * Array containing format information for columns.
     *
     * @var array
     */
    private $columnInfo;

    /**
     * Array containing the selected area for the worksheet.
     *
     * @var array
     */
    private $selection;

    /**
     * The active pane for the worksheet.
     *
     * @var int
     */
    private $activePane;

    /**
     * Whether to use outline.
     *
     * @var bool
     */
    private $outlineOn;

    /**
     * Auto outline styles.
     *
     * @var bool
     */
    private $outlineStyle;

    /**
     * Whether to have outline summary below.
     *
     * @var bool
     */
    private $outlineBelow;

    /**
     * Whether to have outline summary at the right.
     *
     * @var bool
     */
    private $outlineRight;

    /**
     * Reference to the total number of strings in the workbook.
     *
     * @var int
     */
    private $stringTotal;

    /**
     * Reference to the number of unique strings in the workbook.
     *
     * @var int
     */
    private $stringUnique;

    /**
     * Reference to the array containing all the unique strings in the workbook.
     *
     * @var array
     */
    private $stringTable;

    /**
     * Color cache.
     */
    private $colors;

    /**
     * Index of first used row (at least 0).
     *
     * @var int
     */
    private $firstRowIndex;

    /**
     * Index of last used row. (no used rows means -1).
     *
     * @var int
     */
    private $lastRowIndex;

    /**
     * Index of first used column (at least 0).
     *
     * @var int
     */
    private $firstColumnIndex;

    /**
     * Index of last used column (no used columns means -1).
     *
     * @var int
     */
    private $lastColumnIndex;

    /**
     * Sheet object.
     *
     * @var \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet
     */
    public $phpSheet;

    /**
     * Count cell style Xfs.
     *
     * @var int
     */
    private $countCellStyleXfs;

    /**
     * Escher object corresponding to MSODRAWING.
     *
     * @var null|\PhpOffice\PhpSpreadsheet\Shared\Escher
     */
    private $escher;

    /**
     * Array of font hashes associated to FONT records index.
     *
     * @var array
     */
    public $fontHashIndex;

    /**
     * @var bool
     */
    private $preCalculateFormulas;

    /**
     * @var int
     */
    private $printHeaders;

    /**
     * Constructor.
     *
     * @param int $str_total Total number of strings
     * @param int $str_unique Total number of unique strings
     * @param array $str_table String Table
     * @param array $colors Colour Table
     * @param Parser $parser The formula parser created for the Workbook
     * @param bool $preCalculateFormulas Flag indicating whether formulas should be calculated or just written
     * @param \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet $phpSheet The worksheet to write
     */
    public function __construct(&$str_total, &$str_unique, &$str_table, &$colors, Parser $parser, $preCalculateFormulas, \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet $phpSheet)
    {
        // It needs to call its parent's constructor explicitly
        parent::__construct();

        $this->preCalculateFormulas = $preCalculateFormulas;
        $this->stringTotal = &$str_total;
        $this->stringUnique = &$str_unique;
        $this->stringTable = &$str_table;
        $this->colors = &$colors;
        $this->parser = $parser;

        $this->phpSheet = $phpSheet;

        $this->xlsStringMaxLength = 255;
        $this->columnInfo = [];
        $this->selection = [0, 0, 0, 0];
        $this->activePane = 3;

        $this->printHeaders = 0;

        $this->outlineStyle = false;
        $this->outlineBelow = true;
        $this->outlineRight = true;
        $this->outlineOn = true;

        $this->fontHashIndex = [];

        // calculate values for DIMENSIONS record
        $minR = 1;
        $minC = 'A';

        $maxR = $this->phpSheet->getHighestRow();
        $maxC = $this->phpSheet->getHighestColumn();

        // Determine lowest and highest column and row
        $this->firstRowIndex = $minR;
        $this->lastRowIndex = ($maxR > 65535) ? 65535 : $maxR;

        $this->firstColumnIndex = Coordinate::columnIndexFromString($minC);
        $this->lastColumnIndex = Coordinate::columnIndexFromString($maxC);

        if ($this->lastColumnIndex > 255) {
            $this->lastColumnIndex = 255;
        }

        $this->countCellStyleXfs = count($phpSheet->getParent()->getCellStyleXfCollection());
    }

    /**
     * Add data to the beginning of the workbook (note the reverse order)
     * and to the end of the workbook.
     *
     * @see \PhpOffice\PhpSpreadsheet\Writer\Xls\Workbook::storeWorkbook()
     */
    public function close(): void
    {
        $phpSheet = $this->phpSheet;

        // Storing selected cells and active sheet because it changes while parsing cells with formulas.
        $selectedCells = $this->phpSheet->getSelectedCells();
        $activeSheetIndex = $this->phpSheet->getParent()->getActiveSheetIndex();

        // Write BOF record
        $this->storeBof(0x0010);

        // Write PRINTHEADERS
        $this->writePrintHeaders();

        // Write PRINTGRIDLINES
        $this->writePrintGridlines();

        // Write GRIDSET
        $this->writeGridset();

        // Calculate column widths
        $phpSheet->calculateColumnWidths();

        // Column dimensions
        if (($defaultWidth = $phpSheet->getDefaultColumnDimension()->getWidth()) < 0) {
            $defaultWidth = \PhpOffice\PhpSpreadsheet\Shared\Font::getDefaultColumnWidthByFont($phpSheet->getParent()->getDefaultStyle()->getFont());
        }

        $columnDimensions = $phpSheet->getColumnDimensions();
        $maxCol = $this->lastColumnIndex - 1;
        for ($i = 0; $i <= $maxCol; ++$i) {
            $hidden = 0;
            $level = 0;
            $xfIndex = 15; // there are 15 cell style Xfs

            $width = $defaultWidth;

            $columnLetter = Coordinate::stringFromColumnIndex($i + 1);
            if (isset($columnDimensions[$columnLetter])) {
                $columnDimension = $columnDimensions[$columnLetter];
                if ($columnDimension->getWidth() >= 0) {
                    $width = $columnDimension->getWidth();
                }
                $hidden = $columnDimension->getVisible() ? 0 : 1;
                $level = $columnDimension->getOutlineLevel();
                $xfIndex = $columnDimension->getXfIndex() + 15; // there are 15 cell style Xfs
            }

            // Components of columnInfo:
            // $firstcol first column on the range
            // $lastcol  last column on the range
            // $width    width to set
            // $xfIndex  The optional cell style Xf index to apply to the columns
            // $hidden   The optional hidden atribute
            // $level    The optional outline level
            $this->columnInfo[] = [$i, $i, $width, $xfIndex, $hidden, $level];
        }

        // Write GUTS
        $this->writeGuts();

        // Write DEFAULTROWHEIGHT
        $this->writeDefaultRowHeight();
        // Write WSBOOL
        $this->writeWsbool();
        // Write horizontal and vertical page breaks
        $this->writeBreaks();
        // Write page header
        $this->writeHeader();
        // Write page footer
        $this->writeFooter();
        // Write page horizontal centering
        $this->writeHcenter();
        // Write page vertical centering
        $this->writeVcenter();
        // Write left margin
        $this->writeMarginLeft();
        // Write right margin
        $this->writeMarginRight();
        // Write top margin
        $this->writeMarginTop();
        // Write bottom margin
        $this->writeMarginBottom();
        // Write page setup
        $this->writeSetup();
        // Write sheet protection
        $this->writeProtect();
        // Write SCENPROTECT
        $this->writeScenProtect();
        // Write OBJECTPROTECT
        $this->writeObjectProtect();
        // Write sheet password
        $this->writePassword();
        // Write DEFCOLWIDTH record
        $this->writeDefcol();

        // Write the COLINFO records if they exist
        if (!empty($this->columnInfo)) {
            $colcount = count($this->columnInfo);
            for ($i = 0; $i < $colcount; ++$i) {
                $this->writeColinfo($this->columnInfo[$i]);
            }
        }
        $autoFilterRange = $phpSheet->getAutoFilter()->getRange();
        if (!empty($autoFilterRange)) {
            // Write AUTOFILTERINFO
            $this->writeAutoFilterInfo();
        }

        // Write sheet dimensions
        $this->writeDimensions();

        // Row dimensions
        foreach ($phpSheet->getRowDimensions() as $rowDimension) {
            $xfIndex = $rowDimension->getXfIndex() + 15; // there are 15 cellXfs
            $this->writeRow(
                $rowDimension->getRowIndex() - 1,
                (int) $rowDimension->getRowHeight(),
                $xfIndex,
                !$rowDimension->getVisible(),
                $rowDimension->getOutlineLevel()
            );
        }

        // Write Cells
        foreach ($phpSheet->getCoordinates() as $coordinate) {
            $cell = $phpSheet->getCell($coordinate);
            $row = $cell->getRow() - 1;
            $column = Coordinate::columnIndexFromString($cell->getColumn()) - 1;

            // Don't break Excel break the code!
            if ($row > 65535 || $column > 255) {
                throw new WriterException('Rows or columns overflow! Excel5 has limit to 65535 rows and 255 columns. Use XLSX instead.');
            }

            // Write cell value
            $xfIndex = $cell->getXfIndex() + 15; // there are 15 cell style Xfs

            $cVal = $cell->getValue();
            if ($cVal instanceof RichText) {
                $arrcRun = [];
                $str_pos = 0;
                $elements = $cVal->getRichTextElements();
                foreach ($elements as $element) {
                    // FONT Index
                    if ($element instanceof Run) {
                        $str_fontidx = $this->fontHashIndex[$element->getFont()->getHashCode()];
                    } else {
                        $str_fontidx = 0;
                    }
                    $arrcRun[] = ['strlen' => $str_pos, 'fontidx' => $str_fontidx];
                    // Position FROM
                    $str_pos += StringHelper::countCharacters($element->getText(), 'UTF-8');
                }
                $this->writeRichTextString($row, $column, $cVal->getPlainText(), $xfIndex, $arrcRun);
            } else {
                switch ($cell->getDatatype()) {
                    case DataType::TYPE_STRING:
                    case DataType::TYPE_NULL:
                        if ($cVal === '' || $cVal === null) {
                            $this->writeBlank($row, $column, $xfIndex);
                        } else {
                            $this->writeString($row, $column, $cVal, $xfIndex);
                        }

                        break;
                    case DataType::TYPE_NUMERIC:
                        $this->writeNumber($row, $column, $cVal, $xfIndex);

                        break;
                    case DataType::TYPE_FORMULA:
                        $calculatedValue = $this->preCalculateFormulas ?
                            $cell->getCalculatedValue() : null;
                        if (self::WRITE_FORMULA_EXCEPTION == $this->writeFormula($row, $column, $cVal, $xfIndex, $calculatedValue)) {
                            if ($calculatedValue === null) {
                                $calculatedValue = $cell->getCalculatedValue();
                            }
                            $calctype = gettype($calculatedValue);
                            switch ($calctype) {
                                case 'integer':
                                case 'double':
                                    $this->writeNumber($row, $column, $calculatedValue, $xfIndex);

                                    break;
                                case 'string':
                                    $this->writeString($row, $column, $calculatedValue, $xfIndex);

                                    break;
                                case 'boolean':
                                    $this->writeBoolErr($row, $column, $calculatedValue, 0, $xfIndex);

                                    break;
                                default:
                                    $this->writeString($row, $column, $cVal, $xfIndex);
                            }
                        }

                        break;
                    case DataType::TYPE_BOOL:
                        $this->writeBoolErr($row, $column, $cVal, 0, $xfIndex);

                        break;
                    case DataType::TYPE_ERROR:
                        $this->writeBoolErr($row, $column, ErrorCode::error($cVal), 1, $xfIndex);

                        break;
                }
            }
        }

        // Append
        $this->writeMsoDrawing();

        // Restoring active sheet.
        $this->phpSheet->getParent()->setActiveSheetIndex($activeSheetIndex);

        // Write WINDOW2 record
        $this->writeWindow2();

        // Write PLV record
        $this->writePageLayoutView();

        // Write ZOOM record
        $this->writeZoom();
        if ($phpSheet->getFreezePane()) {
            $this->writePanes();
        }

        // Restoring selected cells.
        $this->phpSheet->setSelectedCells($selectedCells);

        // Write SELECTION record
        $this->writeSelection();

        // Write MergedCellsTable Record
        $this->writeMergedCells();

        // Hyperlinks
        foreach ($phpSheet->getHyperLinkCollection() as $coordinate => $hyperlink) {
            [$column, $row] = Coordinate::indexesFromString($coordinate);

            $url = $hyperlink->getUrl();

            if (strpos($url, 'sheet://') !== false) {
                // internal to current workbook
                $url = str_replace('sheet://', 'internal:', $url);
            } elseif (preg_match('/^(http:|https:|ftp:|mailto:)/', $url)) {
                // URL
            } else {
                // external (local file)
                $url = 'external:' . $url;
            }

            $this->writeUrl($row - 1, $column - 1, $url);
        }

        $this->writeDataValidity();
        $this->writeSheetLayout();

        // Write SHEETPROTECTION record
        $this->writeSheetProtection();
        $this->writeRangeProtection();

        $arrConditionalStyles = $phpSheet->getConditionalStylesCollection();
        if (!empty($arrConditionalStyles)) {
            $arrConditional = [];

            $cfHeaderWritten = false;
            // Write ConditionalFormattingTable records
            foreach ($arrConditionalStyles as $cellCoordinate => $conditionalStyles) {
                foreach ($conditionalStyles as $conditional) {
                    /** @var Conditional $conditional */
                    if (
                        $conditional->getConditionType() == Conditional::CONDITION_EXPRESSION ||
                        $conditional->getConditionType() == Conditional::CONDITION_CELLIS
                    ) {
                        // Write CFHEADER record (only if there are Conditional Styles that we are able to write)
                        if ($cfHeaderWritten === false) {
                            $this->writeCFHeader();
                            $cfHeaderWritten = true;
                        }
                        if (!isset($arrConditional[$conditional->getHashCode()])) {
                            // This hash code has been handled
                            $arrConditional[$conditional->getHashCode()] = true;

                            // Write CFRULE record
                            $this->writeCFRule($conditional);
                        }
                    }
                }
            }
        }

        $this->storeEof();
    }

    /**
     * Write a cell range address in BIFF8
     * always fixed range
     * See section 2.5.14 in OpenOffice.org's Documentation of the Microsoft Excel File Format.
     *
     * @param string $range E.g. 'A1' or 'A1:B6'
     *
     * @return string Binary data
     */
    private function writeBIFF8CellRangeAddressFixed($range)
    {
        $explodes = explode(':', $range);

        // extract first cell, e.g. 'A1'
        $firstCell = $explodes[0];

        // extract last cell, e.g. 'B6'
        if (count($explodes) == 1) {
            $lastCell = $firstCell;
        } else {
            $lastCell = $explodes[1];
        }

        $firstCellCoordinates = Coordinate::indexesFromString($firstCell); // e.g. [0, 1]
        $lastCellCoordinates = Coordinate::indexesFromString($lastCell); // e.g. [1, 6]

        return pack('vvvv', $firstCellCoordinates[1] - 1, $lastCellCoordinates[1] - 1, $firstCellCoordinates[0] - 1, $lastCellCoordinates[0] - 1);
    }

    /**
     * Retrieves data from memory in one chunk, or from disk
     * sized chunks.
     *
     * @return string The data
     */
    public function getData()
    {
        // Return data stored in memory
        if (isset($this->_data)) {
            $tmp = $this->_data;
            $this->_data = null;

            return $tmp;
        }

        // No data to return
        return '';
    }

    /**
     * Set the option to print the row and column headers on the printed page.
     *
     * @param int $print Whether to print the headers or not. Defaults to 1 (print).
     */
    public function printRowColHeaders($print = 1): void
    {
        $this->printHeaders = $print;
    }

    /**
     * This method sets the properties for outlining and grouping. The defaults
     * correspond to Excel's defaults.
     *
     * @param bool $visible
     * @param bool $symbols_below
     * @param bool $symbols_right
     * @param bool $auto_style
     */
    public function setOutline($visible = true, $symbols_below = true, $symbols_right = true, $auto_style = false): void
    {
        $this->outlineOn = $visible;
        $this->outlineBelow = $symbols_below;
        $this->outlineRight = $symbols_right;
        $this->outlineStyle = $auto_style;
    }

    /**
     * Write a double to the specified row and column (zero indexed).
     * An integer can be written as a double. Excel will display an
     * integer. $format is optional.
     *
     * Returns  0 : normal termination
     *         -2 : row or column out of range
     *
     * @param int $row Zero indexed row
     * @param int $col Zero indexed column
     * @param float $num The number to write
     * @param mixed $xfIndex The optional XF format
     *
     * @return int
     */
    private function writeNumber($row, $col, $num, $xfIndex)
    {
        $record = 0x0203; // Record identifier
        $length = 0x000E; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('vvv', $row, $col, $xfIndex);
        $xl_double = pack('d', $num);
        if (self::getByteOrder()) { // if it's Big Endian
            $xl_double = strrev($xl_double);
        }

        $this->append($header . $data . $xl_double);

        return 0;
    }

    /**
     * Write a LABELSST record or a LABEL record. Which one depends on BIFF version.
     *
     * @param int $row Row index (0-based)
     * @param int $col Column index (0-based)
     * @param string $str The string
     * @param int $xfIndex Index to XF record
     */
    private function writeString($row, $col, $str, $xfIndex): void
    {
        $this->writeLabelSst($row, $col, $str, $xfIndex);
    }

    /**
     * Write a LABELSST record or a LABEL record. Which one depends on BIFF version
     * It differs from writeString by the writing of rich text strings.
     *
     * @param int $row Row index (0-based)
     * @param int $col Column index (0-based)
     * @param string $str The string
     * @param int $xfIndex The XF format index for the cell
     * @param array $arrcRun Index to Font record and characters beginning
     */
    private function writeRichTextString($row, $col, $str, $xfIndex, $arrcRun): void
    {
        $record = 0x00FD; // Record identifier
        $length = 0x000A; // Bytes to follow
        $str = StringHelper::UTF8toBIFF8UnicodeShort($str, $arrcRun);

        // check if string is already present
        if (!isset($this->stringTable[$str])) {
            $this->stringTable[$str] = $this->stringUnique++;
        }
        ++$this->stringTotal;

        $header = pack('vv', $record, $length);
        $data = pack('vvvV', $row, $col, $xfIndex, $this->stringTable[$str]);
        $this->append($header . $data);
    }

    /**
     * Write a string to the specified row and column (zero indexed).
     * This is the BIFF8 version (no 255 chars limit).
     * $format is optional.
     *
     * @param int $row Zero indexed row
     * @param int $col Zero indexed column
     * @param string $str The string to write
     * @param mixed $xfIndex The XF format index for the cell
     */
    private function writeLabelSst($row, $col, $str, $xfIndex): void
    {
        $record = 0x00FD; // Record identifier
        $length = 0x000A; // Bytes to follow

        $str = StringHelper::UTF8toBIFF8UnicodeLong($str);

        // check if string is already present
        if (!isset($this->stringTable[$str])) {
            $this->stringTable[$str] = $this->stringUnique++;
        }
        ++$this->stringTotal;

        $header = pack('vv', $record, $length);
        $data = pack('vvvV', $row, $col, $xfIndex, $this->stringTable[$str]);
        $this->append($header . $data);
    }

    /**
     * Write a blank cell to the specified row and column (zero indexed).
     * A blank cell is used to specify formatting without adding a string
     * or a number.
     *
     * A blank cell without a format serves no purpose. Therefore, we don't write
     * a BLANK record unless a format is specified.
     *
     * Returns  0 : normal termination (including no format)
     *         -1 : insufficient number of arguments
     *         -2 : row or column out of range
     *
     * @param int $row Zero indexed row
     * @param int $col Zero indexed column
     * @param mixed $xfIndex The XF format index
     *
     * @return int
     */
    public function writeBlank($row, $col, $xfIndex)
    {
        $record = 0x0201; // Record identifier
        $length = 0x0006; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('vvv', $row, $col, $xfIndex);
        $this->append($header . $data);

        return 0;
    }

    /**
     * Write a boolean or an error type to the specified row and column (zero indexed).
     *
     * @param int $row Row index (0-based)
     * @param int $col Column index (0-based)
     * @param int $value
     * @param bool $isError Error or Boolean?
     * @param int $xfIndex
     *
     * @return int
     */
    private function writeBoolErr($row, $col, $value, $isError, $xfIndex)
    {
        $record = 0x0205;
        $length = 8;

        $header = pack('vv', $record, $length);
        $data = pack('vvvCC', $row, $col, $xfIndex, $value, $isError);
        $this->append($header . $data);

        return 0;
    }

    const WRITE_FORMULA_NORMAL = 0;
    const WRITE_FORMULA_ERRORS = -1;
    const WRITE_FORMULA_RANGE = -2;
    const WRITE_FORMULA_EXCEPTION = -3;

    /**
     * Write a formula to the specified row and column (zero indexed).
     * The textual representation of the formula is passed to the parser in
     * Parser.php which returns a packed binary string.
     *
     * Returns  0 : WRITE_FORMULA_NORMAL  normal termination
     *         -1 : WRITE_FORMULA_ERRORS formula errors (bad formula)
     *         -2 : WRITE_FORMULA_RANGE  row or column out of range
     *         -3 : WRITE_FORMULA_EXCEPTION parse raised exception, probably due to definedname
     *
     * @param int $row Zero indexed row
     * @param int $col Zero indexed column
     * @param string $formula The formula text string
     * @param mixed $xfIndex The XF format index
     * @param mixed $calculatedValue Calculated value
     *
     * @return int
     */
    private function writeFormula($row, $col, $formula, $xfIndex, $calculatedValue)
    {
        $record = 0x0006; // Record identifier
        // Initialize possible additional value for STRING record that should be written after the FORMULA record?
        $stringValue = null;

        // calculated value
        if (isset($calculatedValue)) {
            // Since we can't yet get the data type of the calculated value,
            // we use best effort to determine data type
            if (is_bool($calculatedValue)) {
                // Boolean value
                $num = pack('CCCvCv', 0x01, 0x00, (int) $calculatedValue, 0x00, 0x00, 0xFFFF);
            } elseif (is_int($calculatedValue) || is_float($calculatedValue)) {
                // Numeric value
                $num = pack('d', $calculatedValue);
            } elseif (is_string($calculatedValue)) {
                $errorCodes = DataType::getErrorCodes();
                if (isset($errorCodes[$calculatedValue])) {
                    // Error value
                    $num = pack('CCCvCv', 0x02, 0x00, ErrorCode::error($calculatedValue), 0x00, 0x00, 0xFFFF);
                } elseif ($calculatedValue === '') {
                    // Empty string (and BIFF8)
                    $num = pack('CCCvCv', 0x03, 0x00, 0x00, 0x00, 0x00, 0xFFFF);
                } else {
                    // Non-empty string value (or empty string BIFF5)
                    $stringValue = $calculatedValue;
                    $num = pack('CCCvCv', 0x00, 0x00, 0x00, 0x00, 0x00, 0xFFFF);
                }
            } else {
                // We are really not supposed to reach here
                $num = pack('d', 0x00);
            }
        } else {
            $num = pack('d', 0x00);
        }

        $grbit = 0x03; // Option flags
        $unknown = 0x0000; // Must be zero

        // Strip the '=' or '@' sign at the beginning of the formula string
        if ($formula[0] == '=') {
            $formula = substr($formula, 1);
        } else {
            // Error handling
            $this->writeString($row, $col, 'Unrecognised character for formula', 0);

            return self::WRITE_FORMULA_ERRORS;
        }

        // Parse the formula using the parser in Parser.php
        try {
            $this->parser->parse($formula);
            $formula = $this->parser->toReversePolish();

            $formlen = strlen($formula); // Length of the binary string
            $length = 0x16 + $formlen; // Length of the record data

            $header = pack('vv', $record, $length);

            $data = pack('vvv', $row, $col, $xfIndex)
                . $num
                . pack('vVv', $grbit, $unknown, $formlen);
            $this->append($header . $data . $formula);

            // Append also a STRING record if necessary
            if ($stringValue !== null) {
                $this->writeStringRecord($stringValue);
            }

            return self::WRITE_FORMULA_NORMAL;
        } catch (PhpSpreadsheetException $e) {
            return self::WRITE_FORMULA_EXCEPTION;
        }
    }

    /**
     * Write a STRING record. This.
     *
     * @param string $stringValue
     */
    private function writeStringRecord($stringValue): void
    {
        $record = 0x0207; // Record identifier
        $data = StringHelper::UTF8toBIFF8UnicodeLong($stringValue);

        $length = strlen($data);
        $header = pack('vv', $record, $length);

        $this->append($header . $data);
    }

    /**
     * Write a hyperlink.
     * This is comprised of two elements: the visible label and
     * the invisible link. The visible label is the same as the link unless an
     * alternative string is specified. The label is written using the
     * writeString() method. Therefore the 255 characters string limit applies.
     * $string and $format are optional.
     *
     * The hyperlink can be to a http, ftp, mail, internal sheet (not yet), or external
     * directory url.
     *
     * @param int $row Row
     * @param int $col Column
     * @param string $url URL string
     */
    private function writeUrl($row, $col, $url): void
    {
        // Add start row and col to arg list
        $this->writeUrlRange($row, $col, $row, $col, $url);
    }

    /**
     * This is the more general form of writeUrl(). It allows a hyperlink to be
     * written to a range of cells. This function also decides the type of hyperlink
     * to be written. These are either, Web (http, ftp, mailto), Internal
     * (Sheet1!A1) or external ('c:\temp\foo.xls#Sheet1!A1').
     *
     * @param int $row1 Start row
     * @param int $col1 Start column
     * @param int $row2 End row
     * @param int $col2 End column
     * @param string $url URL string
     *
     * @see writeUrl()
     */
    private function writeUrlRange($row1, $col1, $row2, $col2, $url): void
    {
        // Check for internal/external sheet links or default to web link
        if (preg_match('[^internal:]', $url)) {
            $this->writeUrlInternal($row1, $col1, $row2, $col2, $url);
        }
        if (preg_match('[^external:]', $url)) {
            $this->writeUrlExternal($row1, $col1, $row2, $col2, $url);
        }

        $this->writeUrlWeb($row1, $col1, $row2, $col2, $url);
    }

    /**
     * Used to write http, ftp and mailto hyperlinks.
     * The link type ($options) is 0x03 is the same as absolute dir ref without
     * sheet. However it is differentiated by the $unknown2 data stream.
     *
     * @param int $row1 Start row
     * @param int $col1 Start column
     * @param int $row2 End row
     * @param int $col2 End column
     * @param string $url URL string
     *
     * @see writeUrl()
     */
    public function writeUrlWeb($row1, $col1, $row2, $col2, $url): void
    {
        $record = 0x01B8; // Record identifier

        // Pack the undocumented parts of the hyperlink stream
        $unknown1 = pack('H*', 'D0C9EA79F9BACE118C8200AA004BA90B02000000');
        $unknown2 = pack('H*', 'E0C9EA79F9BACE118C8200AA004BA90B');

        // Pack the option flags
        $options = pack('V', 0x03);

        // Convert URL to a null terminated wchar string
        $url = implode("\0", preg_split("''", $url, -1, PREG_SPLIT_NO_EMPTY));
        $url = $url . "\0\0\0";

        // Pack the length of the URL
        $url_len = pack('V', strlen($url));

        // Calculate the data length
        $length = 0x34 + strlen($url);

        // Pack the header data
        $header = pack('vv', $record, $length);
        $data = pack('vvvv', $row1, $row2, $col1, $col2);

        // Write the packed data
        $this->append($header . $data . $unknown1 . $options . $unknown2 . $url_len . $url);
    }

    /**
     * Used to write internal reference hyperlinks such as "Sheet1!A1".
     *
     * @param int $row1 Start row
     * @param int $col1 Start column
     * @param int $row2 End row
     * @param int $col2 End column
     * @param string $url URL string
     *
     * @see writeUrl()
     */
    private function writeUrlInternal($row1, $col1, $row2, $col2, $url): void
    {
        $record = 0x01B8; // Record identifier

        // Strip URL type
        $url = preg_replace('/^internal:/', '', $url);

        // Pack the undocumented parts of the hyperlink stream
        $unknown1 = pack('H*', 'D0C9EA79F9BACE118C8200AA004BA90B02000000');

        // Pack the option flags
        $options = pack('V', 0x08);

        // Convert the URL type and to a null terminated wchar string
        $url .= "\0";

        // character count
        $url_len = StringHelper::countCharacters($url);
        $url_len = pack('V', $url_len);

        $url = StringHelper::convertEncoding($url, 'UTF-16LE', 'UTF-8');

        // Calculate the data length
        $length = 0x24 + strlen($url);

        // Pack the header data
        $header = pack('vv', $record, $length);
        $data = pack('vvvv', $row1, $row2, $col1, $col2);

        // Write the packed data
        $this->append($header . $data . $unknown1 . $options . $url_len . $url);
    }

    /**
     * Write links to external directory names such as 'c:\foo.xls',
     * c:\foo.xls#Sheet1!A1', '../../foo.xls'. and '../../foo.xls#Sheet1!A1'.
     *
     * Note: Excel writes some relative links with the $dir_long string. We ignore
     * these cases for the sake of simpler code.
     *
     * @param int $row1 Start row
     * @param int $col1 Start column
     * @param int $row2 End row
     * @param int $col2 End column
     * @param string $url URL string
     *
     * @see writeUrl()
     */
    private function writeUrlExternal($row1, $col1, $row2, $col2, $url): void
    {
        // Network drives are different. We will handle them separately
        // MS/Novell network drives and shares start with \\
        if (preg_match('[^external:\\\\]', $url)) {
            return;
        }

        $record = 0x01B8; // Record identifier
        $length = 0x00000; // Bytes to follow

        // Strip URL type and change Unix dir separator to Dos style (if needed)
        //
        $url = preg_replace('/^external:/', '', $url);
        $url = preg_replace('/\//', '\\', $url);

        // Determine if the link is relative or absolute:
        //   relative if link contains no dir separator, "somefile.xls"
        //   relative if link starts with up-dir, "..\..\somefile.xls"
        //   otherwise, absolute

        $absolute = 0x00; // relative path
        if (preg_match('/^[A-Z]:/', $url)) {
            $absolute = 0x02; // absolute path on Windows, e.g. C:\...
        }
        $link_type = 0x01 | $absolute;

        // Determine if the link contains a sheet reference and change some of the
        // parameters accordingly.
        // Split the dir name and sheet name (if it exists)
        $dir_long = $url;
        if (preg_match('/\\#/', $url)) {
            $link_type |= 0x08;
        }

        // Pack the link type
        $link_type = pack('V', $link_type);

        // Calculate the up-level dir count e.g.. (..\..\..\ == 3)
        $up_count = preg_match_all('/\\.\\.\\\\/', $dir_long, $useless);
        $up_count = pack('v', $up_count);

        // Store the short dos dir name (null terminated)
        $dir_short = preg_replace('/\\.\\.\\\\/', '', $dir_long) . "\0";

        // Store the long dir name as a wchar string (non-null terminated)
        $dir_long = $dir_long . "\0";

        // Pack the lengths of the dir strings
        $dir_short_len = pack('V', strlen($dir_short));
        $dir_long_len = pack('V', strlen($dir_long));
        $stream_len = pack('V', 0); //strlen($dir_long) + 0x06);

        // Pack the undocumented parts of the hyperlink stream
        $unknown1 = pack('H*', 'D0C9EA79F9BACE118C8200AA004BA90B02000000');
        $unknown2 = pack('H*', '0303000000000000C000000000000046');
        $unknown3 = pack('H*', 'FFFFADDE000000000000000000000000000000000000000');
        $unknown4 = pack('v', 0x03);

        // Pack the main data stream
        $data = pack('vvvv', $row1, $row2, $col1, $col2) .
            $unknown1 .
            $link_type .
            $unknown2 .
            $up_count .
            $dir_short_len .
            $dir_short .
            $unknown3 .
            $stream_len; /*.
                          $dir_long_len .
                          $unknown4     .
                          $dir_long     .
                          $sheet_len    .
                          $sheet        ;*/

        // Pack the header data
        $length = strlen($data);
        $header = pack('vv', $record, $length);

        // Write the packed data
        $this->append($header . $data);
    }

    /**
     * This method is used to set the height and format for a row.
     *
     * @param int $row The row to set
     * @param int $height Height we are giving to the row.
     *                        Use null to set XF without setting height
     * @param int $xfIndex The optional cell style Xf index to apply to the columns
     * @param bool $hidden The optional hidden attribute
     * @param int $level The optional outline level for row, in range [0,7]
     */
    private function writeRow($row, $height, $xfIndex, $hidden = false, $level = 0): void
    {
        $record = 0x0208; // Record identifier
        $length = 0x0010; // Number of bytes to follow

        $colMic = 0x0000; // First defined column
        $colMac = 0x0000; // Last defined column
        $irwMac = 0x0000; // Used by Excel to optimise loading
        $reserved = 0x0000; // Reserved
        $grbit = 0x0000; // Option flags
        $ixfe = $xfIndex;

        if ($height < 0) {
            $height = null;
        }

        // Use writeRow($row, null, $XF) to set XF format without setting height
        if ($height !== null) {
            $miyRw = $height * 20; // row height
        } else {
            $miyRw = 0xff; // default row height is 256
        }

        // Set the options flags. fUnsynced is used to show that the font and row
        // heights are not compatible. This is usually the case for WriteExcel.
        // The collapsed flag 0x10 doesn't seem to be used to indicate that a row
        // is collapsed. Instead it is used to indicate that the previous row is
        // collapsed. The zero height flag, 0x20, is used to collapse a row.

        $grbit |= $level;
        if ($hidden === true) {
            $grbit |= 0x0030;
        }
        if ($height !== null) {
            $grbit |= 0x0040; // fUnsynced
        }
        if ($xfIndex !== 0xF) {
            $grbit |= 0x0080;
        }
        $grbit |= 0x0100;

        $header = pack('vv', $record, $length);
        $data = pack('vvvvvvvv', $row, $colMic, $colMac, $miyRw, $irwMac, $reserved, $grbit, $ixfe);
        $this->append($header . $data);
    }

    /**
     * Writes Excel DIMENSIONS to define the area in which there is data.
     */
    private function writeDimensions(): void
    {
        $record = 0x0200; // Record identifier

        $length = 0x000E;
        $data = pack('VVvvv', $this->firstRowIndex, $this->lastRowIndex + 1, $this->firstColumnIndex, $this->lastColumnIndex + 1, 0x0000); // reserved

        $header = pack('vv', $record, $length);
        $this->append($header . $data);
    }

    /**
     * Write BIFF record Window2.
     */
    private function writeWindow2(): void
    {
        $record = 0x023E; // Record identifier
        $length = 0x0012;

        $grbit = 0x00B6; // Option flags
        $rwTop = 0x0000; // Top row visible in window
        $colLeft = 0x0000; // Leftmost column visible in window

        // The options flags that comprise $grbit
        $fDspFmla = 0; // 0 - bit
        $fDspGrid = $this->phpSheet->getShowGridlines() ? 1 : 0; // 1
        $fDspRwCol = $this->phpSheet->getShowRowColHeaders() ? 1 : 0; // 2
        $fFrozen = $this->phpSheet->getFreezePane() ? 1 : 0; // 3
        $fDspZeros = 1; // 4
        $fDefaultHdr = 1; // 5
        $fArabic = $this->phpSheet->getRightToLeft() ? 1 : 0; // 6
        $fDspGuts = $this->outlineOn; // 7
        $fFrozenNoSplit = 0; // 0 - bit
        // no support in PhpSpreadsheet for selected sheet, therefore sheet is only selected if it is the active sheet
        $fSelected = ($this->phpSheet === $this->phpSheet->getParent()->getActiveSheet()) ? 1 : 0;
        $fPageBreakPreview = $this->phpSheet->getSheetView()->getView() === SheetView::SHEETVIEW_PAGE_BREAK_PREVIEW;

        $grbit = $fDspFmla;
        $grbit |= $fDspGrid << 1;
        $grbit |= $fDspRwCol << 2;
        $grbit |= $fFrozen << 3;
        $grbit |= $fDspZeros << 4;
        $grbit |= $fDefaultHdr << 5;
        $grbit |= $fArabic << 6;
        $grbit |= $fDspGuts << 7;
        $grbit |= $fFrozenNoSplit << 8;
        $grbit |= $fSelected << 9; // Selected sheets.
        $grbit |= $fSelected << 10; // Active sheet.
        $grbit |= $fPageBreakPreview << 11;

        $header = pack('vv', $record, $length);
        $data = pack('vvv', $grbit, $rwTop, $colLeft);

        // FIXME !!!
        $rgbHdr = 0x0040; // Row/column heading and gridline color index
        $zoom_factor_page_break = ($fPageBreakPreview ? $this->phpSheet->getSheetView()->getZoomScale() : 0x0000);
        $zoom_factor_normal = $this->phpSheet->getSheetView()->getZoomScaleNormal();

        $data .= pack('vvvvV', $rgbHdr, 0x0000, $zoom_factor_page_break, $zoom_factor_normal, 0x00000000);

        $this->append($header . $data);
    }

    /**
     * Write BIFF record DEFAULTROWHEIGHT.
     */
    private function writeDefaultRowHeight(): void
    {
        $defaultRowHeight = $this->phpSheet->getDefaultRowDimension()->getRowHeight();

        if ($defaultRowHeight < 0) {
            return;
        }

        // convert to twips
        $defaultRowHeight = (int) 20 * $defaultRowHeight;

        $record = 0x0225; // Record identifier
        $length = 0x0004; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('vv', 1, $defaultRowHeight);
        $this->append($header . $data);
    }

    /**
     * Write BIFF record DEFCOLWIDTH if COLINFO records are in use.
     */
    private function writeDefcol(): void
    {
        $defaultColWidth = 8;

        $record = 0x0055; // Record identifier
        $length = 0x0002; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('v', $defaultColWidth);
        $this->append($header . $data);
    }

    /**
     * Write BIFF record COLINFO to define column widths.
     *
     * Note: The SDK says the record length is 0x0B but Excel writes a 0x0C
     * length record.
     *
     * @param array $col_array This is the only parameter received and is composed of the following:
     *                0 => First formatted column,
     *                1 => Last formatted column,
     *                2 => Col width (8.43 is Excel default),
     *                3 => The optional XF format of the column,
     *                4 => Option flags.
     *                5 => Optional outline level
     */
    private function writeColinfo($col_array): void
    {
        $colFirst = $col_array[0] ?? null;
        $colLast = $col_array[1] ?? null;
        $coldx = $col_array[2] ?? 8.43;
        $xfIndex = $col_array[3] ?? 15;
        $grbit = $col_array[4] ?? 0;
        $level = $col_array[5] ?? 0;

        $record = 0x007D; // Record identifier
        $length = 0x000C; // Number of bytes to follow

        $coldx *= 256; // Convert to units of 1/256 of a char

        $ixfe = $xfIndex;
        $reserved = 0x0000; // Reserved

        $level = max(0, min($level, 7));
        $grbit |= $level << 8;

        $header = pack('vv', $record, $length);
        $data = pack('vvvvvv', $colFirst, $colLast, $coldx, $ixfe, $grbit, $reserved);
        $this->append($header . $data);
    }

    /**
     * Write BIFF record SELECTION.
     */
    private function writeSelection(): void
    {
        // look up the selected cell range
        $selectedCells = Coordinate::splitRange($this->phpSheet->getSelectedCells());
        $selectedCells = $selectedCells[0];
        if (count($selectedCells) == 2) {
            [$first, $last] = $selectedCells;
        } else {
            $first = $selectedCells[0];
            $last = $selectedCells[0];
        }

        [$colFirst, $rwFirst] = Coordinate::coordinateFromString($first);
        $colFirst = Coordinate::columnIndexFromString($colFirst) - 1; // base 0 column index
        --$rwFirst; // base 0 row index

        [$colLast, $rwLast] = Coordinate::coordinateFromString($last);
        $colLast = Coordinate::columnIndexFromString($colLast) - 1; // base 0 column index
        --$rwLast; // base 0 row index

        // make sure we are not out of bounds
        $colFirst = min($colFirst, 255);
        $colLast = min($colLast, 255);

        $rwFirst = min($rwFirst, 65535);
        $rwLast = min($rwLast, 65535);

        $record = 0x001D; // Record identifier
        $length = 0x000F; // Number of bytes to follow

        $pnn = $this->activePane; // Pane position
        $rwAct = $rwFirst; // Active row
        $colAct = $colFirst; // Active column
        $irefAct = 0; // Active cell ref
        $cref = 1; // Number of refs

        // Swap last row/col for first row/col as necessary
        if ($rwFirst > $rwLast) {
            [$rwFirst, $rwLast] = [$rwLast, $rwFirst];
        }

        if ($colFirst > $colLast) {
            [$colFirst, $colLast] = [$colLast, $colFirst];
        }

        $header = pack('vv', $record, $length);
        $data = pack('CvvvvvvCC', $pnn, $rwAct, $colAct, $irefAct, $cref, $rwFirst, $rwLast, $colFirst, $colLast);
        $this->append($header . $data);
    }

    /**
     * Store the MERGEDCELLS records for all ranges of merged cells.
     */
    private function writeMergedCells(): void
    {
        $mergeCells = $this->phpSheet->getMergeCells();
        $countMergeCells = count($mergeCells);

        if ($countMergeCells == 0) {
            return;
        }

        // maximum allowed number of merged cells per record
        $maxCountMergeCellsPerRecord = 1027;

        // record identifier
        $record = 0x00E5;

        // counter for total number of merged cells treated so far by the writer
        $i = 0;

        // counter for number of merged cells written in record currently being written
        $j = 0;

        // initialize record data
        $recordData = '';

        // loop through the merged cells
        foreach ($mergeCells as $mergeCell) {
            ++$i;
            ++$j;

            // extract the row and column indexes
            $range = Coordinate::splitRange($mergeCell);
            [$first, $last] = $range[0];
            [$firstColumn, $firstRow] = Coordinate::indexesFromString($first);
            [$lastColumn, $lastRow] = Coordinate::indexesFromString($last);

            $recordData .= pack('vvvv', $firstRow - 1, $lastRow - 1, $firstColumn - 1, $lastColumn - 1);

            // flush record if we have reached limit for number of merged cells, or reached final merged cell
            if ($j == $maxCountMergeCellsPerRecord || $i == $countMergeCells) {
                $recordData = pack('v', $j) . $recordData;
                $length = strlen($recordData);
                $header = pack('vv', $record, $length);
                $this->append($header . $recordData);

                // initialize for next record, if any
                $recordData = '';
                $j = 0;
            }
        }
    }

    /**
     * Write SHEETLAYOUT record.
     */
    private function writeSheetLayout(): void
    {
        if (!$this->phpSheet->isTabColorSet()) {
            return;
        }

        $recordData = pack(
            'vvVVVvv',
            0x0862,
            0x0000, // unused
            0x00000000, // unused
            0x00000000, // unused
            0x00000014, // size of record data
            $this->colors[$this->phpSheet->getTabColor()->getRGB()], // color index
            0x0000        // unused
        );

        $length = strlen($recordData);

        $record = 0x0862; // Record identifier
        $header = pack('vv', $record, $length);
        $this->append($header . $recordData);
    }

    /**
     * Write SHEETPROTECTION.
     */
    private function writeSheetProtection(): void
    {
        // record identifier
        $record = 0x0867;

        // prepare options
        $options = (int) !$this->phpSheet->getProtection()->getObjects()
            | (int) !$this->phpSheet->getProtection()->getScenarios() << 1
            | (int) !$this->phpSheet->getProtection()->getFormatCells() << 2
            | (int) !$this->phpSheet->getProtection()->getFormatColumns() << 3
            | (int) !$this->phpSheet->getProtection()->getFormatRows() << 4
            | (int) !$this->phpSheet->getProtection()->getInsertColumns() << 5
            | (int) !$this->phpSheet->getProtection()->getInsertRows() << 6
            | (int) !$this->phpSheet->getProtection()->getInsertHyperlinks() << 7
            | (int) !$this->phpSheet->getProtection()->getDeleteColumns() << 8
            | (int) !$this->phpSheet->getProtection()->getDeleteRows() << 9
            | (int) !$this->phpSheet->getProtection()->getSelectLockedCells() << 10
            | (int) !$this->phpSheet->getProtection()->getSort() << 11
            | (int) !$this->phpSheet->getProtection()->getAutoFilter() << 12
            | (int) !$this->phpSheet->getProtection()->getPivotTables() << 13
            | (int) !$this->phpSheet->getProtection()->getSelectUnlockedCells() << 14;

        // record data
        $recordData = pack(
            'vVVCVVvv',
            0x0867, // repeated record identifier
            0x0000, // not used
            0x0000, // not used
            0x00, // not used
            0x01000200, // unknown data
            0xFFFFFFFF, // unknown data
            $options, // options
            0x0000 // not used
        );

        $length = strlen($recordData);
        $header = pack('vv', $record, $length);

        $this->append($header . $recordData);
    }

    /**
     * Write BIFF record RANGEPROTECTION.
     *
     * Openoffice.org's Documentation of the Microsoft Excel File Format uses term RANGEPROTECTION for these records
     * Microsoft Office Excel 97-2007 Binary File Format Specification uses term FEAT for these records
     */
    private function writeRangeProtection(): void
    {
        foreach ($this->phpSheet->getProtectedCells() as $range => $password) {
            // number of ranges, e.g. 'A1:B3 C20:D25'
            $cellRanges = explode(' ', $range);
            $cref = count($cellRanges);

            $recordData = pack(
                'vvVVvCVvVv',
                0x0868,
                0x00,
                0x0000,
                0x0000,
                0x02,
                0x0,
                0x0000,
                $cref,
                0x0000,
                0x00
            );

            foreach ($cellRanges as $cellRange) {
                $recordData .= $this->writeBIFF8CellRangeAddressFixed($cellRange);
            }

            // the rgbFeat structure
            $recordData .= pack(
                'VV',
                0x0000,
                hexdec($password)
            );

            $recordData .= StringHelper::UTF8toBIFF8UnicodeLong('p' . md5($recordData));

            $length = strlen($recordData);

            $record = 0x0868; // Record identifier
            $header = pack('vv', $record, $length);
            $this->append($header . $recordData);
        }
    }

    /**
     * Writes the Excel BIFF PANE record.
     * The panes can either be frozen or thawed (unfrozen).
     * Frozen panes are specified in terms of an integer number of rows and columns.
     * Thawed panes are specified in terms of Excel's units for rows and columns.
     */
    private function writePanes(): void
    {
        if (!$this->phpSheet->getFreezePane()) {
            // thaw panes
            return;
        }

        [$column, $row] = Coordinate::indexesFromString($this->phpSheet->getFreezePane() ?? '');
        $x = $column - 1;
        $y = $row - 1;

        [$leftMostColumn, $topRow] = Coordinate::indexesFromString($this->phpSheet->getTopLeftCell());
        //Coordinates are zero-based in xls files
        $rwTop = $topRow - 1;
        $colLeft = $leftMostColumn - 1;

        $record = 0x0041; // Record identifier
        $length = 0x000A; // Number of bytes to follow

        // Determine which pane should be active. There is also the undocumented
        // option to override this should it be necessary: may be removed later.
        $pnnAct = null;
        if ($x != 0 && $y != 0) {
            $pnnAct = 0; // Bottom right
        }
        if ($x != 0 && $y == 0) {
            $pnnAct = 1; // Top right
        }
        if ($x == 0 && $y != 0) {
            $pnnAct = 2; // Bottom left
        }
        if ($x == 0 && $y == 0) {
            $pnnAct = 3; // Top left
        }

        $this->activePane = $pnnAct; // Used in writeSelection

        $header = pack('vv', $record, $length);
        $data = pack('vvvvv', $x, $y, $rwTop, $colLeft, $pnnAct);
        $this->append($header . $data);
    }

    /**
     * Store the page setup SETUP BIFF record.
     */
    private function writeSetup(): void
    {
        $record = 0x00A1; // Record identifier
        $length = 0x0022; // Number of bytes to follow

        $iPaperSize = $this->phpSheet->getPageSetup()->getPaperSize(); // Paper size
        $iScale = $this->phpSheet->getPageSetup()->getScale() ?: 100; // Print scaling factor

        $iPageStart = 0x01; // Starting page number
        $iFitWidth = (int) $this->phpSheet->getPageSetup()->getFitToWidth(); // Fit to number of pages wide
        $iFitHeight = (int) $this->phpSheet->getPageSetup()->getFitToHeight(); // Fit to number of pages high
        $grbit = 0x00; // Option flags
        $iRes = 0x0258; // Print resolution
        $iVRes = 0x0258; // Vertical print resolution

        $numHdr = $this->phpSheet->getPageMargins()->getHeader(); // Header Margin

        $numFtr = $this->phpSheet->getPageMargins()->getFooter(); // Footer Margin
        $iCopies = 0x01; // Number of copies

        // Order of printing pages
        $fLeftToRight = $this->phpSheet->getPageSetup()->getPageOrder() === PageSetup::PAGEORDER_DOWN_THEN_OVER
            ? 0x1 : 0x0;
        // Page orientation
        $fLandscape = ($this->phpSheet->getPageSetup()->getOrientation() == PageSetup::ORIENTATION_LANDSCAPE)
            ? 0x0 : 0x1;

        $fNoPls = 0x0; // Setup not read from printer
        $fNoColor = 0x0; // Print black and white
        $fDraft = 0x0; // Print draft quality
        $fNotes = 0x0; // Print notes
        $fNoOrient = 0x0; // Orientation not set
        $fUsePage = 0x0; // Use custom starting page

        $grbit = $fLeftToRight;
        $grbit |= $fLandscape << 1;
        $grbit |= $fNoPls << 2;
        $grbit |= $fNoColor << 3;
        $grbit |= $fDraft << 4;
        $grbit |= $fNotes << 5;
        $grbit |= $fNoOrient << 6;
        $grbit |= $fUsePage << 7;

        $numHdr = pack('d', $numHdr);
        $numFtr = pack('d', $numFtr);
        if (self::getByteOrder()) { // if it's Big Endian
            $numHdr = strrev($numHdr);
            $numFtr = strrev($numFtr);
        }

        $header = pack('vv', $record, $length);
        $data1 = pack('vvvvvvvv', $iPaperSize, $iScale, $iPageStart, $iFitWidth, $iFitHeight, $grbit, $iRes, $iVRes);
        $data2 = $numHdr . $numFtr;
        $data3 = pack('v', $iCopies);
        $this->append($header . $data1 . $data2 . $data3);
    }

    /**
     * Store the header caption BIFF record.
     */
    private function writeHeader(): void
    {
        $record = 0x0014; // Record identifier

        /* removing for now
        // need to fix character count (multibyte!)
        if (strlen($this->phpSheet->getHeaderFooter()->getOddHeader()) <= 255) {
            $str      = $this->phpSheet->getHeaderFooter()->getOddHeader();       // header string
        } else {
            $str = '';
        }
        */

        $recordData = StringHelper::UTF8toBIFF8UnicodeLong($this->phpSheet->getHeaderFooter()->getOddHeader());
        $length = strlen($recordData);

        $header = pack('vv', $record, $length);

        $this->append($header . $recordData);
    }

    /**
     * Store the footer caption BIFF record.
     */
    private function writeFooter(): void
    {
        $record = 0x0015; // Record identifier

        /* removing for now
        // need to fix character count (multibyte!)
        if (strlen($this->phpSheet->getHeaderFooter()->getOddFooter()) <= 255) {
            $str = $this->phpSheet->getHeaderFooter()->getOddFooter();
        } else {
            $str = '';
        }
        */

        $recordData = StringHelper::UTF8toBIFF8UnicodeLong($this->phpSheet->getHeaderFooter()->getOddFooter());
        $length = strlen($recordData);

        $header = pack('vv', $record, $length);

        $this->append($header . $recordData);
    }

    /**
     * Store the horizontal centering HCENTER BIFF record.
     */
    private function writeHcenter(): void
    {
        $record = 0x0083; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fHCenter = $this->phpSheet->getPageSetup()->getHorizontalCentered() ? 1 : 0; // Horizontal centering

        $header = pack('vv', $record, $length);
        $data = pack('v', $fHCenter);

        $this->append($header . $data);
    }

    /**
     * Store the vertical centering VCENTER BIFF record.
     */
    private function writeVcenter(): void
    {
        $record = 0x0084; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fVCenter = $this->phpSheet->getPageSetup()->getVerticalCentered() ? 1 : 0; // Horizontal centering

        $header = pack('vv', $record, $length);
        $data = pack('v', $fVCenter);
        $this->append($header . $data);
    }

    /**
     * Store the LEFTMARGIN BIFF record.
     */
    private function writeMarginLeft(): void
    {
        $record = 0x0026; // Record identifier
        $length = 0x0008; // Bytes to follow

        $margin = $this->phpSheet->getPageMargins()->getLeft(); // Margin in inches

        $header = pack('vv', $record, $length);
        $data = pack('d', $margin);
        if (self::getByteOrder()) { // if it's Big Endian
            $data = strrev($data);
        }

        $this->append($header . $data);
    }

    /**
     * Store the RIGHTMARGIN BIFF record.
     */
    private function writeMarginRight(): void
    {
        $record = 0x0027; // Record identifier
        $length = 0x0008; // Bytes to follow

        $margin = $this->phpSheet->getPageMargins()->getRight(); // Margin in inches

        $header = pack('vv', $record, $length);
        $data = pack('d', $margin);
        if (self::getByteOrder()) { // if it's Big Endian
            $data = strrev($data);
        }

        $this->append($header . $data);
    }

    /**
     * Store the TOPMARGIN BIFF record.
     */
    private function writeMarginTop(): void
    {
        $record = 0x0028; // Record identifier
        $length = 0x0008; // Bytes to follow

        $margin = $this->phpSheet->getPageMargins()->getTop(); // Margin in inches

        $header = pack('vv', $record, $length);
        $data = pack('d', $margin);
        if (self::getByteOrder()) { // if it's Big Endian
            $data = strrev($data);
        }

        $this->append($header . $data);
    }

    /**
     * Store the BOTTOMMARGIN BIFF record.
     */
    private function writeMarginBottom(): void
    {
        $record = 0x0029; // Record identifier
        $length = 0x0008; // Bytes to follow

        $margin = $this->phpSheet->getPageMargins()->getBottom(); // Margin in inches

        $header = pack('vv', $record, $length);
        $data = pack('d', $margin);
        if (self::getByteOrder()) { // if it's Big Endian
            $data = strrev($data);
        }

        $this->append($header . $data);
    }

    /**
     * Write the PRINTHEADERS BIFF record.
     */
    private function writePrintHeaders(): void
    {
        $record = 0x002a; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fPrintRwCol = $this->printHeaders; // Boolean flag

        $header = pack('vv', $record, $length);
        $data = pack('v', $fPrintRwCol);
        $this->append($header . $data);
    }

    /**
     * Write the PRINTGRIDLINES BIFF record. Must be used in conjunction with the
     * GRIDSET record.
     */
    private function writePrintGridlines(): void
    {
        $record = 0x002b; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fPrintGrid = $this->phpSheet->getPrintGridlines() ? 1 : 0; // Boolean flag

        $header = pack('vv', $record, $length);
        $data = pack('v', $fPrintGrid);
        $this->append($header . $data);
    }

    /**
     * Write the GRIDSET BIFF record. Must be used in conjunction with the
     * PRINTGRIDLINES record.
     */
    private function writeGridset(): void
    {
        $record = 0x0082; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fGridSet = !$this->phpSheet->getPrintGridlines(); // Boolean flag

        $header = pack('vv', $record, $length);
        $data = pack('v', $fGridSet);
        $this->append($header . $data);
    }

    /**
     * Write the AUTOFILTERINFO BIFF record. This is used to configure the number of autofilter select used in the sheet.
     */
    private function writeAutoFilterInfo(): void
    {
        $record = 0x009D; // Record identifier
        $length = 0x0002; // Bytes to follow

        $rangeBounds = Coordinate::rangeBoundaries($this->phpSheet->getAutoFilter()->getRange());
        $iNumFilters = 1 + $rangeBounds[1][0] - $rangeBounds[0][0];

        $header = pack('vv', $record, $length);
        $data = pack('v', $iNumFilters);
        $this->append($header . $data);
    }

    /**
     * Write the GUTS BIFF record. This is used to configure the gutter margins
     * where Excel outline symbols are displayed. The visibility of the gutters is
     * controlled by a flag in WSBOOL.
     *
     * @see writeWsbool()
     */
    private function writeGuts(): void
    {
        $record = 0x0080; // Record identifier
        $length = 0x0008; // Bytes to follow

        $dxRwGut = 0x0000; // Size of row gutter
        $dxColGut = 0x0000; // Size of col gutter

        // determine maximum row outline level
        $maxRowOutlineLevel = 0;
        foreach ($this->phpSheet->getRowDimensions() as $rowDimension) {
            $maxRowOutlineLevel = max($maxRowOutlineLevel, $rowDimension->getOutlineLevel());
        }

        $col_level = 0;

        // Calculate the maximum column outline level. The equivalent calculation
        // for the row outline level is carried out in writeRow().
        $colcount = count($this->columnInfo);
        for ($i = 0; $i < $colcount; ++$i) {
            $col_level = max($this->columnInfo[$i][5], $col_level);
        }

        // Set the limits for the outline levels (0 <= x <= 7).
        $col_level = max(0, min($col_level, 7));

        // The displayed level is one greater than the max outline levels
        if ($maxRowOutlineLevel) {
            ++$maxRowOutlineLevel;
        }
        if ($col_level) {
            ++$col_level;
        }

        $header = pack('vv', $record, $length);
        $data = pack('vvvv', $dxRwGut, $dxColGut, $maxRowOutlineLevel, $col_level);

        $this->append($header . $data);
    }

    /**
     * Write the WSBOOL BIFF record, mainly for fit-to-page. Used in conjunction
     * with the SETUP record.
     */
    private function writeWsbool(): void
    {
        $record = 0x0081; // Record identifier
        $length = 0x0002; // Bytes to follow
        $grbit = 0x0000;

        // The only option that is of interest is the flag for fit to page. So we
        // set all the options in one go.
        //
        // Set the option flags
        $grbit |= 0x0001; // Auto page breaks visible
        if ($this->outlineStyle) {
            $grbit |= 0x0020; // Auto outline styles
        }
        if ($this->phpSheet->getShowSummaryBelow()) {
            $grbit |= 0x0040; // Outline summary below
        }
        if ($this->phpSheet->getShowSummaryRight()) {
            $grbit |= 0x0080; // Outline summary right
        }
        if ($this->phpSheet->getPageSetup()->getFitToPage()) {
            $grbit |= 0x0100; // Page setup fit to page
        }
        if ($this->outlineOn) {
            $grbit |= 0x0400; // Outline symbols displayed
        }

        $header = pack('vv', $record, $length);
        $data = pack('v', $grbit);
        $this->append($header . $data);
    }

    /**
     * Write the HORIZONTALPAGEBREAKS and VERTICALPAGEBREAKS BIFF records.
     */
    private function writeBreaks(): void
    {
        // initialize
        $vbreaks = [];
        $hbreaks = [];

        foreach ($this->phpSheet->getBreaks() as $cell => $breakType) {
            // Fetch coordinates
            $coordinates = Coordinate::coordinateFromString($cell);

            // Decide what to do by the type of break
            switch ($breakType) {
                case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::BREAK_COLUMN:
                    // Add to list of vertical breaks
                    $vbreaks[] = Coordinate::columnIndexFromString($coordinates[0]) - 1;

                    break;
                case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::BREAK_ROW:
                    // Add to list of horizontal breaks
                    $hbreaks[] = $coordinates[1];

                    break;
                case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::BREAK_NONE:
                default:
                    // Nothing to do
                    break;
            }
        }

        //horizontal page breaks
        if (!empty($hbreaks)) {
            // Sort and filter array of page breaks
            sort($hbreaks, SORT_NUMERIC);
            if ($hbreaks[0] == 0) { // don't use first break if it's 0
                array_shift($hbreaks);
            }

            $record = 0x001b; // Record identifier
            $cbrk = count($hbreaks); // Number of page breaks
            $length = 2 + 6 * $cbrk; // Bytes to follow

            $header = pack('vv', $record, $length);
            $data = pack('v', $cbrk);

            // Append each page break
            foreach ($hbreaks as $hbreak) {
                $data .= pack('vvv', $hbreak, 0x0000, 0x00ff);
            }

            $this->append($header . $data);
        }

        // vertical page breaks
        if (!empty($vbreaks)) {
            // 1000 vertical pagebreaks appears to be an internal Excel 5 limit.
            // It is slightly higher in Excel 97/200, approx. 1026
            $vbreaks = array_slice($vbreaks, 0, 1000);

            // Sort and filter array of page breaks
            sort($vbreaks, SORT_NUMERIC);
            if ($vbreaks[0] == 0) { // don't use first break if it's 0
                array_shift($vbreaks);
            }

            $record = 0x001a; // Record identifier
            $cbrk = count($vbreaks); // Number of page breaks
            $length = 2 + 6 * $cbrk; // Bytes to follow

            $header = pack('vv', $record, $length);
            $data = pack('v', $cbrk);

            // Append each page break
            foreach ($vbreaks as $vbreak) {
                $data .= pack('vvv', $vbreak, 0x0000, 0xffff);
            }

            $this->append($header . $data);
        }
    }

    /**
     * Set the Biff PROTECT record to indicate that the worksheet is protected.
     */
    private function writeProtect(): void
    {
        // Exit unless sheet protection has been specified
        if (!$this->phpSheet->getProtection()->getSheet()) {
            return;
        }

        $record = 0x0012; // Record identifier
        $length = 0x0002; // Bytes to follow

        $fLock = 1; // Worksheet is protected

        $header = pack('vv', $record, $length);
        $data = pack('v', $fLock);

        $this->append($header . $data);
    }

    /**
     * Write SCENPROTECT.
     */
    private function writeScenProtect(): void
    {
        // Exit if sheet protection is not active
        if (!$this->phpSheet->getProtection()->getSheet()) {
            return;
        }

        // Exit if scenarios are not protected
        if (!$this->phpSheet->getProtection()->getScenarios()) {
            return;
        }

        $record = 0x00DD; // Record identifier
        $length = 0x0002; // Bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('v', 1);

        $this->append($header . $data);
    }

    /**
     * Write OBJECTPROTECT.
     */
    private function writeObjectProtect(): void
    {
        // Exit if sheet protection is not active
        if (!$this->phpSheet->getProtection()->getSheet()) {
            return;
        }

        // Exit if objects are not protected
        if (!$this->phpSheet->getProtection()->getObjects()) {
            return;
        }

        $record = 0x0063; // Record identifier
        $length = 0x0002; // Bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('v', 1);

        $this->append($header . $data);
    }

    /**
     * Write the worksheet PASSWORD record.
     */
    private function writePassword(): void
    {
        // Exit unless sheet protection and password have been specified
        if (!$this->phpSheet->getProtection()->getSheet() || !$this->phpSheet->getProtection()->getPassword() || $this->phpSheet->getProtection()->getAlgorithm() !== '') {
            return;
        }

        $record = 0x0013; // Record identifier
        $length = 0x0002; // Bytes to follow

        $wPassword = hexdec($this->phpSheet->getProtection()->getPassword()); // Encoded password

        $header = pack('vv', $record, $length);
        $data = pack('v', $wPassword);

        $this->append($header . $data);
    }

    /**
     * Insert a 24bit bitmap image in a worksheet.
     *
     * @param int $row The row we are going to insert the bitmap into
     * @param int $col The column we are going to insert the bitmap into
     * @param mixed $bitmap The bitmap filename or GD-image resource
     * @param int $x the horizontal position (offset) of the image inside the cell
     * @param int $y the vertical position (offset) of the image inside the cell
     * @param float $scale_x The horizontal scale
     * @param float $scale_y The vertical scale
     */
    public function insertBitmap($row, $col, $bitmap, $x = 0, $y = 0, $scale_x = 1, $scale_y = 1): void
    {
        $bitmap_array = (is_resource($bitmap) || $bitmap instanceof GdImage
            ? $this->processBitmapGd($bitmap)
            : $this->processBitmap($bitmap));
        [$width, $height, $size, $data] = $bitmap_array;

        // Scale the frame of the image.
        $width *= $scale_x;
        $height *= $scale_y;

        // Calculate the vertices of the image and write the OBJ record
        $this->positionImage($col, $row, $x, $y, $width, $height);

        // Write the IMDATA record to store the bitmap data
        $record = 0x007f;
        $length = 8 + $size;
        $cf = 0x09;
        $env = 0x01;
        $lcb = $size;

        $header = pack('vvvvV', $record, $length, $cf, $env, $lcb);
        $this->append($header . $data);
    }

    /**
     * Calculate the vertices that define the position of the image as required by
     * the OBJ record.
     *
     *         +------------+------------+
     *         |     A      |      B     |
     *   +-----+------------+------------+
     *   |     |(x1,y1)     |            |
     *   |  1  |(A1)._______|______      |
     *   |     |    |              |     |
     *   |     |    |              |     |
     *   +-----+----|    BITMAP    |-----+
     *   |     |    |              |     |
     *   |  2  |    |______________.     |
     *   |     |            |        (B2)|
     *   |     |            |     (x2,y2)|
     *   +---- +------------+------------+
     *
     * Example of a bitmap that covers some of the area from cell A1 to cell B2.
     *
     * Based on the width and height of the bitmap we need to calculate 8 vars:
     *     $col_start, $row_start, $col_end, $row_end, $x1, $y1, $x2, $y2.
     * The width and height of the cells are also variable and have to be taken into
     * account.
     * The values of $col_start and $row_start are passed in from the calling
     * function. The values of $col_end and $row_end are calculated by subtracting
     * the width and height of the bitmap from the width and height of the
     * underlying cells.
     * The vertices are expressed as a percentage of the underlying cell width as
     * follows (rhs values are in pixels):
     *
     *       x1 = X / W *1024
     *       y1 = Y / H *256
     *       x2 = (X-1) / W *1024
     *       y2 = (Y-1) / H *256
     *
     *       Where:  X is distance from the left side of the underlying cell
     *               Y is distance from the top of the underlying cell
     *               W is the width of the cell
     *               H is the height of the cell
     * The SDK incorrectly states that the height should be expressed as a
     *        percentage of 1024.
     *
     * @param int $col_start Col containing upper left corner of object
     * @param int $row_start Row containing top left corner of object
     * @param int $x1 Distance to left side of object
     * @param int $y1 Distance to top of object
     * @param int $width Width of image frame
     * @param int $height Height of image frame
     */
    public function positionImage($col_start, $row_start, $x1, $y1, $width, $height): void
    {
        // Initialise end cell to the same as the start cell
        $col_end = $col_start; // Col containing lower right corner of object
        $row_end = $row_start; // Row containing bottom right corner of object

        // Zero the specified offset if greater than the cell dimensions
        if ($x1 >= Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_start + 1))) {
            $x1 = 0;
        }
        if ($y1 >= Xls::sizeRow($this->phpSheet, $row_start + 1)) {
            $y1 = 0;
        }

        $width = $width + $x1 - 1;
        $height = $height + $y1 - 1;

        // Subtract the underlying cell widths to find the end cell of the image
        while ($width >= Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_end + 1))) {
            $width -= Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_end + 1));
            ++$col_end;
        }

        // Subtract the underlying cell heights to find the end cell of the image
        while ($height >= Xls::sizeRow($this->phpSheet, $row_end + 1)) {
            $height -= Xls::sizeRow($this->phpSheet, $row_end + 1);
            ++$row_end;
        }

        // Bitmap isn't allowed to start or finish in a hidden cell, i.e. a cell
        // with zero eight or width.
        //
        if (Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_start + 1)) == 0) {
            return;
        }
        if (Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_end + 1)) == 0) {
            return;
        }
        if (Xls::sizeRow($this->phpSheet, $row_start + 1) == 0) {
            return;
        }
        if (Xls::sizeRow($this->phpSheet, $row_end + 1) == 0) {
            return;
        }

        // Convert the pixel values to the percentage value expected by Excel
        $x1 = $x1 / Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_start + 1)) * 1024;
        $y1 = $y1 / Xls::sizeRow($this->phpSheet, $row_start + 1) * 256;
        $x2 = $width / Xls::sizeCol($this->phpSheet, Coordinate::stringFromColumnIndex($col_end + 1)) * 1024; // Distance to right side of object
        $y2 = $height / Xls::sizeRow($this->phpSheet, $row_end + 1) * 256; // Distance to bottom of object

        $this->writeObjPicture($col_start, $x1, $row_start, $y1, $col_end, $x2, $row_end, $y2);
    }

    /**
     * Store the OBJ record that precedes an IMDATA record. This could be generalise
     * to support other Excel objects.
     *
     * @param int $colL Column containing upper left corner of object
     * @param int $dxL Distance from left side of cell
     * @param int $rwT Row containing top left corner of object
     * @param int $dyT Distance from top of cell
     * @param int $colR Column containing lower right corner of object
     * @param int $dxR Distance from right of cell
     * @param int $rwB Row containing bottom right corner of object
     * @param int $dyB Distance from bottom of cell
     */
    private function writeObjPicture($colL, $dxL, $rwT, $dyT, $colR, $dxR, $rwB, $dyB): void
    {
        $record = 0x005d; // Record identifier
        $length = 0x003c; // Bytes to follow

        $cObj = 0x0001; // Count of objects in file (set to 1)
        $OT = 0x0008; // Object type. 8 = Picture
        $id = 0x0001; // Object ID
        $grbit = 0x0614; // Option flags

        $cbMacro = 0x0000; // Length of FMLA structure
        $Reserved1 = 0x0000; // Reserved
        $Reserved2 = 0x0000; // Reserved

        $icvBack = 0x09; // Background colour
        $icvFore = 0x09; // Foreground colour
        $fls = 0x00; // Fill pattern
        $fAuto = 0x00; // Automatic fill
        $icv = 0x08; // Line colour
        $lns = 0xff; // Line style
        $lnw = 0x01; // Line weight
        $fAutoB = 0x00; // Automatic border
        $frs = 0x0000; // Frame style
        $cf = 0x0009; // Image format, 9 = bitmap
        $Reserved3 = 0x0000; // Reserved
        $cbPictFmla = 0x0000; // Length of FMLA structure
        $Reserved4 = 0x0000; // Reserved
        $grbit2 = 0x0001; // Option flags
        $Reserved5 = 0x0000; // Reserved

        $header = pack('vv', $record, $length);
        $data = pack('V', $cObj);
        $data .= pack('v', $OT);
        $data .= pack('v', $id);
        $data .= pack('v', $grbit);
        $data .= pack('v', $colL);
        $data .= pack('v', $dxL);
        $data .= pack('v', $rwT);
        $data .= pack('v', $dyT);
        $data .= pack('v', $colR);
        $data .= pack('v', $dxR);
        $data .= pack('v', $rwB);
        $data .= pack('v', $dyB);
        $data .= pack('v', $cbMacro);
        $data .= pack('V', $Reserved1);
        $data .= pack('v', $Reserved2);
        $data .= pack('C', $icvBack);
        $data .= pack('C', $icvFore);
        $data .= pack('C', $fls);
        $data .= pack('C', $fAuto);
        $data .= pack('C', $icv);
        $data .= pack('C', $lns);
        $data .= pack('C', $lnw);
        $data .= pack('C', $fAutoB);
        $data .= pack('v', $frs);
        $data .= pack('V', $cf);
        $data .= pack('v', $Reserved3);
        $data .= pack('v', $cbPictFmla);
        $data .= pack('v', $Reserved4);
        $data .= pack('v', $grbit2);
        $data .= pack('V', $Reserved5);

        $this->append($header . $data);
    }

    /**
     * Convert a GD-image into the internal format.
     *
     * @param GdImage|resource $image The image to process
     *
     * @return array Array with data and properties of the bitmap
     */
    public function processBitmapGd($image)
    {
        $width = imagesx($image);
        $height = imagesy($image);

        $data = pack('Vvvvv', 0x000c, $width, $height, 0x01, 0x18);
        for ($j = $height; --$j;) {
            for ($i = 0; $i < $width; ++$i) {
                $color = imagecolorsforindex($image, imagecolorat($image, $i, $j));
                foreach (['red', 'green', 'blue'] as $key) {
                    $color[$key] = $color[$key] + round((255 - $color[$key]) * $color['alpha'] / 127);
                }
                $data .= chr($color['blue']) . chr($color['green']) . chr($color['red']);
            }
            if (3 * $width % 4) {
                $data .= str_repeat("\x00", 4 - 3 * $width % 4);
            }
        }

        return [$width, $height, strlen($data), $data];
    }

    /**
     * Convert a 24 bit bitmap into the modified internal format used by Windows.
     * This is described in BITMAPCOREHEADER and BITMAPCOREINFO structures in the
     * MSDN library.
     *
     * @param string $bitmap The bitmap to process
     *
     * @return array Array with data and properties of the bitmap
     */
    public function processBitmap($bitmap)
    {
        // Open file.
        $bmp_fd = @fopen($bitmap, 'rb');
        if (!$bmp_fd) {
            throw new WriterException("Couldn't import $bitmap");
        }

        // Slurp the file into a string.
        $data = fread($bmp_fd, filesize($bitmap));

        // Check that the file is big enough to be a bitmap.
        if (strlen($data) <= 0x36) {
            throw new WriterException("$bitmap doesn't contain enough data.\n");
        }

        // The first 2 bytes are used to identify the bitmap.
        $identity = unpack('A2ident', $data);
        if ($identity['ident'] != 'BM') {
            throw new WriterException("$bitmap doesn't appear to be a valid bitmap image.\n");
        }

        // Remove bitmap data: ID.
        $data = substr($data, 2);

        // Read and remove the bitmap size. This is more reliable than reading
        // the data size at offset 0x22.
        //
        $size_array = unpack('Vsa', substr($data, 0, 4));
        $size = $size_array['sa'];
        $data = substr($data, 4);
        $size -= 0x36; // Subtract size of bitmap header.
        $size += 0x0C; // Add size of BIFF header.

        // Remove bitmap data: reserved, offset, header length.
        $data = substr($data, 12);

        // Read and remove the bitmap width and height. Verify the sizes.
        $width_and_height = unpack('V2', substr($data, 0, 8));
        $width = $width_and_height[1];
        $height = $width_and_height[2];
        $data = substr($data, 8);
        if ($width > 0xFFFF) {
            throw new WriterException("$bitmap: largest image width supported is 65k.\n");
        }
        if ($height > 0xFFFF) {
            throw new WriterException("$bitmap: largest image height supported is 65k.\n");
        }

        // Read and remove the bitmap planes and bpp data. Verify them.
        $planes_and_bitcount = unpack('v2', substr($data, 0, 4));
        $data = substr($data, 4);
        if ($planes_and_bitcount[2] != 24) { // Bitcount
            throw new WriterException("$bitmap isn't a 24bit true color bitmap.\n");
        }
        if ($planes_and_bitcount[1] != 1) {
            throw new WriterException("$bitmap: only 1 plane supported in bitmap image.\n");
        }

        // Read and remove the bitmap compression. Verify compression.
        $compression = unpack('Vcomp', substr($data, 0, 4));
        $data = substr($data, 4);

        if ($compression['comp'] != 0) {
            throw new WriterException("$bitmap: compression not supported in bitmap image.\n");
        }

        // Remove bitmap data: data size, hres, vres, colours, imp. colours.
        $data = substr($data, 20);

        // Add the BITMAPCOREHEADER data
        $header = pack('Vvvvv', 0x000c, $width, $height, 0x01, 0x18);
        $data = $header . $data;

        return [$width, $height, $size, $data];
    }

    /**
     * Store the window zoom factor. This should be a reduced fraction but for
     * simplicity we will store all fractions with a numerator of 100.
     */
    private function writeZoom(): void
    {
        // If scale is 100 we don't need to write a record
        if ($this->phpSheet->getSheetView()->getZoomScale() == 100) {
            return;
        }

        $record = 0x00A0; // Record identifier
        $length = 0x0004; // Bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('vv', $this->phpSheet->getSheetView()->getZoomScale(), 100);
        $this->append($header . $data);
    }

    /**
     * Get Escher object.
     */
    public function getEscher(): ?\PhpOffice\PhpSpreadsheet\Shared\Escher
    {
        return $this->escher;
    }

    /**
     * Set Escher object.
     */
    public function setEscher(?\PhpOffice\PhpSpreadsheet\Shared\Escher $escher): void
    {
        $this->escher = $escher;
    }

    /**
     * Write MSODRAWING record.
     */
    private function writeMsoDrawing(): void
    {
        // write the Escher stream if necessary
        if (isset($this->escher)) {
            $writer = new Escher($this->escher);
            $data = $writer->close();
            $spOffsets = $writer->getSpOffsets();
            $spTypes = $writer->getSpTypes();
            // write the neccesary MSODRAWING, OBJ records

            // split the Escher stream
            $spOffsets[0] = 0;
            $nm = count($spOffsets) - 1; // number of shapes excluding first shape
            for ($i = 1; $i <= $nm; ++$i) {
                // MSODRAWING record
                $record = 0x00EC; // Record identifier

                // chunk of Escher stream for one shape
                $dataChunk = substr($data, $spOffsets[$i - 1], $spOffsets[$i] - $spOffsets[$i - 1]);

                $length = strlen($dataChunk);
                $header = pack('vv', $record, $length);

                $this->append($header . $dataChunk);

                // OBJ record
                $record = 0x005D; // record identifier
                $objData = '';

                // ftCmo
                if ($spTypes[$i] == 0x00C9) {
                    // Add ftCmo (common object data) subobject
                    $objData .=
                        pack(
                            'vvvvvVVV',
                            0x0015, // 0x0015 = ftCmo
                            0x0012, // length of ftCmo data
                            0x0014, // object type, 0x0014 = filter
                            $i, // object id number, Excel seems to use 1-based index, local for the sheet
                            0x2101, // option flags, 0x2001 is what OpenOffice.org uses
                            0, // reserved
                            0, // reserved
                            0  // reserved
                        );

                    // Add ftSbs Scroll bar subobject
                    $objData .= pack('vv', 0x00C, 0x0014);
                    $objData .= pack('H*', '0000000000000000640001000A00000010000100');
                    // Add ftLbsData (List box data) subobject
                    $objData .= pack('vv', 0x0013, 0x1FEE);
                    $objData .= pack('H*', '00000000010001030000020008005700');
                } else {
                    // Add ftCmo (common object data) subobject
                    $objData .=
                        pack(
                            'vvvvvVVV',
                            0x0015, // 0x0015 = ftCmo
                            0x0012, // length of ftCmo data
                            0x0008, // object type, 0x0008 = picture
                            $i, // object id number, Excel seems to use 1-based index, local for the sheet
                            0x6011, // option flags, 0x6011 is what OpenOffice.org uses
                            0, // reserved
                            0, // reserved
                            0  // reserved
                        );
                }

                // ftEnd
                $objData .=
                    pack(
                        'vv',
                        0x0000, // 0x0000 = ftEnd
                        0x0000  // length of ftEnd data
                    );

                $length = strlen($objData);
                $header = pack('vv', $record, $length);
                $this->append($header . $objData);
            }
        }
    }

    /**
     * Store the DATAVALIDATIONS and DATAVALIDATION records.
     */
    private function writeDataValidity(): void
    {
        // Datavalidation collection
        $dataValidationCollection = $this->phpSheet->getDataValidationCollection();

        // Write data validations?
        if (!empty($dataValidationCollection)) {
            // DATAVALIDATIONS record
            $record = 0x01B2; // Record identifier
            $length = 0x0012; // Bytes to follow

            $grbit = 0x0000; // Prompt box at cell, no cached validity data at DV records
            $horPos = 0x00000000; // Horizontal position of prompt box, if fixed position
            $verPos = 0x00000000; // Vertical position of prompt box, if fixed position
            $objId = 0xFFFFFFFF; // Object identifier of drop down arrow object, or -1 if not visible

            $header = pack('vv', $record, $length);
            $data = pack('vVVVV', $grbit, $horPos, $verPos, $objId, count($dataValidationCollection));
            $this->append($header . $data);

            // DATAVALIDATION records
            $record = 0x01BE; // Record identifier

            foreach ($dataValidationCollection as $cellCoordinate => $dataValidation) {
                // options
                $options = 0x00000000;

                // data type
                $type = CellDataValidation::type($dataValidation);

                $options |= $type << 0;

                // error style
                $errorStyle = CellDataValidation::errorStyle($dataValidation);

                $options |= $errorStyle << 4;

                // explicit formula?
                if ($type == 0x03 && preg_match('/^\".*\"$/', $dataValidation->getFormula1())) {
                    $options |= 0x01 << 7;
                }

                // empty cells allowed
                $options |= $dataValidation->getAllowBlank() << 8;

                // show drop down
                $options |= (!$dataValidation->getShowDropDown()) << 9;

                // show input message
                $options |= $dataValidation->getShowInputMessage() << 18;

                // show error message
                $options |= $dataValidation->getShowErrorMessage() << 19;

                // condition operator
                $operator = CellDataValidation::operator($dataValidation);

                $options |= $operator << 20;

                $data = pack('V', $options);

                // prompt title
                $promptTitle = $dataValidation->getPromptTitle() !== '' ?
                    $dataValidation->getPromptTitle() : chr(0);
                $data .= StringHelper::UTF8toBIFF8UnicodeLong($promptTitle);

                // error title
                $errorTitle = $dataValidation->getErrorTitle() !== '' ?
                    $dataValidation->getErrorTitle() : chr(0);
                $data .= StringHelper::UTF8toBIFF8UnicodeLong($errorTitle);

                // prompt text
                $prompt = $dataValidation->getPrompt() !== '' ?
                    $dataValidation->getPrompt() : chr(0);
                $data .= StringHelper::UTF8toBIFF8UnicodeLong($prompt);

                // error text
                $error = $dataValidation->getError() !== '' ?
                    $dataValidation->getError() : chr(0);
                $data .= StringHelper::UTF8toBIFF8UnicodeLong($error);

                // formula 1
                try {
                    $formula1 = $dataValidation->getFormula1();
                    if ($type == 0x03) { // list type
                        $formula1 = str_replace(',', chr(0), $formula1);
                    }
                    $this->parser->parse($formula1);
                    $formula1 = $this->parser->toReversePolish();
                    $sz1 = strlen($formula1);
                } catch (PhpSpreadsheetException $e) {
                    $sz1 = 0;
                    $formula1 = '';
                }
                $data .= pack('vv', $sz1, 0x0000);
                $data .= $formula1;

                // formula 2
                try {
                    $formula2 = $dataValidation->getFormula2();
                    if ($formula2 === '') {
                        throw new WriterException('No formula2');
                    }
                    $this->parser->parse($formula2);
                    $formula2 = $this->parser->toReversePolish();
                    $sz2 = strlen($formula2);
                } catch (PhpSpreadsheetException $e) {
                    $sz2 = 0;
                    $formula2 = '';
                }
                $data .= pack('vv', $sz2, 0x0000);
                $data .= $formula2;

                // cell range address list
                $data .= pack('v', 0x0001);
                $data .= $this->writeBIFF8CellRangeAddressFixed($cellCoordinate);

                $length = strlen($data);
                $header = pack('vv', $record, $length);

                $this->append($header . $data);
            }
        }
    }

    /**
     * Write PLV Record.
     */
    private function writePageLayoutView(): void
    {
        $record = 0x088B; // Record identifier
        $length = 0x0010; // Bytes to follow

        $rt = 0x088B; // 2
        $grbitFrt = 0x0000; // 2
        $reserved = 0x0000000000000000; // 8
        $wScalvePLV = $this->phpSheet->getSheetView()->getZoomScale(); // 2

        // The options flags that comprise $grbit
        if ($this->phpSheet->getSheetView()->getView() == SheetView::SHEETVIEW_PAGE_LAYOUT) {
            $fPageLayoutView = 1;
        } else {
            $fPageLayoutView = 0;
        }
        $fRulerVisible = 0;
        $fWhitespaceHidden = 0;

        $grbit = $fPageLayoutView; // 2
        $grbit |= $fRulerVisible << 1;
        $grbit |= $fWhitespaceHidden << 3;

        $header = pack('vv', $record, $length);
        $data = pack('vvVVvv', $rt, $grbitFrt, 0x00000000, 0x00000000, $wScalvePLV, $grbit);
        $this->append($header . $data);
    }

    /**
     * Write CFRule Record.
     */
    private function writeCFRule(Conditional $conditional): void
    {
        $record = 0x01B1; // Record identifier
        $type = null;  //  Type of the CF
        $operatorType = null;   //  Comparison operator

        if ($conditional->getConditionType() == Conditional::CONDITION_EXPRESSION) {
            $type = 0x02;
            $operatorType = 0x00;
        } elseif ($conditional->getConditionType() == Conditional::CONDITION_CELLIS) {
            $type = 0x01;

            switch ($conditional->getOperatorType()) {
                case Conditional::OPERATOR_NONE:
                    $operatorType = 0x00;

                    break;
                case Conditional::OPERATOR_EQUAL:
                    $operatorType = 0x03;

                    break;
                case Conditional::OPERATOR_GREATERTHAN:
                    $operatorType = 0x05;

                    break;
                case Conditional::OPERATOR_GREATERTHANOREQUAL:
                    $operatorType = 0x07;

                    break;
                case Conditional::OPERATOR_LESSTHAN:
                    $operatorType = 0x06;

                    break;
                case Conditional::OPERATOR_LESSTHANOREQUAL:
                    $operatorType = 0x08;

                    break;
                case Conditional::OPERATOR_NOTEQUAL:
                    $operatorType = 0x04;

                    break;
                case Conditional::OPERATOR_BETWEEN:
                    $operatorType = 0x01;

                    break;
                // not OPERATOR_NOTBETWEEN 0x02
            }
        }

        // $szValue1 : size of the formula data for first value or formula
        // $szValue2 : size of the formula data for second value or formula
        $arrConditions = $conditional->getConditions();
        $numConditions = count($arrConditions);
        if ($numConditions == 1) {
            $szValue1 = ($arrConditions[0] <= 65535 ? 3 : 0x0000);
            $szValue2 = 0x0000;
            $operand1 = pack('Cv', 0x1E, $arrConditions[0]);
            $operand2 = null;
        } elseif ($numConditions == 2 && ($conditional->getOperatorType() == Conditional::OPERATOR_BETWEEN)) {
            $szValue1 = ($arrConditions[0] <= 65535 ? 3 : 0x0000);
            $szValue2 = ($arrConditions[1] <= 65535 ? 3 : 0x0000);
            $operand1 = pack('Cv', 0x1E, $arrConditions[0]);
            $operand2 = pack('Cv', 0x1E, $arrConditions[1]);
        } else {
            $szValue1 = 0x0000;
            $szValue2 = 0x0000;
            $operand1 = null;
            $operand2 = null;
        }

        // $flags : Option flags
        // Alignment
        $bAlignHz = ($conditional->getStyle()->getAlignment()->getHorizontal() === null ? 1 : 0);
        $bAlignVt = ($conditional->getStyle()->getAlignment()->getVertical() === null ? 1 : 0);
        $bAlignWrapTx = ($conditional->getStyle()->getAlignment()->getWrapText() === false ? 1 : 0);
        $bTxRotation = ($conditional->getStyle()->getAlignment()->getTextRotation() === null ? 1 : 0);
        $bIndent = ($conditional->getStyle()->getAlignment()->getIndent() === 0 ? 1 : 0);
        $bShrinkToFit = ($conditional->getStyle()->getAlignment()->getShrinkToFit() === false ? 1 : 0);
        if ($bAlignHz == 0 || $bAlignVt == 0 || $bAlignWrapTx == 0 || $bTxRotation == 0 || $bIndent == 0 || $bShrinkToFit == 0) {
            $bFormatAlign = 1;
        } else {
            $bFormatAlign = 0;
        }
        // Protection
        $bProtLocked = ($conditional->getStyle()->getProtection()->getLocked() == null ? 1 : 0);
        $bProtHidden = ($conditional->getStyle()->getProtection()->getHidden() == null ? 1 : 0);
        if ($bProtLocked == 0 || $bProtHidden == 0) {
            $bFormatProt = 1;
        } else {
            $bFormatProt = 0;
        }
        // Border
        $bBorderLeft = ($conditional->getStyle()->getBorders()->getLeft()->getColor()->getARGB() == Color::COLOR_BLACK
        && $conditional->getStyle()->getBorders()->getLeft()->getBorderStyle() == Border::BORDER_NONE ? 1 : 0);
        $bBorderRight = ($conditional->getStyle()->getBorders()->getRight()->getColor()->getARGB() == Color::COLOR_BLACK
        && $conditional->getStyle()->getBorders()->getRight()->getBorderStyle() == Border::BORDER_NONE ? 1 : 0);
        $bBorderTop = ($conditional->getStyle()->getBorders()->getTop()->getColor()->getARGB() == Color::COLOR_BLACK
        && $conditional->getStyle()->getBorders()->getTop()->getBorderStyle() == Border::BORDER_NONE ? 1 : 0);
        $bBorderBottom = ($conditional->getStyle()->getBorders()->getBottom()->getColor()->getARGB() == Color::COLOR_BLACK
        && $conditional->getStyle()->getBorders()->getBottom()->getBorderStyle() == Border::BORDER_NONE ? 1 : 0);
        if ($bBorderLeft == 0 || $bBorderRight == 0 || $bBorderTop == 0 || $bBorderBottom == 0) {
            $bFormatBorder = 1;
        } else {
            $bFormatBorder = 0;
        }
        // Pattern
        $bFillStyle = ($conditional->getStyle()->getFill()->getFillType() === null ? 0 : 1);
        $bFillColor = ($conditional->getStyle()->getFill()->getStartColor()->getARGB() == null ? 0 : 1);
        $bFillColorBg = ($conditional->getStyle()->getFill()->getEndColor()->getARGB() == null ? 0 : 1);
        if ($bFillStyle == 0 || $bFillColor == 0 || $bFillColorBg == 0) {
            $bFormatFill = 1;
        } else {
            $bFormatFill = 0;
        }
        // Font
        if (
            $conditional->getStyle()->getFont()->getName() !== null
            || $conditional->getStyle()->getFont()->getSize() !== null
            || $conditional->getStyle()->getFont()->getBold() !== null
            || $conditional->getStyle()->getFont()->getItalic() !== null
            || $conditional->getStyle()->getFont()->getSuperscript() !== null
            || $conditional->getStyle()->getFont()->getSubscript() !== null
            || $conditional->getStyle()->getFont()->getUnderline() !== null
            || $conditional->getStyle()->getFont()->getStrikethrough() !== null
            || $conditional->getStyle()->getFont()->getColor()->getARGB() != null
        ) {
            $bFormatFont = 1;
        } else {
            $bFormatFont = 0;
        }
        // Alignment
        $flags = 0;
        $flags |= (1 == $bAlignHz ? 0x00000001 : 0);
        $flags |= (1 == $bAlignVt ? 0x00000002 : 0);
        $flags |= (1 == $bAlignWrapTx ? 0x00000004 : 0);
        $flags |= (1 == $bTxRotation ? 0x00000008 : 0);
        // Justify last line flag
        $flags |= (1 == 1 ? 0x00000010 : 0);
        $flags |= (1 == $bIndent ? 0x00000020 : 0);
        $flags |= (1 == $bShrinkToFit ? 0x00000040 : 0);
        // Default
        $flags |= (1 == 1 ? 0x00000080 : 0);
        // Protection
        $flags |= (1 == $bProtLocked ? 0x00000100 : 0);
        $flags |= (1 == $bProtHidden ? 0x00000200 : 0);
        // Border
        $flags |= (1 == $bBorderLeft ? 0x00000400 : 0);
        $flags |= (1 == $bBorderRight ? 0x00000800 : 0);
        $flags |= (1 == $bBorderTop ? 0x00001000 : 0);
        $flags |= (1 == $bBorderBottom ? 0x00002000 : 0);
        $flags |= (1 == 1 ? 0x00004000 : 0); // Top left to Bottom right border
        $flags |= (1 == 1 ? 0x00008000 : 0); // Bottom left to Top right border
        // Pattern
        $flags |= (1 == $bFillStyle ? 0x00010000 : 0);
        $flags |= (1 == $bFillColor ? 0x00020000 : 0);
        $flags |= (1 == $bFillColorBg ? 0x00040000 : 0);
        $flags |= (1 == 1 ? 0x00380000 : 0);
        // Font
        $flags |= (1 == $bFormatFont ? 0x04000000 : 0);
        // Alignment:
        $flags |= (1 == $bFormatAlign ? 0x08000000 : 0);
        // Border
        $flags |= (1 == $bFormatBorder ? 0x10000000 : 0);
        // Pattern
        $flags |= (1 == $bFormatFill ? 0x20000000 : 0);
        // Protection
        $flags |= (1 == $bFormatProt ? 0x40000000 : 0);
        // Text direction
        $flags |= (1 == 0 ? 0x80000000 : 0);

        $dataBlockFont = null;
        $dataBlockAlign = null;
        $dataBlockBorder = null;
        $dataBlockFill = null;

        // Data Blocks
        if ($bFormatFont == 1) {
            // Font Name
            if ($conditional->getStyle()->getFont()->getName() === null) {
                $dataBlockFont = pack('VVVVVVVV', 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000);
                $dataBlockFont .= pack('VVVVVVVV', 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000);
            } else {
                $dataBlockFont = StringHelper::UTF8toBIFF8UnicodeLong($conditional->getStyle()->getFont()->getName());
            }
            // Font Size
            if ($conditional->getStyle()->getFont()->getSize() === null) {
                $dataBlockFont .= pack('V', 20 * 11);
            } else {
                $dataBlockFont .= pack('V', 20 * $conditional->getStyle()->getFont()->getSize());
            }
            // Font Options
            $dataBlockFont .= pack('V', 0);
            // Font weight
            if ($conditional->getStyle()->getFont()->getBold() === true) {
                $dataBlockFont .= pack('v', 0x02BC);
            } else {
                $dataBlockFont .= pack('v', 0x0190);
            }
            // Escapement type
            if ($conditional->getStyle()->getFont()->getSubscript() === true) {
                $dataBlockFont .= pack('v', 0x02);
                $fontEscapement = 0;
            } elseif ($conditional->getStyle()->getFont()->getSuperscript() === true) {
                $dataBlockFont .= pack('v', 0x01);
                $fontEscapement = 0;
            } else {
                $dataBlockFont .= pack('v', 0x00);
                $fontEscapement = 1;
            }
            // Underline type
            switch ($conditional->getStyle()->getFont()->getUnderline()) {
                case \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_NONE:
                    $dataBlockFont .= pack('C', 0x00);
                    $fontUnderline = 0;

                    break;
                case \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_DOUBLE:
                    $dataBlockFont .= pack('C', 0x02);
                    $fontUnderline = 0;

                    break;
                case \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_DOUBLEACCOUNTING:
                    $dataBlockFont .= pack('C', 0x22);
                    $fontUnderline = 0;

                    break;
                case \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_SINGLE:
                    $dataBlockFont .= pack('C', 0x01);
                    $fontUnderline = 0;

                    break;
                case \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_SINGLEACCOUNTING:
                    $dataBlockFont .= pack('C', 0x21);
                    $fontUnderline = 0;

                    break;
                default:
                    $dataBlockFont .= pack('C', 0x00);
                    $fontUnderline = 1;

                    break;
            }
            // Not used (3)
            $dataBlockFont .= pack('vC', 0x0000, 0x00);
            // Font color index
            $colorIdx = Style\ColorMap::lookup($conditional->getStyle()->getFont()->getColor(), 0x00);

            $dataBlockFont .= pack('V', $colorIdx);
            // Not used (4)
            $dataBlockFont .= pack('V', 0x00000000);
            // Options flags for modified font attributes
            $optionsFlags = 0;
            $optionsFlagsBold = ($conditional->getStyle()->getFont()->getBold() === null ? 1 : 0);
            $optionsFlags |= (1 == $optionsFlagsBold ? 0x00000002 : 0);
            $optionsFlags |= (1 == 1 ? 0x00000008 : 0);
            $optionsFlags |= (1 == 1 ? 0x00000010 : 0);
            $optionsFlags |= (1 == 0 ? 0x00000020 : 0);
            $optionsFlags |= (1 == 1 ? 0x00000080 : 0);
            $dataBlockFont .= pack('V', $optionsFlags);
            // Escapement type
            $dataBlockFont .= pack('V', $fontEscapement);
            // Underline type
            $dataBlockFont .= pack('V', $fontUnderline);
            // Always
            $dataBlockFont .= pack('V', 0x00000000);
            // Always
            $dataBlockFont .= pack('V', 0x00000000);
            // Not used (8)
            $dataBlockFont .= pack('VV', 0x00000000, 0x00000000);
            // Always
            $dataBlockFont .= pack('v', 0x0001);
        }
        if ($bFormatAlign === 1) {
            // Alignment and text break
            $blockAlign = Style\CellAlignment::horizontal($conditional->getStyle()->getAlignment());
            $blockAlign |= Style\CellAlignment::wrap($conditional->getStyle()->getAlignment()) << 3;
            $blockAlign |= Style\CellAlignment::vertical($conditional->getStyle()->getAlignment()) << 4;
            $blockAlign |= 0 << 7;

            // Text rotation angle
            $blockRotation = $conditional->getStyle()->getAlignment()->getTextRotation();

            // Indentation
            $blockIndent = $conditional->getStyle()->getAlignment()->getIndent();
            if ($conditional->getStyle()->getAlignment()->getShrinkToFit() === true) {
                $blockIndent |= 1 << 4;
            } else {
                $blockIndent |= 0 << 4;
            }
            $blockIndent |= 0 << 6;

            // Relative indentation
            $blockIndentRelative = 255;

            $dataBlockAlign = pack('CCvvv', $blockAlign, $blockRotation, $blockIndent, $blockIndentRelative, 0x0000);
        }
        if ($bFormatBorder === 1) {
            $blockLineStyle = Style\CellBorder::style($conditional->getStyle()->getBorders()->getLeft());
            $blockLineStyle |= Style\CellBorder::style($conditional->getStyle()->getBorders()->getRight()) << 4;
            $blockLineStyle |= Style\CellBorder::style($conditional->getStyle()->getBorders()->getTop()) << 8;
            $blockLineStyle |= Style\CellBorder::style($conditional->getStyle()->getBorders()->getBottom()) << 12;

            // TODO writeCFRule() => $blockLineStyle => Index Color for left line
            // TODO writeCFRule() => $blockLineStyle => Index Color for right line
            // TODO writeCFRule() => $blockLineStyle => Top-left to bottom-right on/off
            // TODO writeCFRule() => $blockLineStyle => Bottom-left to top-right on/off
            $blockColor = 0;
            // TODO writeCFRule() => $blockColor => Index Color for top line
            // TODO writeCFRule() => $blockColor => Index Color for bottom line
            // TODO writeCFRule() => $blockColor => Index Color for diagonal line
            $blockColor |= Style\CellBorder::style($conditional->getStyle()->getBorders()->getDiagonal()) << 21;
            $dataBlockBorder = pack('vv', $blockLineStyle, $blockColor);
        }
        if ($bFormatFill === 1) {
            // Fill Pattern Style
            $blockFillPatternStyle = Style\CellFill::style($conditional->getStyle()->getFill());
            // Background Color
            $colorIdxBg = Style\ColorMap::lookup($conditional->getStyle()->getFill()->getStartColor(), 0x41);
            // Foreground Color
            $colorIdxFg = Style\ColorMap::lookup($conditional->getStyle()->getFill()->getEndColor(), 0x40);

            $dataBlockFill = pack('v', $blockFillPatternStyle);
            $dataBlockFill .= pack('v', $colorIdxFg | ($colorIdxBg << 7));
        }

        $data = pack('CCvvVv', $type, $operatorType, $szValue1, $szValue2, $flags, 0x0000);
        if ($bFormatFont === 1) { // Block Formatting : OK
            $data .= $dataBlockFont;
        }
        if ($bFormatAlign === 1) {
            $data .= $dataBlockAlign;
        }
        if ($bFormatBorder === 1) {
            $data .= $dataBlockBorder;
        }
        if ($bFormatFill === 1) { // Block Formatting : OK
            $data .= $dataBlockFill;
        }
        if ($bFormatProt == 1) {
            $data .= $this->getDataBlockProtection($conditional);
        }
        if ($operand1 !== null) {
            $data .= $operand1;
        }
        if ($operand2 !== null) {
            $data .= $operand2;
        }
        $header = pack('vv', $record, strlen($data));
        $this->append($header . $data);
    }

    /**
     * Write CFHeader record.
     */
    private function writeCFHeader(): void
    {
        $record = 0x01B0; // Record identifier
        $length = 0x0016; // Bytes to follow

        $numColumnMin = null;
        $numColumnMax = null;
        $numRowMin = null;
        $numRowMax = null;
        $arrConditional = [];
        foreach ($this->phpSheet->getConditionalStylesCollection() as $cellCoordinate => $conditionalStyles) {
            foreach ($conditionalStyles as $conditional) {
                if (
                    $conditional->getConditionType() == Conditional::CONDITION_EXPRESSION ||
                    $conditional->getConditionType() == Conditional::CONDITION_CELLIS
                ) {
                    if (!in_array($conditional->getHashCode(), $arrConditional)) {
                        $arrConditional[] = $conditional->getHashCode();
                    }
                    // Cells
                    $rangeCoordinates = Coordinate::rangeBoundaries($cellCoordinate);
                    if ($numColumnMin === null || ($numColumnMin > $rangeCoordinates[0][0])) {
                        $numColumnMin = $rangeCoordinates[0][0];
                    }
                    if ($numColumnMax === null || ($numColumnMax < $rangeCoordinates[1][0])) {
                        $numColumnMax = $rangeCoordinates[1][0];
                    }
                    if ($numRowMin === null || ($numRowMin > $rangeCoordinates[0][1])) {
                        $numRowMin = (int) $rangeCoordinates[0][1];
                    }
                    if ($numRowMax === null || ($numRowMax < $rangeCoordinates[1][1])) {
                        $numRowMax = (int) $rangeCoordinates[1][1];
                    }
                }
            }
        }
        $needRedraw = 1;
        $cellRange = pack('vvvv', $numRowMin - 1, $numRowMax - 1, $numColumnMin - 1, $numColumnMax - 1);

        $header = pack('vv', $record, $length);
        $data = pack('vv', count($arrConditional), $needRedraw);
        $data .= $cellRange;
        $data .= pack('v', 0x0001);
        $data .= $cellRange;
        $this->append($header . $data);
    }

    private function getDataBlockProtection(Conditional $conditional): int
    {
        $dataBlockProtection = 0;
        if ($conditional->getStyle()->getProtection()->getLocked() == Protection::PROTECTION_PROTECTED) {
            $dataBlockProtection = 1;
        }
        if ($conditional->getStyle()->getProtection()->getHidden() == Protection::PROTECTION_PROTECTED) {
            $dataBlockProtection = 1 << 1;
        }

        return $dataBlockProtection;
    }
}
PK     «[Ï*a«  «    BIFFwriter.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Writer\Exception as WriterException;

// Original file header of PEAR::Spreadsheet_Excel_Writer_BIFFwriter (used as the base for this class):
// -----------------------------------------------------------------------------------------
// *  Module written/ported by Xavier Noguer <xnoguer@rezebra.com>
// *
// *  The majority of this is _NOT_ my code.  I simply ported it from the
// *  PERL Spreadsheet::WriteExcel module.
// *
// *  The author of the Spreadsheet::WriteExcel module is John McNamara
// *  <jmcnamara@cpan.org>
// *
// *  I _DO_ maintain this code, and John McNamara has nothing to do with the
// *  porting of this code to PHP.  Any questions directly related to this
// *  class library should be directed to me.
// *
// *  License Information:
// *
// *    Spreadsheet_Excel_Writer:  A library for generating Excel Spreadsheets
// *    Copyright (c) 2002-2003 Xavier Noguer xnoguer@rezebra.com
// *
// *    This library is free software; you can redistribute it and/or
// *    modify it under the terms of the GNU Lesser General Public
// *    License as published by the Free Software Foundation; either
// *    version 2.1 of the License, or (at your option) any later version.
// *
// *    This library is distributed in the hope that it will be useful,
// *    but WITHOUT ANY WARRANTY; without even the implied warranty of
// *    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// *    Lesser General Public License for more details.
// *
// *    You should have received a copy of the GNU Lesser General Public
// *    License along with this library; if not, write to the Free Software
// *    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
// */
class BIFFwriter
{
    /**
     * The byte order of this architecture. 0 => little endian, 1 => big endian.
     *
     * @var int
     */
    private static $byteOrder;

    /**
     * The string containing the data of the BIFF stream.
     *
     * @var null|string
     */
    public $_data;

    /**
     * The size of the data in bytes. Should be the same as strlen($this->_data).
     *
     * @var int
     */
    public $_datasize;

    /**
     * The maximum length for a BIFF record (excluding record header and length field). See addContinue().
     *
     * @var int
     *
     * @see addContinue()
     */
    private $limit = 8224;

    /**
     * Constructor.
     */
    public function __construct()
    {
        $this->_data = '';
        $this->_datasize = 0;
    }

    /**
     * Determine the byte order and store it as class data to avoid
     * recalculating it for each call to new().
     *
     * @return int
     */
    public static function getByteOrder()
    {
        if (!isset(self::$byteOrder)) {
            // Check if "pack" gives the required IEEE 64bit float
            $teststr = pack('d', 1.2345);
            $number = pack('C8', 0x8D, 0x97, 0x6E, 0x12, 0x83, 0xC0, 0xF3, 0x3F);
            if ($number == $teststr) {
                $byte_order = 0; // Little Endian
            } elseif ($number == strrev($teststr)) {
                $byte_order = 1; // Big Endian
            } else {
                // Give up. I'll fix this in a later version.
                throw new WriterException('Required floating point format not supported on this platform.');
            }
            self::$byteOrder = $byte_order;
        }

        return self::$byteOrder;
    }

    /**
     * General storage function.
     *
     * @param string $data binary data to append
     */
    protected function append($data): void
    {
        if (strlen($data) - 4 > $this->limit) {
            $data = $this->addContinue($data);
        }
        $this->_data .= $data;
        $this->_datasize += strlen($data);
    }

    /**
     * General storage function like append, but returns string instead of modifying $this->_data.
     *
     * @param string $data binary data to write
     *
     * @return string
     */
    public function writeData($data)
    {
        if (strlen($data) - 4 > $this->limit) {
            $data = $this->addContinue($data);
        }
        $this->_datasize += strlen($data);

        return $data;
    }

    /**
     * Writes Excel BOF record to indicate the beginning of a stream or
     * sub-stream in the BIFF file.
     *
     * @param int $type type of BIFF file to write: 0x0005 Workbook,
     *                       0x0010 Worksheet
     */
    protected function storeBof($type): void
    {
        $record = 0x0809; // Record identifier    (BIFF5-BIFF8)
        $length = 0x0010;

        // by inspection of real files, MS Office Excel 2007 writes the following
        $unknown = pack('VV', 0x000100D1, 0x00000406);

        $build = 0x0DBB; //    Excel 97
        $year = 0x07CC; //    Excel 97

        $version = 0x0600; //    BIFF8

        $header = pack('vv', $record, $length);
        $data = pack('vvvv', $version, $type, $build, $year);
        $this->append($header . $data . $unknown);
    }

    /**
     * Writes Excel EOF record to indicate the end of a BIFF stream.
     */
    protected function storeEof(): void
    {
        $record = 0x000A; // Record identifier
        $length = 0x0000; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $this->append($header);
    }

    /**
     * Writes Excel EOF record to indicate the end of a BIFF stream.
     */
    public function writeEof()
    {
        $record = 0x000A; // Record identifier
        $length = 0x0000; // Number of bytes to follow
        $header = pack('vv', $record, $length);

        return $this->writeData($header);
    }

    /**
     * Excel limits the size of BIFF records. In Excel 5 the limit is 2084 bytes. In
     * Excel 97 the limit is 8228 bytes. Records that are longer than these limits
     * must be split up into CONTINUE blocks.
     *
     * This function takes a long BIFF record and inserts CONTINUE records as
     * necessary.
     *
     * @param string $data The original binary data to be written
     *
     * @return string A very convenient string of continue blocks
     */
    private function addContinue($data)
    {
        $limit = $this->limit;
        $record = 0x003C; // Record identifier

        // The first 2080/8224 bytes remain intact. However, we have to change
        // the length field of the record.
        $tmp = substr($data, 0, 2) . pack('v', $limit) . substr($data, 4, $limit);

        $header = pack('vv', $record, $limit); // Headers for continue records

        // Retrieve chunks of 2080/8224 bytes +4 for the header.
        $data_length = strlen($data);
        for ($i = $limit + 4; $i < ($data_length - $limit); $i += $limit) {
            $tmp .= $header;
            $tmp .= substr($data, $i, $limit);
        }

        // Retrieve the last chunk of data
        $header = pack('vv', $record, strlen($data) - $i);
        $tmp .= $header;
        $tmp .= substr($data, $i);

        return $tmp;
    }
}
PK     «[¢(Ä0  0    Xf.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Style\Alignment;
use PhpOffice\PhpSpreadsheet\Style\Borders;
use PhpOffice\PhpSpreadsheet\Style\Protection;
use PhpOffice\PhpSpreadsheet\Style\Style;
use PhpOffice\PhpSpreadsheet\Writer\Xls\Style\CellAlignment;
use PhpOffice\PhpSpreadsheet\Writer\Xls\Style\CellBorder;
use PhpOffice\PhpSpreadsheet\Writer\Xls\Style\CellFill;

// Original file header of PEAR::Spreadsheet_Excel_Writer_Format (used as the base for this class):
// -----------------------------------------------------------------------------------------
// /*
// *  Module written/ported by Xavier Noguer <xnoguer@rezebra.com>
// *
// *  The majority of this is _NOT_ my code.  I simply ported it from the
// *  PERL Spreadsheet::WriteExcel module.
// *
// *  The author of the Spreadsheet::WriteExcel module is John McNamara
// *  <jmcnamara@cpan.org>
// *
// *  I _DO_ maintain this code, and John McNamara has nothing to do with the
// *  porting of this code to PHP.  Any questions directly related to this
// *  class library should be directed to me.
// *
// *  License Information:
// *
// *    Spreadsheet_Excel_Writer:  A library for generating Excel Spreadsheets
// *    Copyright (c) 2002-2003 Xavier Noguer xnoguer@rezebra.com
// *
// *    This library is free software; you can redistribute it and/or
// *    modify it under the terms of the GNU Lesser General Public
// *    License as published by the Free Software Foundation; either
// *    version 2.1 of the License, or (at your option) any later version.
// *
// *    This library is distributed in the hope that it will be useful,
// *    but WITHOUT ANY WARRANTY; without even the implied warranty of
// *    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// *    Lesser General Public License for more details.
// *
// *    You should have received a copy of the GNU Lesser General Public
// *    License along with this library; if not, write to the Free Software
// *    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
// */
class Xf
{
    /**
     * Style XF or a cell XF ?
     *
     * @var bool
     */
    private $isStyleXf;

    /**
     * Index to the FONT record. Index 4 does not exist.
     *
     * @var int
     */
    private $fontIndex;

    /**
     * An index (2 bytes) to a FORMAT record (number format).
     *
     * @var int
     */
    private $numberFormatIndex;

    /**
     * 1 bit, apparently not used.
     *
     * @var int
     */
    private $textJustLast;

    /**
     * The cell's foreground color.
     *
     * @var int
     */
    private $foregroundColor;

    /**
     * The cell's background color.
     *
     * @var int
     */
    private $backgroundColor;

    /**
     * Color of the bottom border of the cell.
     *
     * @var int
     */
    private $bottomBorderColor;

    /**
     * Color of the top border of the cell.
     *
     * @var int
     */
    private $topBorderColor;

    /**
     * Color of the left border of the cell.
     *
     * @var int
     */
    private $leftBorderColor;

    /**
     * Color of the right border of the cell.
     *
     * @var int
     */
    private $rightBorderColor;

    /**
     * @var int
     */
    private $diag;

    /**
     * @var int
     */
    private $diagColor;

    /**
     * @var Style
     */
    private $style;

    /**
     * Constructor.
     *
     * @param Style $style The XF format
     */
    public function __construct(Style $style)
    {
        $this->isStyleXf = false;
        $this->fontIndex = 0;

        $this->numberFormatIndex = 0;

        $this->textJustLast = 0;

        $this->foregroundColor = 0x40;
        $this->backgroundColor = 0x41;

        $this->diag = 0;

        $this->bottomBorderColor = 0x40;
        $this->topBorderColor = 0x40;
        $this->leftBorderColor = 0x40;
        $this->rightBorderColor = 0x40;
        $this->diagColor = 0x40;
        $this->style = $style;
    }

    /**
     * Generate an Excel BIFF XF record (style or cell).
     *
     * @return string The XF record
     */
    public function writeXf()
    {
        // Set the type of the XF record and some of the attributes.
        if ($this->isStyleXf) {
            $style = 0xFFF5;
        } else {
            $style = self::mapLocked($this->style->getProtection()->getLocked());
            $style |= self::mapHidden($this->style->getProtection()->getHidden()) << 1;
        }

        // Flags to indicate if attributes have been set.
        $atr_num = ($this->numberFormatIndex != 0) ? 1 : 0;
        $atr_fnt = ($this->fontIndex != 0) ? 1 : 0;
        $atr_alc = ((int) $this->style->getAlignment()->getWrapText()) ? 1 : 0;
        $atr_bdr = (CellBorder::style($this->style->getBorders()->getBottom()) ||
            CellBorder::style($this->style->getBorders()->getTop()) ||
            CellBorder::style($this->style->getBorders()->getLeft()) ||
            CellBorder::style($this->style->getBorders()->getRight())) ? 1 : 0;
        $atr_pat = ($this->foregroundColor != 0x40) ? 1 : 0;
        $atr_pat = ($this->backgroundColor != 0x41) ? 1 : $atr_pat;
        $atr_pat = CellFill::style($this->style->getFill()) ? 1 : $atr_pat;
        $atr_prot = self::mapLocked($this->style->getProtection()->getLocked())
            | self::mapHidden($this->style->getProtection()->getHidden());

        // Zero the default border colour if the border has not been set.
        if (CellBorder::style($this->style->getBorders()->getBottom()) == 0) {
            $this->bottomBorderColor = 0;
        }
        if (CellBorder::style($this->style->getBorders()->getTop()) == 0) {
            $this->topBorderColor = 0;
        }
        if (CellBorder::style($this->style->getBorders()->getRight()) == 0) {
            $this->rightBorderColor = 0;
        }
        if (CellBorder::style($this->style->getBorders()->getLeft()) == 0) {
            $this->leftBorderColor = 0;
        }
        if (CellBorder::style($this->style->getBorders()->getDiagonal()) == 0) {
            $this->diagColor = 0;
        }

        $record = 0x00E0; // Record identifier
        $length = 0x0014; // Number of bytes to follow

        $ifnt = $this->fontIndex; // Index to FONT record
        $ifmt = $this->numberFormatIndex; // Index to FORMAT record

        // Alignment
        $align = CellAlignment::horizontal($this->style->getAlignment());
        $align |= CellAlignment::wrap($this->style->getAlignment()) << 3;
        $align |= CellAlignment::vertical($this->style->getAlignment()) << 4;
        $align |= $this->textJustLast << 7;

        $used_attrib = $atr_num << 2;
        $used_attrib |= $atr_fnt << 3;
        $used_attrib |= $atr_alc << 4;
        $used_attrib |= $atr_bdr << 5;
        $used_attrib |= $atr_pat << 6;
        $used_attrib |= $atr_prot << 7;

        $icv = $this->foregroundColor; // fg and bg pattern colors
        $icv |= $this->backgroundColor << 7;

        $border1 = CellBorder::style($this->style->getBorders()->getLeft()); // Border line style and color
        $border1 |= CellBorder::style($this->style->getBorders()->getRight()) << 4;
        $border1 |= CellBorder::style($this->style->getBorders()->getTop()) << 8;
        $border1 |= CellBorder::style($this->style->getBorders()->getBottom()) << 12;
        $border1 |= $this->leftBorderColor << 16;
        $border1 |= $this->rightBorderColor << 23;

        $diagonalDirection = $this->style->getBorders()->getDiagonalDirection();
        $diag_tl_to_rb = $diagonalDirection == Borders::DIAGONAL_BOTH
            || $diagonalDirection == Borders::DIAGONAL_DOWN;
        $diag_tr_to_lb = $diagonalDirection == Borders::DIAGONAL_BOTH
            || $diagonalDirection == Borders::DIAGONAL_UP;
        $border1 |= $diag_tl_to_rb << 30;
        $border1 |= $diag_tr_to_lb << 31;

        $border2 = $this->topBorderColor; // Border color
        $border2 |= $this->bottomBorderColor << 7;
        $border2 |= $this->diagColor << 14;
        $border2 |= CellBorder::style($this->style->getBorders()->getDiagonal()) << 21;
        $border2 |= CellFill::style($this->style->getFill()) << 26;

        $header = pack('vv', $record, $length);

        //BIFF8 options: identation, shrinkToFit and  text direction
        $biff8_options = $this->style->getAlignment()->getIndent();
        $biff8_options |= (int) $this->style->getAlignment()->getShrinkToFit() << 4;

        $data = pack('vvvC', $ifnt, $ifmt, $style, $align);
        $data .= pack('CCC', self::mapTextRotation($this->style->getAlignment()->getTextRotation()), $biff8_options, $used_attrib);
        $data .= pack('VVv', $border1, $border2, $icv);

        return $header . $data;
    }

    /**
     * Is this a style XF ?
     *
     * @param bool $value
     */
    public function setIsStyleXf($value): void
    {
        $this->isStyleXf = $value;
    }

    /**
     * Sets the cell's bottom border color.
     *
     * @param int $colorIndex Color index
     */
    public function setBottomColor($colorIndex): void
    {
        $this->bottomBorderColor = $colorIndex;
    }

    /**
     * Sets the cell's top border color.
     *
     * @param int $colorIndex Color index
     */
    public function setTopColor($colorIndex): void
    {
        $this->topBorderColor = $colorIndex;
    }

    /**
     * Sets the cell's left border color.
     *
     * @param int $colorIndex Color index
     */
    public function setLeftColor($colorIndex): void
    {
        $this->leftBorderColor = $colorIndex;
    }

    /**
     * Sets the cell's right border color.
     *
     * @param int $colorIndex Color index
     */
    public function setRightColor($colorIndex): void
    {
        $this->rightBorderColor = $colorIndex;
    }

    /**
     * Sets the cell's diagonal border color.
     *
     * @param int $colorIndex Color index
     */
    public function setDiagColor($colorIndex): void
    {
        $this->diagColor = $colorIndex;
    }

    /**
     * Sets the cell's foreground color.
     *
     * @param int $colorIndex Color index
     */
    public function setFgColor($colorIndex): void
    {
        $this->foregroundColor = $colorIndex;
    }

    /**
     * Sets the cell's background color.
     *
     * @param int $colorIndex Color index
     */
    public function setBgColor($colorIndex): void
    {
        $this->backgroundColor = $colorIndex;
    }

    /**
     * Sets the index to the number format record
     * It can be date, time, currency, etc...
     *
     * @param int $numberFormatIndex Index to format record
     */
    public function setNumberFormatIndex($numberFormatIndex): void
    {
        $this->numberFormatIndex = $numberFormatIndex;
    }

    /**
     * Set the font index.
     *
     * @param int $value Font index, note that value 4 does not exist
     */
    public function setFontIndex($value): void
    {
        $this->fontIndex = $value;
    }

    /**
     * Map to BIFF8 codes for text rotation angle.
     *
     * @param int $textRotation
     *
     * @return int
     */
    private static function mapTextRotation($textRotation)
    {
        if ($textRotation >= 0) {
            return $textRotation;
        }
        if ($textRotation == Alignment::TEXTROTATION_STACK_PHPSPREADSHEET) {
            return Alignment::TEXTROTATION_STACK_EXCEL;
        }

        return 90 - $textRotation;
    }

    private const LOCK_ARRAY = [
        Protection::PROTECTION_INHERIT => 1,
        Protection::PROTECTION_PROTECTED => 1,
        Protection::PROTECTION_UNPROTECTED => 0,
    ];

    /**
     * Map locked values.
     *
     * @param string $locked
     *
     * @return int
     */
    private static function mapLocked($locked)
    {
        return array_key_exists($locked, self::LOCK_ARRAY) ? self::LOCK_ARRAY[$locked] : 1;
    }

    private const HIDDEN_ARRAY = [
        Protection::PROTECTION_INHERIT => 0,
        Protection::PROTECTION_PROTECTED => 1,
        Protection::PROTECTION_UNPROTECTED => 0,
    ];

    /**
     * Map hidden.
     *
     * @param string $hidden
     *
     * @return int
     */
    private static function mapHidden($hidden)
    {
        return array_key_exists($hidden, self::HIDDEN_ARRAY) ? self::HIDDEN_ARRAY[$hidden] : 0;
    }
}
PK     «[ÜÂúò¡  ò¡    Workbook.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Style;

// Original file header of PEAR::Spreadsheet_Excel_Writer_Workbook (used as the base for this class):
// -----------------------------------------------------------------------------------------
// /*
// *  Module written/ported by Xavier Noguer <xnoguer@rezebra.com>
// *
// *  The majority of this is _NOT_ my code.  I simply ported it from the
// *  PERL Spreadsheet::WriteExcel module.
// *
// *  The author of the Spreadsheet::WriteExcel module is John McNamara
// *  <jmcnamara@cpan.org>
// *
// *  I _DO_ maintain this code, and John McNamara has nothing to do with the
// *  porting of this code to PHP.  Any questions directly related to this
// *  class library should be directed to me.
// *
// *  License Information:
// *
// *    Spreadsheet_Excel_Writer:  A library for generating Excel Spreadsheets
// *    Copyright (c) 2002-2003 Xavier Noguer xnoguer@rezebra.com
// *
// *    This library is free software; you can redistribute it and/or
// *    modify it under the terms of the GNU Lesser General Public
// *    License as published by the Free Software Foundation; either
// *    version 2.1 of the License, or (at your option) any later version.
// *
// *    This library is distributed in the hope that it will be useful,
// *    but WITHOUT ANY WARRANTY; without even the implied warranty of
// *    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// *    Lesser General Public License for more details.
// *
// *    You should have received a copy of the GNU Lesser General Public
// *    License along with this library; if not, write to the Free Software
// *    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
// */
class Workbook extends BIFFwriter
{
    /**
     * Formula parser.
     *
     * @var \PhpOffice\PhpSpreadsheet\Writer\Xls\Parser
     */
    private $parser;

    /**
     * The BIFF file size for the workbook.
     *
     * @var int
     *
     * @see calcSheetOffsets()
     */
    private $biffSize;

    /**
     * XF Writers.
     *
     * @var \PhpOffice\PhpSpreadsheet\Writer\Xls\Xf[]
     */
    private $xfWriters = [];

    /**
     * Array containing the colour palette.
     *
     * @var array
     */
    private $palette;

    /**
     * The codepage indicates the text encoding used for strings.
     *
     * @var int
     */
    private $codepage;

    /**
     * The country code used for localization.
     *
     * @var int
     */
    private $countryCode;

    /**
     * Workbook.
     *
     * @var Spreadsheet
     */
    private $spreadsheet;

    /**
     * Fonts writers.
     *
     * @var Font[]
     */
    private $fontWriters = [];

    /**
     * Added fonts. Maps from font's hash => index in workbook.
     *
     * @var array
     */
    private $addedFonts = [];

    /**
     * Shared number formats.
     *
     * @var array
     */
    private $numberFormats = [];

    /**
     * Added number formats. Maps from numberFormat's hash => index in workbook.
     *
     * @var array
     */
    private $addedNumberFormats = [];

    /**
     * Sizes of the binary worksheet streams.
     *
     * @var array
     */
    private $worksheetSizes = [];

    /**
     * Offsets of the binary worksheet streams relative to the start of the global workbook stream.
     *
     * @var array
     */
    private $worksheetOffsets = [];

    /**
     * Total number of shared strings in workbook.
     *
     * @var int
     */
    private $stringTotal;

    /**
     * Number of unique shared strings in workbook.
     *
     * @var int
     */
    private $stringUnique;

    /**
     * Array of unique shared strings in workbook.
     *
     * @var array
     */
    private $stringTable;

    /**
     * Color cache.
     */
    private $colors;

    /**
     * Escher object corresponding to MSODRAWINGGROUP.
     *
     * @var null|\PhpOffice\PhpSpreadsheet\Shared\Escher
     */
    private $escher;

    /**
     * Class constructor.
     *
     * @param Spreadsheet $spreadsheet The Workbook
     * @param int $str_total Total number of strings
     * @param int $str_unique Total number of unique strings
     * @param array $str_table String Table
     * @param array $colors Colour Table
     * @param Parser $parser The formula parser created for the Workbook
     */
    public function __construct(Spreadsheet $spreadsheet, &$str_total, &$str_unique, &$str_table, &$colors, Parser $parser)
    {
        // It needs to call its parent's constructor explicitly
        parent::__construct();

        $this->parser = $parser;
        $this->biffSize = 0;
        $this->palette = [];
        $this->countryCode = -1;

        $this->stringTotal = &$str_total;
        $this->stringUnique = &$str_unique;
        $this->stringTable = &$str_table;
        $this->colors = &$colors;
        $this->setPaletteXl97();

        $this->spreadsheet = $spreadsheet;

        $this->codepage = 0x04B0;

        // Add empty sheets and Build color cache
        $countSheets = $spreadsheet->getSheetCount();
        for ($i = 0; $i < $countSheets; ++$i) {
            $phpSheet = $spreadsheet->getSheet($i);

            $this->parser->setExtSheet($phpSheet->getTitle(), $i); // Register worksheet name with parser

            $supbook_index = 0x00;
            $ref = pack('vvv', $supbook_index, $i, $i);
            $this->parser->references[] = $ref; // Register reference with parser

            // Sheet tab colors?
            if ($phpSheet->isTabColorSet()) {
                $this->addColor($phpSheet->getTabColor()->getRGB());
            }
        }
    }

    /**
     * Add a new XF writer.
     *
     * @param bool $isStyleXf Is it a style XF?
     *
     * @return int Index to XF record
     */
    public function addXfWriter(Style $style, $isStyleXf = false)
    {
        $xfWriter = new Xf($style);
        $xfWriter->setIsStyleXf($isStyleXf);

        // Add the font if not already added
        $fontIndex = $this->addFont($style->getFont());

        // Assign the font index to the xf record
        $xfWriter->setFontIndex($fontIndex);

        // Background colors, best to treat these after the font so black will come after white in custom palette
        $xfWriter->setFgColor($this->addColor($style->getFill()->getStartColor()->getRGB()));
        $xfWriter->setBgColor($this->addColor($style->getFill()->getEndColor()->getRGB()));
        $xfWriter->setBottomColor($this->addColor($style->getBorders()->getBottom()->getColor()->getRGB()));
        $xfWriter->setTopColor($this->addColor($style->getBorders()->getTop()->getColor()->getRGB()));
        $xfWriter->setRightColor($this->addColor($style->getBorders()->getRight()->getColor()->getRGB()));
        $xfWriter->setLeftColor($this->addColor($style->getBorders()->getLeft()->getColor()->getRGB()));
        $xfWriter->setDiagColor($this->addColor($style->getBorders()->getDiagonal()->getColor()->getRGB()));

        // Add the number format if it is not a built-in one and not already added
        if ($style->getNumberFormat()->getBuiltInFormatCode() === false) {
            $numberFormatHashCode = $style->getNumberFormat()->getHashCode();

            if (isset($this->addedNumberFormats[$numberFormatHashCode])) {
                $numberFormatIndex = $this->addedNumberFormats[$numberFormatHashCode];
            } else {
                $numberFormatIndex = 164 + count($this->numberFormats);
                $this->numberFormats[$numberFormatIndex] = $style->getNumberFormat();
                $this->addedNumberFormats[$numberFormatHashCode] = $numberFormatIndex;
            }
        } else {
            $numberFormatIndex = (int) $style->getNumberFormat()->getBuiltInFormatCode();
        }

        // Assign the number format index to xf record
        $xfWriter->setNumberFormatIndex($numberFormatIndex);

        $this->xfWriters[] = $xfWriter;

        return count($this->xfWriters) - 1;
    }

    /**
     * Add a font to added fonts.
     *
     * @return int Index to FONT record
     */
    public function addFont(\PhpOffice\PhpSpreadsheet\Style\Font $font)
    {
        $fontHashCode = $font->getHashCode();
        if (isset($this->addedFonts[$fontHashCode])) {
            $fontIndex = $this->addedFonts[$fontHashCode];
        } else {
            $countFonts = count($this->fontWriters);
            $fontIndex = ($countFonts < 4) ? $countFonts : $countFonts + 1;

            $fontWriter = new Font($font);
            $fontWriter->setColorIndex($this->addColor($font->getColor()->getRGB()));
            $this->fontWriters[] = $fontWriter;

            $this->addedFonts[$fontHashCode] = $fontIndex;
        }

        return $fontIndex;
    }

    /**
     * Alter color palette adding a custom color.
     *
     * @param string $rgb E.g. 'FF00AA'
     *
     * @return int Color index
     */
    private function addColor($rgb)
    {
        if (!isset($this->colors[$rgb])) {
            $color =
                [
                    hexdec(substr($rgb, 0, 2)),
                    hexdec(substr($rgb, 2, 2)),
                    hexdec(substr($rgb, 4)),
                    0,
                ];
            $colorIndex = array_search($color, $this->palette);
            if ($colorIndex) {
                $this->colors[$rgb] = $colorIndex;
            } else {
                if (count($this->colors) === 0) {
                    $lastColor = 7;
                } else {
                    $lastColor = end($this->colors);
                }
                if ($lastColor < 57) {
                    // then we add a custom color altering the palette
                    $colorIndex = $lastColor + 1;
                    $this->palette[$colorIndex] = $color;
                    $this->colors[$rgb] = $colorIndex;
                } else {
                    // no room for more custom colors, just map to black
                    $colorIndex = 0;
                }
            }
        } else {
            // fetch already added custom color
            $colorIndex = $this->colors[$rgb];
        }

        return $colorIndex;
    }

    /**
     * Sets the colour palette to the Excel 97+ default.
     */
    private function setPaletteXl97(): void
    {
        $this->palette = [
            0x08 => [0x00, 0x00, 0x00, 0x00],
            0x09 => [0xff, 0xff, 0xff, 0x00],
            0x0A => [0xff, 0x00, 0x00, 0x00],
            0x0B => [0x00, 0xff, 0x00, 0x00],
            0x0C => [0x00, 0x00, 0xff, 0x00],
            0x0D => [0xff, 0xff, 0x00, 0x00],
            0x0E => [0xff, 0x00, 0xff, 0x00],
            0x0F => [0x00, 0xff, 0xff, 0x00],
            0x10 => [0x80, 0x00, 0x00, 0x00],
            0x11 => [0x00, 0x80, 0x00, 0x00],
            0x12 => [0x00, 0x00, 0x80, 0x00],
            0x13 => [0x80, 0x80, 0x00, 0x00],
            0x14 => [0x80, 0x00, 0x80, 0x00],
            0x15 => [0x00, 0x80, 0x80, 0x00],
            0x16 => [0xc0, 0xc0, 0xc0, 0x00],
            0x17 => [0x80, 0x80, 0x80, 0x00],
            0x18 => [0x99, 0x99, 0xff, 0x00],
            0x19 => [0x99, 0x33, 0x66, 0x00],
            0x1A => [0xff, 0xff, 0xcc, 0x00],
            0x1B => [0xcc, 0xff, 0xff, 0x00],
            0x1C => [0x66, 0x00, 0x66, 0x00],
            0x1D => [0xff, 0x80, 0x80, 0x00],
            0x1E => [0x00, 0x66, 0xcc, 0x00],
            0x1F => [0xcc, 0xcc, 0xff, 0x00],
            0x20 => [0x00, 0x00, 0x80, 0x00],
            0x21 => [0xff, 0x00, 0xff, 0x00],
            0x22 => [0xff, 0xff, 0x00, 0x00],
            0x23 => [0x00, 0xff, 0xff, 0x00],
            0x24 => [0x80, 0x00, 0x80, 0x00],
            0x25 => [0x80, 0x00, 0x00, 0x00],
            0x26 => [0x00, 0x80, 0x80, 0x00],
            0x27 => [0x00, 0x00, 0xff, 0x00],
            0x28 => [0x00, 0xcc, 0xff, 0x00],
            0x29 => [0xcc, 0xff, 0xff, 0x00],
            0x2A => [0xcc, 0xff, 0xcc, 0x00],
            0x2B => [0xff, 0xff, 0x99, 0x00],
            0x2C => [0x99, 0xcc, 0xff, 0x00],
            0x2D => [0xff, 0x99, 0xcc, 0x00],
            0x2E => [0xcc, 0x99, 0xff, 0x00],
            0x2F => [0xff, 0xcc, 0x99, 0x00],
            0x30 => [0x33, 0x66, 0xff, 0x00],
            0x31 => [0x33, 0xcc, 0xcc, 0x00],
            0x32 => [0x99, 0xcc, 0x00, 0x00],
            0x33 => [0xff, 0xcc, 0x00, 0x00],
            0x34 => [0xff, 0x99, 0x00, 0x00],
            0x35 => [0xff, 0x66, 0x00, 0x00],
            0x36 => [0x66, 0x66, 0x99, 0x00],
            0x37 => [0x96, 0x96, 0x96, 0x00],
            0x38 => [0x00, 0x33, 0x66, 0x00],
            0x39 => [0x33, 0x99, 0x66, 0x00],
            0x3A => [0x00, 0x33, 0x00, 0x00],
            0x3B => [0x33, 0x33, 0x00, 0x00],
            0x3C => [0x99, 0x33, 0x00, 0x00],
            0x3D => [0x99, 0x33, 0x66, 0x00],
            0x3E => [0x33, 0x33, 0x99, 0x00],
            0x3F => [0x33, 0x33, 0x33, 0x00],
        ];
    }

    /**
     * Assemble worksheets into a workbook and send the BIFF data to an OLE
     * storage.
     *
     * @param array $worksheetSizes The sizes in bytes of the binary worksheet streams
     *
     * @return string Binary data for workbook stream
     */
    public function writeWorkbook(array $worksheetSizes)
    {
        $this->worksheetSizes = $worksheetSizes;

        // Calculate the number of selected worksheet tabs and call the finalization
        // methods for each worksheet
        $total_worksheets = $this->spreadsheet->getSheetCount();

        // Add part 1 of the Workbook globals, what goes before the SHEET records
        $this->storeBof(0x0005);
        $this->writeCodepage();
        $this->writeWindow1();

        $this->writeDateMode();
        $this->writeAllFonts();
        $this->writeAllNumberFormats();
        $this->writeAllXfs();
        $this->writeAllStyles();
        $this->writePalette();

        // Prepare part 3 of the workbook global stream, what goes after the SHEET records
        $part3 = '';
        if ($this->countryCode !== -1) {
            $part3 .= $this->writeCountry();
        }
        $part3 .= $this->writeRecalcId();

        $part3 .= $this->writeSupbookInternal();
        /* TODO: store external SUPBOOK records and XCT and CRN records
        in case of external references for BIFF8 */
        $part3 .= $this->writeExternalsheetBiff8();
        $part3 .= $this->writeAllDefinedNamesBiff8();
        $part3 .= $this->writeMsoDrawingGroup();
        $part3 .= $this->writeSharedStringsTable();

        $part3 .= $this->writeEof();

        // Add part 2 of the Workbook globals, the SHEET records
        $this->calcSheetOffsets();
        for ($i = 0; $i < $total_worksheets; ++$i) {
            $this->writeBoundSheet($this->spreadsheet->getSheet($i), $this->worksheetOffsets[$i]);
        }

        // Add part 3 of the Workbook globals
        $this->_data .= $part3;

        return $this->_data;
    }

    /**
     * Calculate offsets for Worksheet BOF records.
     */
    private function calcSheetOffsets(): void
    {
        $boundsheet_length = 10; // fixed length for a BOUNDSHEET record

        // size of Workbook globals part 1 + 3
        $offset = $this->_datasize;

        // add size of Workbook globals part 2, the length of the SHEET records
        $total_worksheets = count($this->spreadsheet->getAllSheets());
        foreach ($this->spreadsheet->getWorksheetIterator() as $sheet) {
            $offset += $boundsheet_length + strlen(StringHelper::UTF8toBIFF8UnicodeShort($sheet->getTitle()));
        }

        // add the sizes of each of the Sheet substreams, respectively
        for ($i = 0; $i < $total_worksheets; ++$i) {
            $this->worksheetOffsets[$i] = $offset;
            $offset += $this->worksheetSizes[$i];
        }
        $this->biffSize = $offset;
    }

    /**
     * Store the Excel FONT records.
     */
    private function writeAllFonts(): void
    {
        foreach ($this->fontWriters as $fontWriter) {
            $this->append($fontWriter->writeFont());
        }
    }

    /**
     * Store user defined numerical formats i.e. FORMAT records.
     */
    private function writeAllNumberFormats(): void
    {
        foreach ($this->numberFormats as $numberFormatIndex => $numberFormat) {
            $this->writeNumberFormat($numberFormat->getFormatCode(), $numberFormatIndex);
        }
    }

    /**
     * Write all XF records.
     */
    private function writeAllXfs(): void
    {
        foreach ($this->xfWriters as $xfWriter) {
            $this->append($xfWriter->writeXf());
        }
    }

    /**
     * Write all STYLE records.
     */
    private function writeAllStyles(): void
    {
        $this->writeStyle();
    }

    private function parseDefinedNameValue(DefinedName $definedName): string
    {
        $definedRange = $definedName->getValue();
        $splitCount = preg_match_all(
            '/' . Calculation::CALCULATION_REGEXP_CELLREF . '/mui',
            $definedRange,
            $splitRanges,
            PREG_OFFSET_CAPTURE
        );

        $lengths = array_map('strlen', array_column($splitRanges[0], 0));
        $offsets = array_column($splitRanges[0], 1);

        $worksheets = $splitRanges[2];
        $columns = $splitRanges[6];
        $rows = $splitRanges[7];

        while ($splitCount > 0) {
            --$splitCount;
            $length = $lengths[$splitCount];
            $offset = $offsets[$splitCount];
            $worksheet = $worksheets[$splitCount][0];
            $column = $columns[$splitCount][0];
            $row = $rows[$splitCount][0];

            $newRange = '';
            if (empty($worksheet)) {
                if (($offset === 0) || ($definedRange[$offset - 1] !== ':')) {
                    // We should have a worksheet
                    $worksheet = $definedName->getWorksheet() ? $definedName->getWorksheet()->getTitle() : null;
                }
            } else {
                $worksheet = str_replace("''", "'", trim($worksheet, "'"));
            }
            if (!empty($worksheet)) {
                $newRange = "'" . str_replace("'", "''", $worksheet) . "'!";
            }

            if (!empty($column)) {
                $newRange .= "\${$column}";
            }
            if (!empty($row)) {
                $newRange .= "\${$row}";
            }

            $definedRange = substr($definedRange, 0, $offset) . $newRange . substr($definedRange, $offset + $length);
        }

        return $definedRange;
    }

    /**
     * Writes all the DEFINEDNAME records (BIFF8).
     * So far this is only used for repeating rows/columns (print titles) and print areas.
     */
    private function writeAllDefinedNamesBiff8()
    {
        $chunk = '';

        // Named ranges
        $definedNames = $this->spreadsheet->getDefinedNames();
        if (count($definedNames) > 0) {
            // Loop named ranges
            foreach ($definedNames as $definedName) {
                $range = $this->parseDefinedNameValue($definedName);

                // parse formula
                try {
                    $error = $this->parser->parse($range);
                    $formulaData = $this->parser->toReversePolish();

                    // make sure tRef3d is of type tRef3dR (0x3A)
                    if (isset($formulaData[0]) && ($formulaData[0] == "\x7A" || $formulaData[0] == "\x5A")) {
                        $formulaData = "\x3A" . substr($formulaData, 1);
                    }

                    if ($definedName->getLocalOnly()) {
                        /**
                         * local scope.
                         *
                         * @phpstan-ignore-next-line
                         */
                        $scope = $this->spreadsheet->getIndex($definedName->getScope()) + 1;
                    } else {
                        // global scope
                        $scope = 0;
                    }
                    $chunk .= $this->writeData($this->writeDefinedNameBiff8($definedName->getName(), $formulaData, $scope, false));
                } catch (PhpSpreadsheetException $e) {
                    // do nothing
                }
            }
        }

        // total number of sheets
        $total_worksheets = $this->spreadsheet->getSheetCount();

        // write the print titles (repeating rows, columns), if any
        for ($i = 0; $i < $total_worksheets; ++$i) {
            $sheetSetup = $this->spreadsheet->getSheet($i)->getPageSetup();
            // simultaneous repeatColumns repeatRows
            if ($sheetSetup->isColumnsToRepeatAtLeftSet() && $sheetSetup->isRowsToRepeatAtTopSet()) {
                $repeat = $sheetSetup->getColumnsToRepeatAtLeft();
                $colmin = Coordinate::columnIndexFromString($repeat[0]) - 1;
                $colmax = Coordinate::columnIndexFromString($repeat[1]) - 1;

                $repeat = $sheetSetup->getRowsToRepeatAtTop();
                $rowmin = $repeat[0] - 1;
                $rowmax = $repeat[1] - 1;

                // construct formula data manually
                $formulaData = pack('Cv', 0x29, 0x17); // tMemFunc
                $formulaData .= pack('Cvvvvv', 0x3B, $i, 0, 65535, $colmin, $colmax); // tArea3d
                $formulaData .= pack('Cvvvvv', 0x3B, $i, $rowmin, $rowmax, 0, 255); // tArea3d
                $formulaData .= pack('C', 0x10); // tList

                // store the DEFINEDNAME record
                $chunk .= $this->writeData($this->writeDefinedNameBiff8(pack('C', 0x07), $formulaData, $i + 1, true));

            // (exclusive) either repeatColumns or repeatRows
            } elseif ($sheetSetup->isColumnsToRepeatAtLeftSet() || $sheetSetup->isRowsToRepeatAtTopSet()) {
                // Columns to repeat
                if ($sheetSetup->isColumnsToRepeatAtLeftSet()) {
                    $repeat = $sheetSetup->getColumnsToRepeatAtLeft();
                    $colmin = Coordinate::columnIndexFromString($repeat[0]) - 1;
                    $colmax = Coordinate::columnIndexFromString($repeat[1]) - 1;
                } else {
                    $colmin = 0;
                    $colmax = 255;
                }
                // Rows to repeat
                if ($sheetSetup->isRowsToRepeatAtTopSet()) {
                    $repeat = $sheetSetup->getRowsToRepeatAtTop();
                    $rowmin = $repeat[0] - 1;
                    $rowmax = $repeat[1] - 1;
                } else {
                    $rowmin = 0;
                    $rowmax = 65535;
                }

                // construct formula data manually because parser does not recognize absolute 3d cell references
                $formulaData = pack('Cvvvvv', 0x3B, $i, $rowmin, $rowmax, $colmin, $colmax);

                // store the DEFINEDNAME record
                $chunk .= $this->writeData($this->writeDefinedNameBiff8(pack('C', 0x07), $formulaData, $i + 1, true));
            }
        }

        // write the print areas, if any
        for ($i = 0; $i < $total_worksheets; ++$i) {
            $sheetSetup = $this->spreadsheet->getSheet($i)->getPageSetup();
            if ($sheetSetup->isPrintAreaSet()) {
                // Print area, e.g. A3:J6,H1:X20
                $printArea = Coordinate::splitRange($sheetSetup->getPrintArea());
                $countPrintArea = count($printArea);

                $formulaData = '';
                for ($j = 0; $j < $countPrintArea; ++$j) {
                    $printAreaRect = $printArea[$j]; // e.g. A3:J6
                    $printAreaRect[0] = Coordinate::indexesFromString($printAreaRect[0]);
                    $printAreaRect[1] = Coordinate::indexesFromString($printAreaRect[1]);

                    $print_rowmin = $printAreaRect[0][1] - 1;
                    $print_rowmax = $printAreaRect[1][1] - 1;
                    $print_colmin = $printAreaRect[0][0] - 1;
                    $print_colmax = $printAreaRect[1][0] - 1;

                    // construct formula data manually because parser does not recognize absolute 3d cell references
                    $formulaData .= pack('Cvvvvv', 0x3B, $i, $print_rowmin, $print_rowmax, $print_colmin, $print_colmax);

                    if ($j > 0) {
                        $formulaData .= pack('C', 0x10); // list operator token ','
                    }
                }

                // store the DEFINEDNAME record
                $chunk .= $this->writeData($this->writeDefinedNameBiff8(pack('C', 0x06), $formulaData, $i + 1, true));
            }
        }

        // write autofilters, if any
        for ($i = 0; $i < $total_worksheets; ++$i) {
            $sheetAutoFilter = $this->spreadsheet->getSheet($i)->getAutoFilter();
            $autoFilterRange = $sheetAutoFilter->getRange();
            if (!empty($autoFilterRange)) {
                $rangeBounds = Coordinate::rangeBoundaries($autoFilterRange);

                //Autofilter built in name
                $name = pack('C', 0x0D);

                $chunk .= $this->writeData($this->writeShortNameBiff8($name, $i + 1, $rangeBounds, true));
            }
        }

        return $chunk;
    }

    /**
     * Write a DEFINEDNAME record for BIFF8 using explicit binary formula data.
     *
     * @param string $name The name in UTF-8
     * @param string $formulaData The binary formula data
     * @param int $sheetIndex 1-based sheet index the defined name applies to. 0 = global
     * @param bool $isBuiltIn Built-in name?
     *
     * @return string Complete binary record data
     */
    private function writeDefinedNameBiff8($name, $formulaData, $sheetIndex = 0, $isBuiltIn = false)
    {
        $record = 0x0018;

        // option flags
        $options = $isBuiltIn ? 0x20 : 0x00;

        // length of the name, character count
        $nlen = StringHelper::countCharacters($name);

        // name with stripped length field
        $name = substr(StringHelper::UTF8toBIFF8UnicodeLong($name), 2);

        // size of the formula (in bytes)
        $sz = strlen($formulaData);

        // combine the parts
        $data = pack('vCCvvvCCCC', $options, 0, $nlen, $sz, 0, $sheetIndex, 0, 0, 0, 0)
            . $name . $formulaData;
        $length = strlen($data);

        $header = pack('vv', $record, $length);

        return $header . $data;
    }

    /**
     * Write a short NAME record.
     *
     * @param string $name
     * @param int $sheetIndex 1-based sheet index the defined name applies to. 0 = global
     * @param int[][] $rangeBounds range boundaries
     * @param bool $isHidden
     *
     * @return string Complete binary record data
     * */
    private function writeShortNameBiff8($name, $sheetIndex, $rangeBounds, $isHidden = false)
    {
        $record = 0x0018;

        // option flags
        $options = ($isHidden ? 0x21 : 0x00);

        $extra = pack(
            'Cvvvvv',
            0x3B,
            $sheetIndex - 1,
            $rangeBounds[0][1] - 1,
            $rangeBounds[1][1] - 1,
            $rangeBounds[0][0] - 1,
            $rangeBounds[1][0] - 1
        );

        // size of the formula (in bytes)
        $sz = strlen($extra);

        // combine the parts
        $data = pack('vCCvvvCCCCC', $options, 0, 1, $sz, 0, $sheetIndex, 0, 0, 0, 0, 0)
            . $name . $extra;
        $length = strlen($data);

        $header = pack('vv', $record, $length);

        return $header . $data;
    }

    /**
     * Stores the CODEPAGE biff record.
     */
    private function writeCodepage(): void
    {
        $record = 0x0042; // Record identifier
        $length = 0x0002; // Number of bytes to follow
        $cv = $this->codepage; // The code page

        $header = pack('vv', $record, $length);
        $data = pack('v', $cv);

        $this->append($header . $data);
    }

    /**
     * Write Excel BIFF WINDOW1 record.
     */
    private function writeWindow1(): void
    {
        $record = 0x003D; // Record identifier
        $length = 0x0012; // Number of bytes to follow

        $xWn = 0x0000; // Horizontal position of window
        $yWn = 0x0000; // Vertical position of window
        $dxWn = 0x25BC; // Width of window
        $dyWn = 0x1572; // Height of window

        $grbit = 0x0038; // Option flags

        // not supported by PhpSpreadsheet, so there is only one selected sheet, the active
        $ctabsel = 1; // Number of workbook tabs selected

        $wTabRatio = 0x0258; // Tab to scrollbar ratio

        // not supported by PhpSpreadsheet, set to 0
        $itabFirst = 0; // 1st displayed worksheet
        $itabCur = $this->spreadsheet->getActiveSheetIndex(); // Active worksheet

        $header = pack('vv', $record, $length);
        $data = pack('vvvvvvvvv', $xWn, $yWn, $dxWn, $dyWn, $grbit, $itabCur, $itabFirst, $ctabsel, $wTabRatio);
        $this->append($header . $data);
    }

    /**
     * Writes Excel BIFF BOUNDSHEET record.
     *
     * @param int $offset Location of worksheet BOF
     */
    private function writeBoundSheet(\PhpOffice\PhpSpreadsheet\Worksheet\Worksheet $sheet, $offset): void
    {
        $sheetname = $sheet->getTitle();
        $record = 0x0085; // Record identifier

        // sheet state
        switch ($sheet->getSheetState()) {
            case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::SHEETSTATE_VISIBLE:
                $ss = 0x00;

                break;
            case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::SHEETSTATE_HIDDEN:
                $ss = 0x01;

                break;
            case \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet::SHEETSTATE_VERYHIDDEN:
                $ss = 0x02;

                break;
            default:
                $ss = 0x00;

                break;
        }

        // sheet type
        $st = 0x00;

        $grbit = 0x0000; // Visibility and sheet type

        $data = pack('VCC', $offset, $ss, $st);
        $data .= StringHelper::UTF8toBIFF8UnicodeShort($sheetname);

        $length = strlen($data);
        $header = pack('vv', $record, $length);
        $this->append($header . $data);
    }

    /**
     * Write Internal SUPBOOK record.
     */
    private function writeSupbookInternal()
    {
        $record = 0x01AE; // Record identifier
        $length = 0x0004; // Bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('vv', $this->spreadsheet->getSheetCount(), 0x0401);

        return $this->writeData($header . $data);
    }

    /**
     * Writes the Excel BIFF EXTERNSHEET record. These references are used by
     * formulas.
     */
    private function writeExternalsheetBiff8()
    {
        $totalReferences = count($this->parser->references);
        $record = 0x0017; // Record identifier
        $length = 2 + 6 * $totalReferences; // Number of bytes to follow

        $supbook_index = 0; // FIXME: only using internal SUPBOOK record
        $header = pack('vv', $record, $length);
        $data = pack('v', $totalReferences);
        for ($i = 0; $i < $totalReferences; ++$i) {
            $data .= $this->parser->references[$i];
        }

        return $this->writeData($header . $data);
    }

    /**
     * Write Excel BIFF STYLE records.
     */
    private function writeStyle(): void
    {
        $record = 0x0293; // Record identifier
        $length = 0x0004; // Bytes to follow

        $ixfe = 0x8000; // Index to cell style XF
        $BuiltIn = 0x00; // Built-in style
        $iLevel = 0xff; // Outline style level

        $header = pack('vv', $record, $length);
        $data = pack('vCC', $ixfe, $BuiltIn, $iLevel);
        $this->append($header . $data);
    }

    /**
     * Writes Excel FORMAT record for non "built-in" numerical formats.
     *
     * @param string $format Custom format string
     * @param int $ifmt Format index code
     */
    private function writeNumberFormat($format, $ifmt): void
    {
        $record = 0x041E; // Record identifier

        $numberFormatString = StringHelper::UTF8toBIFF8UnicodeLong($format);
        $length = 2 + strlen($numberFormatString); // Number of bytes to follow

        $header = pack('vv', $record, $length);
        $data = pack('v', $ifmt) . $numberFormatString;
        $this->append($header . $data);
    }

    /**
     * Write DATEMODE record to indicate the date system in use (1904 or 1900).
     */
    private function writeDateMode(): void
    {
        $record = 0x0022; // Record identifier
        $length = 0x0002; // Bytes to follow

        $f1904 = (Date::getExcelCalendar() === Date::CALENDAR_MAC_1904)
            ? 1
            : 0; // Flag for 1904 date system

        $header = pack('vv', $record, $length);
        $data = pack('v', $f1904);
        $this->append($header . $data);
    }

    /**
     * Stores the COUNTRY record for localization.
     *
     * @return string
     */
    private function writeCountry()
    {
        $record = 0x008C; // Record identifier
        $length = 4; // Number of bytes to follow

        $header = pack('vv', $record, $length);
        // using the same country code always for simplicity
        $data = pack('vv', $this->countryCode, $this->countryCode);

        return $this->writeData($header . $data);
    }

    /**
     * Write the RECALCID record.
     *
     * @return string
     */
    private function writeRecalcId()
    {
        $record = 0x01C1; // Record identifier
        $length = 8; // Number of bytes to follow

        $header = pack('vv', $record, $length);

        // by inspection of real Excel files, MS Office Excel 2007 writes this
        $data = pack('VV', 0x000001C1, 0x00001E667);

        return $this->writeData($header . $data);
    }

    /**
     * Stores the PALETTE biff record.
     */
    private function writePalette(): void
    {
        $aref = $this->palette;

        $record = 0x0092; // Record identifier
        $length = 2 + 4 * count($aref); // Number of bytes to follow
        $ccv = count($aref); // Number of RGB values to follow
        $data = ''; // The RGB data

        // Pack the RGB data
        foreach ($aref as $color) {
            foreach ($color as $byte) {
                $data .= pack('C', $byte);
            }
        }

        $header = pack('vvv', $record, $length, $ccv);
        $this->append($header . $data);
    }

    /**
     * Handling of the SST continue blocks is complicated by the need to include an
     * additional continuation byte depending on whether the string is split between
     * blocks or whether it starts at the beginning of the block. (There are also
     * additional complications that will arise later when/if Rich Strings are
     * supported).
     *
     * The Excel documentation says that the SST record should be followed by an
     * EXTSST record. The EXTSST record is a hash table that is used to optimise
     * access to SST. However, despite the documentation it doesn't seem to be
     * required so we will ignore it.
     *
     * @return string Binary data
     */
    private function writeSharedStringsTable()
    {
        // maximum size of record data (excluding record header)
        $continue_limit = 8224;

        // initialize array of record data blocks
        $recordDatas = [];

        // start SST record data block with total number of strings, total number of unique strings
        $recordData = pack('VV', $this->stringTotal, $this->stringUnique);

        // loop through all (unique) strings in shared strings table
        foreach (array_keys($this->stringTable) as $string) {
            // here $string is a BIFF8 encoded string

            // length = character count
            $headerinfo = unpack('vlength/Cencoding', $string);

            // currently, this is always 1 = uncompressed
            $encoding = $headerinfo['encoding'];

            // initialize finished writing current $string
            $finished = false;

            while ($finished === false) {
                // normally, there will be only one cycle, but if string cannot immediately be written as is
                // there will be need for more than one cylcle, if string longer than one record data block, there
                // may be need for even more cycles

                if (strlen($recordData) + strlen($string) <= $continue_limit) {
                    // then we can write the string (or remainder of string) without any problems
                    $recordData .= $string;

                    if (strlen($recordData) + strlen($string) == $continue_limit) {
                        // we close the record data block, and initialize a new one
                        $recordDatas[] = $recordData;
                        $recordData = '';
                    }

                    // we are finished writing this string
                    $finished = true;
                } else {
                    // special treatment writing the string (or remainder of the string)
                    // If the string is very long it may need to be written in more than one CONTINUE record.

                    // check how many bytes more there is room for in the current record
                    $space_remaining = $continue_limit - strlen($recordData);

                    // minimum space needed
                    // uncompressed: 2 byte string length length field + 1 byte option flags + 2 byte character
                    // compressed:   2 byte string length length field + 1 byte option flags + 1 byte character
                    $min_space_needed = ($encoding == 1) ? 5 : 4;

                    // We have two cases
                    // 1. space remaining is less than minimum space needed
                    //        here we must waste the space remaining and move to next record data block
                    // 2. space remaining is greater than or equal to minimum space needed
                    //        here we write as much as we can in the current block, then move to next record data block

                    // 1. space remaining is less than minimum space needed
                    if ($space_remaining < $min_space_needed) {
                        // we close the block, store the block data
                        $recordDatas[] = $recordData;

                        // and start new record data block where we start writing the string
                        $recordData = '';

                    // 2. space remaining is greater than or equal to minimum space needed
                    } else {
                        // initialize effective remaining space, for Unicode strings this may need to be reduced by 1, see below
                        $effective_space_remaining = $space_remaining;

                        // for uncompressed strings, sometimes effective space remaining is reduced by 1
                        if ($encoding == 1 && (strlen($string) - $space_remaining) % 2 == 1) {
                            --$effective_space_remaining;
                        }

                        // one block fininshed, store the block data
                        $recordData .= substr($string, 0, $effective_space_remaining);

                        $string = substr($string, $effective_space_remaining); // for next cycle in while loop
                        $recordDatas[] = $recordData;

                        // start new record data block with the repeated option flags
                        $recordData = pack('C', $encoding);
                    }
                }
            }
        }

        // Store the last record data block unless it is empty
        // if there was no need for any continue records, this will be the for SST record data block itself
        if (strlen($recordData) > 0) {
            $recordDatas[] = $recordData;
        }

        // combine into one chunk with all the blocks SST, CONTINUE,...
        $chunk = '';
        foreach ($recordDatas as $i => $recordData) {
            // first block should have the SST record header, remaing should have CONTINUE header
            $record = ($i == 0) ? 0x00FC : 0x003C;

            $header = pack('vv', $record, strlen($recordData));
            $data = $header . $recordData;

            $chunk .= $this->writeData($data);
        }

        return $chunk;
    }

    /**
     * Writes the MSODRAWINGGROUP record if needed. Possibly split using CONTINUE records.
     */
    private function writeMsoDrawingGroup()
    {
        // write the Escher stream if necessary
        if (isset($this->escher)) {
            $writer = new Escher($this->escher);
            $data = $writer->close();

            $record = 0x00EB;
            $length = strlen($data);
            $header = pack('vv', $record, $length);

            return $this->writeData($header . $data);
        }

        return '';
    }

    /**
     * Get Escher object.
     */
    public function getEscher(): ?\PhpOffice\PhpSpreadsheet\Shared\Escher
    {
        return $this->escher;
    }

    /**
     * Set Escher object.
     */
    public function setEscher(?\PhpOffice\PhpSpreadsheet\Shared\Escher $escher): void
    {
        $this->escher = $escher;
    }
}
PK     «[á„ü.¦Ó  ¦Ó  
  Parser.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet as PhpspreadsheetWorksheet;
use PhpOffice\PhpSpreadsheet\Writer\Exception as WriterException;

// Original file header of PEAR::Spreadsheet_Excel_Writer_Parser (used as the base for this class):
// -----------------------------------------------------------------------------------------
// *  Class for parsing Excel formulas
// *
// *  License Information:
// *
// *    Spreadsheet_Excel_Writer:  A library for generating Excel Spreadsheets
// *    Copyright (c) 2002-2003 Xavier Noguer xnoguer@rezebra.com
// *
// *    This library is free software; you can redistribute it and/or
// *    modify it under the terms of the GNU Lesser General Public
// *    License as published by the Free Software Foundation; either
// *    version 2.1 of the License, or (at your option) any later version.
// *
// *    This library is distributed in the hope that it will be useful,
// *    but WITHOUT ANY WARRANTY; without even the implied warranty of
// *    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// *    Lesser General Public License for more details.
// *
// *    You should have received a copy of the GNU Lesser General Public
// *    License along with this library; if not, write to the Free Software
// *    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
// */
class Parser
{
    /**    Constants                */
    // Sheet title in unquoted form
    // Invalid sheet title characters cannot occur in the sheet title:
    //         *:/\?[]
    // Moreover, there are valid sheet title characters that cannot occur in unquoted form (there may be more?)
    // +-% '^&<>=,;#()"{}
    const REGEX_SHEET_TITLE_UNQUOTED = '[^\*\:\/\\\\\?\[\]\+\-\% \\\'\^\&\<\>\=\,\;\#\(\)\"\{\}]+';

    // Sheet title in quoted form (without surrounding quotes)
    // Invalid sheet title characters cannot occur in the sheet title:
    // *:/\?[]                    (usual invalid sheet title characters)
    // Single quote is represented as a pair ''
    const REGEX_SHEET_TITLE_QUOTED = '(([^\*\:\/\\\\\?\[\]\\\'])+|(\\\'\\\')+)+';

    /**
     * The index of the character we are currently looking at.
     *
     * @var int
     */
    public $currentCharacter;

    /**
     * The token we are working on.
     *
     * @var string
     */
    public $currentToken;

    /**
     * The formula to parse.
     *
     * @var string
     */
    private $formula;

    /**
     * The character ahead of the current char.
     *
     * @var string
     */
    public $lookAhead;

    /**
     * The parse tree to be generated.
     *
     * @var string
     */
    public $parseTree;

    /**
     * Array of external sheets.
     *
     * @var array
     */
    private $externalSheets;

    /**
     * Array of sheet references in the form of REF structures.
     *
     * @var array
     */
    public $references;

    /**
     * The Excel ptg indices.
     *
     * @var array
     */
    private $ptg = [
        'ptgExp' => 0x01,
        'ptgTbl' => 0x02,
        'ptgAdd' => 0x03,
        'ptgSub' => 0x04,
        'ptgMul' => 0x05,
        'ptgDiv' => 0x06,
        'ptgPower' => 0x07,
        'ptgConcat' => 0x08,
        'ptgLT' => 0x09,
        'ptgLE' => 0x0A,
        'ptgEQ' => 0x0B,
        'ptgGE' => 0x0C,
        'ptgGT' => 0x0D,
        'ptgNE' => 0x0E,
        'ptgIsect' => 0x0F,
        'ptgUnion' => 0x10,
        'ptgRange' => 0x11,
        'ptgUplus' => 0x12,
        'ptgUminus' => 0x13,
        'ptgPercent' => 0x14,
        'ptgParen' => 0x15,
        'ptgMissArg' => 0x16,
        'ptgStr' => 0x17,
        'ptgAttr' => 0x19,
        'ptgSheet' => 0x1A,
        'ptgEndSheet' => 0x1B,
        'ptgErr' => 0x1C,
        'ptgBool' => 0x1D,
        'ptgInt' => 0x1E,
        'ptgNum' => 0x1F,
        'ptgArray' => 0x20,
        'ptgFunc' => 0x21,
        'ptgFuncVar' => 0x22,
        'ptgName' => 0x23,
        'ptgRef' => 0x24,
        'ptgArea' => 0x25,
        'ptgMemArea' => 0x26,
        'ptgMemErr' => 0x27,
        'ptgMemNoMem' => 0x28,
        'ptgMemFunc' => 0x29,
        'ptgRefErr' => 0x2A,
        'ptgAreaErr' => 0x2B,
        'ptgRefN' => 0x2C,
        'ptgAreaN' => 0x2D,
        'ptgMemAreaN' => 0x2E,
        'ptgMemNoMemN' => 0x2F,
        'ptgNameX' => 0x39,
        'ptgRef3d' => 0x3A,
        'ptgArea3d' => 0x3B,
        'ptgRefErr3d' => 0x3C,
        'ptgAreaErr3d' => 0x3D,
        'ptgArrayV' => 0x40,
        'ptgFuncV' => 0x41,
        'ptgFuncVarV' => 0x42,
        'ptgNameV' => 0x43,
        'ptgRefV' => 0x44,
        'ptgAreaV' => 0x45,
        'ptgMemAreaV' => 0x46,
        'ptgMemErrV' => 0x47,
        'ptgMemNoMemV' => 0x48,
        'ptgMemFuncV' => 0x49,
        'ptgRefErrV' => 0x4A,
        'ptgAreaErrV' => 0x4B,
        'ptgRefNV' => 0x4C,
        'ptgAreaNV' => 0x4D,
        'ptgMemAreaNV' => 0x4E,
        'ptgMemNoMemNV' => 0x4F,
        'ptgFuncCEV' => 0x58,
        'ptgNameXV' => 0x59,
        'ptgRef3dV' => 0x5A,
        'ptgArea3dV' => 0x5B,
        'ptgRefErr3dV' => 0x5C,
        'ptgAreaErr3dV' => 0x5D,
        'ptgArrayA' => 0x60,
        'ptgFuncA' => 0x61,
        'ptgFuncVarA' => 0x62,
        'ptgNameA' => 0x63,
        'ptgRefA' => 0x64,
        'ptgAreaA' => 0x65,
        'ptgMemAreaA' => 0x66,
        'ptgMemErrA' => 0x67,
        'ptgMemNoMemA' => 0x68,
        'ptgMemFuncA' => 0x69,
        'ptgRefErrA' => 0x6A,
        'ptgAreaErrA' => 0x6B,
        'ptgRefNA' => 0x6C,
        'ptgAreaNA' => 0x6D,
        'ptgMemAreaNA' => 0x6E,
        'ptgMemNoMemNA' => 0x6F,
        'ptgFuncCEA' => 0x78,
        'ptgNameXA' => 0x79,
        'ptgRef3dA' => 0x7A,
        'ptgArea3dA' => 0x7B,
        'ptgRefErr3dA' => 0x7C,
        'ptgAreaErr3dA' => 0x7D,
    ];

    /**
     * Thanks to Michael Meeks and Gnumeric for the initial arg values.
     *
     * The following hash was generated by "function_locale.pl" in the distro.
     * Refer to function_locale.pl for non-English function names.
     *
     * The array elements are as follow:
     * ptg:   The Excel function ptg code.
     * args:  The number of arguments that the function takes:
     *           >=0 is a fixed number of arguments.
     *           -1  is a variable  number of arguments.
     * class: The reference, value or array class of the function args.
     * vol:   The function is volatile.
     *
     * @var array
     */
    private $functions = [
        // function                  ptg  args  class  vol
        'COUNT' => [0, -1, 0, 0],
        'IF' => [1, -1, 1, 0],
        'ISNA' => [2, 1, 1, 0],
        'ISERROR' => [3, 1, 1, 0],
        'SUM' => [4, -1, 0, 0],
        'AVERAGE' => [5, -1, 0, 0],
        'MIN' => [6, -1, 0, 0],
        'MAX' => [7, -1, 0, 0],
        'ROW' => [8, -1, 0, 0],
        'COLUMN' => [9, -1, 0, 0],
        'NA' => [10, 0, 0, 0],
        'NPV' => [11, -1, 1, 0],
        'STDEV' => [12, -1, 0, 0],
        'DOLLAR' => [13, -1, 1, 0],
        'FIXED' => [14, -1, 1, 0],
        'SIN' => [15, 1, 1, 0],
        'COS' => [16, 1, 1, 0],
        'TAN' => [17, 1, 1, 0],
        'ATAN' => [18, 1, 1, 0],
        'PI' => [19, 0, 1, 0],
        'SQRT' => [20, 1, 1, 0],
        'EXP' => [21, 1, 1, 0],
        'LN' => [22, 1, 1, 0],
        'LOG10' => [23, 1, 1, 0],
        'ABS' => [24, 1, 1, 0],
        'INT' => [25, 1, 1, 0],
        'SIGN' => [26, 1, 1, 0],
        'ROUND' => [27, 2, 1, 0],
        'LOOKUP' => [28, -1, 0, 0],
        'INDEX' => [29, -1, 0, 1],
        'REPT' => [30, 2, 1, 0],
        'MID' => [31, 3, 1, 0],
        'LEN' => [32, 1, 1, 0],
        'VALUE' => [33, 1, 1, 0],
        'TRUE' => [34, 0, 1, 0],
        'FALSE' => [35, 0, 1, 0],
        'AND' => [36, -1, 0, 0],
        'OR' => [37, -1, 0, 0],
        'NOT' => [38, 1, 1, 0],
        'MOD' => [39, 2, 1, 0],
        'DCOUNT' => [40, 3, 0, 0],
        'DSUM' => [41, 3, 0, 0],
        'DAVERAGE' => [42, 3, 0, 0],
        'DMIN' => [43, 3, 0, 0],
        'DMAX' => [44, 3, 0, 0],
        'DSTDEV' => [45, 3, 0, 0],
        'VAR' => [46, -1, 0, 0],
        'DVAR' => [47, 3, 0, 0],
        'TEXT' => [48, 2, 1, 0],
        'LINEST' => [49, -1, 0, 0],
        'TREND' => [50, -1, 0, 0],
        'LOGEST' => [51, -1, 0, 0],
        'GROWTH' => [52, -1, 0, 0],
        'PV' => [56, -1, 1, 0],
        'FV' => [57, -1, 1, 0],
        'NPER' => [58, -1, 1, 0],
        'PMT' => [59, -1, 1, 0],
        'RATE' => [60, -1, 1, 0],
        'MIRR' => [61, 3, 0, 0],
        'IRR' => [62, -1, 0, 0],
        'RAND' => [63, 0, 1, 1],
        'MATCH' => [64, -1, 0, 0],
        'DATE' => [65, 3, 1, 0],
        'TIME' => [66, 3, 1, 0],
        'DAY' => [67, 1, 1, 0],
        'MONTH' => [68, 1, 1, 0],
        'YEAR' => [69, 1, 1, 0],
        'WEEKDAY' => [70, -1, 1, 0],
        'HOUR' => [71, 1, 1, 0],
        'MINUTE' => [72, 1, 1, 0],
        'SECOND' => [73, 1, 1, 0],
        'NOW' => [74, 0, 1, 1],
        'AREAS' => [75, 1, 0, 1],
        'ROWS' => [76, 1, 0, 1],
        'COLUMNS' => [77, 1, 0, 1],
        'OFFSET' => [78, -1, 0, 1],
        'SEARCH' => [82, -1, 1, 0],
        'TRANSPOSE' => [83, 1, 1, 0],
        'TYPE' => [86, 1, 1, 0],
        'ATAN2' => [97, 2, 1, 0],
        'ASIN' => [98, 1, 1, 0],
        'ACOS' => [99, 1, 1, 0],
        'CHOOSE' => [100, -1, 1, 0],
        'HLOOKUP' => [101, -1, 0, 0],
        'VLOOKUP' => [102, -1, 0, 0],
        'ISREF' => [105, 1, 0, 0],
        'LOG' => [109, -1, 1, 0],
        'CHAR' => [111, 1, 1, 0],
        'LOWER' => [112, 1, 1, 0],
        'UPPER' => [113, 1, 1, 0],
        'PROPER' => [114, 1, 1, 0],
        'LEFT' => [115, -1, 1, 0],
        'RIGHT' => [116, -1, 1, 0],
        'EXACT' => [117, 2, 1, 0],
        'TRIM' => [118, 1, 1, 0],
        'REPLACE' => [119, 4, 1, 0],
        'SUBSTITUTE' => [120, -1, 1, 0],
        'CODE' => [121, 1, 1, 0],
        'FIND' => [124, -1, 1, 0],
        'CELL' => [125, -1, 0, 1],
        'ISERR' => [126, 1, 1, 0],
        'ISTEXT' => [127, 1, 1, 0],
        'ISNUMBER' => [128, 1, 1, 0],
        'ISBLANK' => [129, 1, 1, 0],
        'T' => [130, 1, 0, 0],
        'N' => [131, 1, 0, 0],
        'DATEVALUE' => [140, 1, 1, 0],
        'TIMEVALUE' => [141, 1, 1, 0],
        'SLN' => [142, 3, 1, 0],
        'SYD' => [143, 4, 1, 0],
        'DDB' => [144, -1, 1, 0],
        'INDIRECT' => [148, -1, 1, 1],
        'CALL' => [150, -1, 1, 0],
        'CLEAN' => [162, 1, 1, 0],
        'MDETERM' => [163, 1, 2, 0],
        'MINVERSE' => [164, 1, 2, 0],
        'MMULT' => [165, 2, 2, 0],
        'IPMT' => [167, -1, 1, 0],
        'PPMT' => [168, -1, 1, 0],
        'COUNTA' => [169, -1, 0, 0],
        'PRODUCT' => [183, -1, 0, 0],
        'FACT' => [184, 1, 1, 0],
        'DPRODUCT' => [189, 3, 0, 0],
        'ISNONTEXT' => [190, 1, 1, 0],
        'STDEVP' => [193, -1, 0, 0],
        'VARP' => [194, -1, 0, 0],
        'DSTDEVP' => [195, 3, 0, 0],
        'DVARP' => [196, 3, 0, 0],
        'TRUNC' => [197, -1, 1, 0],
        'ISLOGICAL' => [198, 1, 1, 0],
        'DCOUNTA' => [199, 3, 0, 0],
        'USDOLLAR' => [204, -1, 1, 0],
        'FINDB' => [205, -1, 1, 0],
        'SEARCHB' => [206, -1, 1, 0],
        'REPLACEB' => [207, 4, 1, 0],
        'LEFTB' => [208, -1, 1, 0],
        'RIGHTB' => [209, -1, 1, 0],
        'MIDB' => [210, 3, 1, 0],
        'LENB' => [211, 1, 1, 0],
        'ROUNDUP' => [212, 2, 1, 0],
        'ROUNDDOWN' => [213, 2, 1, 0],
        'ASC' => [214, 1, 1, 0],
        'DBCS' => [215, 1, 1, 0],
        'RANK' => [216, -1, 0, 0],
        'ADDRESS' => [219, -1, 1, 0],
        'DAYS360' => [220, -1, 1, 0],
        'TODAY' => [221, 0, 1, 1],
        'VDB' => [222, -1, 1, 0],
        'MEDIAN' => [227, -1, 0, 0],
        'SUMPRODUCT' => [228, -1, 2, 0],
        'SINH' => [229, 1, 1, 0],
        'COSH' => [230, 1, 1, 0],
        'TANH' => [231, 1, 1, 0],
        'ASINH' => [232, 1, 1, 0],
        'ACOSH' => [233, 1, 1, 0],
        'ATANH' => [234, 1, 1, 0],
        'DGET' => [235, 3, 0, 0],
        'INFO' => [244, 1, 1, 1],
        'DB' => [247, -1, 1, 0],
        'FREQUENCY' => [252, 2, 0, 0],
        'ERROR.TYPE' => [261, 1, 1, 0],
        'REGISTER.ID' => [267, -1, 1, 0],
        'AVEDEV' => [269, -1, 0, 0],
        'BETADIST' => [270, -1, 1, 0],
        'GAMMALN' => [271, 1, 1, 0],
        'BETAINV' => [272, -1, 1, 0],
        'BINOMDIST' => [273, 4, 1, 0],
        'CHIDIST' => [274, 2, 1, 0],
        'CHIINV' => [275, 2, 1, 0],
        'COMBIN' => [276, 2, 1, 0],
        'CONFIDENCE' => [277, 3, 1, 0],
        'CRITBINOM' => [278, 3, 1, 0],
        'EVEN' => [279, 1, 1, 0],
        'EXPONDIST' => [280, 3, 1, 0],
        'FDIST' => [281, 3, 1, 0],
        'FINV' => [282, 3, 1, 0],
        'FISHER' => [283, 1, 1, 0],
        'FISHERINV' => [284, 1, 1, 0],
        'FLOOR' => [285, 2, 1, 0],
        'GAMMADIST' => [286, 4, 1, 0],
        'GAMMAINV' => [287, 3, 1, 0],
        'CEILING' => [288, 2, 1, 0],
        'HYPGEOMDIST' => [289, 4, 1, 0],
        'LOGNORMDIST' => [290, 3, 1, 0],
        'LOGINV' => [291, 3, 1, 0],
        'NEGBINOMDIST' => [292, 3, 1, 0],
        'NORMDIST' => [293, 4, 1, 0],
        'NORMSDIST' => [294, 1, 1, 0],
        'NORMINV' => [295, 3, 1, 0],
        'NORMSINV' => [296, 1, 1, 0],
        'STANDARDIZE' => [297, 3, 1, 0],
        'ODD' => [298, 1, 1, 0],
        'PERMUT' => [299, 2, 1, 0],
        'POISSON' => [300, 3, 1, 0],
        'TDIST' => [301, 3, 1, 0],
        'WEIBULL' => [302, 4, 1, 0],
        'SUMXMY2' => [303, 2, 2, 0],
        'SUMX2MY2' => [304, 2, 2, 0],
        'SUMX2PY2' => [305, 2, 2, 0],
        'CHITEST' => [306, 2, 2, 0],
        'CORREL' => [307, 2, 2, 0],
        'COVAR' => [308, 2, 2, 0],
        'FORECAST' => [309, 3, 2, 0],
        'FTEST' => [310, 2, 2, 0],
        'INTERCEPT' => [311, 2, 2, 0],
        'PEARSON' => [312, 2, 2, 0],
        'RSQ' => [313, 2, 2, 0],
        'STEYX' => [314, 2, 2, 0],
        'SLOPE' => [315, 2, 2, 0],
        'TTEST' => [316, 4, 2, 0],
        'PROB' => [317, -1, 2, 0],
        'DEVSQ' => [318, -1, 0, 0],
        'GEOMEAN' => [319, -1, 0, 0],
        'HARMEAN' => [320, -1, 0, 0],
        'SUMSQ' => [321, -1, 0, 0],
        'KURT' => [322, -1, 0, 0],
        'SKEW' => [323, -1, 0, 0],
        'ZTEST' => [324, -1, 0, 0],
        'LARGE' => [325, 2, 0, 0],
        'SMALL' => [326, 2, 0, 0],
        'QUARTILE' => [327, 2, 0, 0],
        'PERCENTILE' => [328, 2, 0, 0],
        'PERCENTRANK' => [329, -1, 0, 0],
        'MODE' => [330, -1, 2, 0],
        'TRIMMEAN' => [331, 2, 0, 0],
        'TINV' => [332, 2, 1, 0],
        'CONCATENATE' => [336, -1, 1, 0],
        'POWER' => [337, 2, 1, 0],
        'RADIANS' => [342, 1, 1, 0],
        'DEGREES' => [343, 1, 1, 0],
        'SUBTOTAL' => [344, -1, 0, 0],
        'SUMIF' => [345, -1, 0, 0],
        'COUNTIF' => [346, 2, 0, 0],
        'COUNTBLANK' => [347, 1, 0, 0],
        'ISPMT' => [350, 4, 1, 0],
        'DATEDIF' => [351, 3, 1, 0],
        'DATESTRING' => [352, 1, 1, 0],
        'NUMBERSTRING' => [353, 2, 1, 0],
        'ROMAN' => [354, -1, 1, 0],
        'GETPIVOTDATA' => [358, -1, 0, 0],
        'HYPERLINK' => [359, -1, 1, 0],
        'PHONETIC' => [360, 1, 0, 0],
        'AVERAGEA' => [361, -1, 0, 0],
        'MAXA' => [362, -1, 0, 0],
        'MINA' => [363, -1, 0, 0],
        'STDEVPA' => [364, -1, 0, 0],
        'VARPA' => [365, -1, 0, 0],
        'STDEVA' => [366, -1, 0, 0],
        'VARA' => [367, -1, 0, 0],
        'BAHTTEXT' => [368, 1, 0, 0],
    ];

    private $spreadsheet;

    /**
     * The class constructor.
     */
    public function __construct(Spreadsheet $spreadsheet)
    {
        $this->spreadsheet = $spreadsheet;

        $this->currentCharacter = 0;
        $this->currentToken = ''; // The token we are working on.
        $this->formula = ''; // The formula to parse.
        $this->lookAhead = ''; // The character ahead of the current char.
        $this->parseTree = ''; // The parse tree to be generated.
        $this->externalSheets = [];
        $this->references = [];
    }

    /**
     * Convert a token to the proper ptg value.
     *
     * @param mixed $token the token to convert
     *
     * @return mixed the converted token on success
     */
    private function convert($token)
    {
        if (preg_match('/"([^"]|""){0,255}"/', $token)) {
            return $this->convertString($token);
        } elseif (is_numeric($token)) {
            return $this->convertNumber($token);
        // match references like A1 or $A$1
        } elseif (preg_match('/^\$?([A-Ia-i]?[A-Za-z])\$?(\d+)$/', $token)) {
            return $this->convertRef2d($token);
        // match external references like Sheet1!A1 or Sheet1:Sheet2!A1 or Sheet1!$A$1 or Sheet1:Sheet2!$A$1
        } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?[A-Ia-i]?[A-Za-z]\$?(\\d+)$/u', $token)) {
            return $this->convertRef3d($token);
        // match external references like 'Sheet1'!A1 or 'Sheet1:Sheet2'!A1 or 'Sheet1'!$A$1 or 'Sheet1:Sheet2'!$A$1
        } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?[A-Ia-i]?[A-Za-z]\\$?(\\d+)$/u", $token)) {
            return $this->convertRef3d($token);
        // match ranges like A1:B2 or $A$1:$B$2
        } elseif (preg_match('/^(\$)?[A-Ia-i]?[A-Za-z](\$)?(\d+)\:(\$)?[A-Ia-i]?[A-Za-z](\$)?(\d+)$/', $token)) {
            return $this->convertRange2d($token);
        // match external ranges like Sheet1!A1:B2 or Sheet1:Sheet2!A1:B2 or Sheet1!$A$1:$B$2 or Sheet1:Sheet2!$A$1:$B$2
        } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?([A-Ia-i]?[A-Za-z])?\$?(\\d+)\\:\$?([A-Ia-i]?[A-Za-z])?\$?(\\d+)$/u', $token)) {
            return $this->convertRange3d($token);
        // match external ranges like 'Sheet1'!A1:B2 or 'Sheet1:Sheet2'!A1:B2 or 'Sheet1'!$A$1:$B$2 or 'Sheet1:Sheet2'!$A$1:$B$2
        } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?([A-Ia-i]?[A-Za-z])?\\$?(\\d+)\\:\\$?([A-Ia-i]?[A-Za-z])?\\$?(\\d+)$/u", $token)) {
            return $this->convertRange3d($token);
        // operators (including parentheses)
        } elseif (isset($this->ptg[$token])) {
            return pack('C', $this->ptg[$token]);
        // match error codes
        } elseif (preg_match('/^#[A-Z0\\/]{3,5}[!?]{1}$/', $token) || $token == '#N/A') {
            return $this->convertError($token);
        } elseif (preg_match('/^' . Calculation::CALCULATION_REGEXP_DEFINEDNAME . '$/mui', $token) && $this->spreadsheet->getDefinedName($token) !== null) {
            return $this->convertDefinedName($token);
        // commented so argument number can be processed correctly. See toReversePolish().
            /*elseif (preg_match("/[A-Z0-9\xc0-\xdc\.]+/", $token))
            {
                return($this->convertFunction($token, $this->_func_args));
            }*/
            // if it's an argument, ignore the token (the argument remains)
        } elseif ($token == 'arg') {
            return '';
        }

        // TODO: use real error codes
        throw new WriterException("Unknown token $token");
    }

    /**
     * Convert a number token to ptgInt or ptgNum.
     *
     * @param mixed $num an integer or double for conversion to its ptg value
     *
     * @return string
     */
    private function convertNumber($num)
    {
        // Integer in the range 0..2**16-1
        if ((preg_match('/^\\d+$/', $num)) && ($num <= 65535)) {
            return pack('Cv', $this->ptg['ptgInt'], $num);
        }

        // A float
        if (BIFFwriter::getByteOrder()) { // if it's Big Endian
            $num = strrev($num);
        }

        return pack('Cd', $this->ptg['ptgNum'], $num);
    }

    /**
     * Convert a string token to ptgStr.
     *
     * @param string $string a string for conversion to its ptg value
     *
     * @return mixed the converted token on success
     */
    private function convertString($string)
    {
        // chop away beggining and ending quotes
        $string = substr($string, 1, -1);
        if (strlen($string) > 255) {
            throw new WriterException('String is too long');
        }

        return pack('C', $this->ptg['ptgStr']) . StringHelper::UTF8toBIFF8UnicodeShort($string);
    }

    /**
     * Convert a function to a ptgFunc or ptgFuncVarV depending on the number of
     * args that it takes.
     *
     * @param string $token the name of the function for convertion to ptg value
     * @param int $num_args the number of arguments the function receives
     *
     * @return string The packed ptg for the function
     */
    private function convertFunction($token, $num_args)
    {
        $args = $this->functions[$token][1];

        // Fixed number of args eg. TIME($i, $j, $k).
        if ($args >= 0) {
            return pack('Cv', $this->ptg['ptgFuncV'], $this->functions[$token][0]);
        }

        // Variable number of args eg. SUM($i, $j, $k, ..).
        return pack('CCv', $this->ptg['ptgFuncVarV'], $num_args, $this->functions[$token][0]);
    }

    /**
     * Convert an Excel range such as A1:D4 to a ptgRefV.
     *
     * @param string $range An Excel range in the A1:A2
     * @param int $class
     *
     * @return string
     */
    private function convertRange2d($range, $class = 0)
    {
        // TODO: possible class value 0,1,2 check Formula.pm
        // Split the range into 2 cell refs
        if (preg_match('/^(\$)?([A-Ia-i]?[A-Za-z])(\$)?(\d+)\:(\$)?([A-Ia-i]?[A-Za-z])(\$)?(\d+)$/', $range)) {
            [$cell1, $cell2] = explode(':', $range);
        } else {
            // TODO: use real error codes
            throw new WriterException('Unknown range separator');
        }

        // Convert the cell references
        [$row1, $col1] = $this->cellToPackedRowcol($cell1);
        [$row2, $col2] = $this->cellToPackedRowcol($cell2);

        // The ptg value depends on the class of the ptg.
        if ($class == 0) {
            $ptgArea = pack('C', $this->ptg['ptgArea']);
        } elseif ($class == 1) {
            $ptgArea = pack('C', $this->ptg['ptgAreaV']);
        } elseif ($class == 2) {
            $ptgArea = pack('C', $this->ptg['ptgAreaA']);
        } else {
            // TODO: use real error codes
            throw new WriterException("Unknown class $class");
        }

        return $ptgArea . $row1 . $row2 . $col1 . $col2;
    }

    /**
     * Convert an Excel 3d range such as "Sheet1!A1:D4" or "Sheet1:Sheet2!A1:D4" to
     * a ptgArea3d.
     *
     * @param string $token an Excel range in the Sheet1!A1:A2 format
     *
     * @return mixed the packed ptgArea3d token on success
     */
    private function convertRange3d($token)
    {
        // Split the ref at the ! symbol
        [$ext_ref, $range] = PhpspreadsheetWorksheet::extractSheetTitle($token, true);

        // Convert the external reference part (different for BIFF8)
        $ext_ref = $this->getRefIndex($ext_ref);

        // Split the range into 2 cell refs
        [$cell1, $cell2] = explode(':', $range);

        // Convert the cell references
        if (preg_match('/^(\$)?[A-Ia-i]?[A-Za-z](\$)?(\\d+)$/', $cell1)) {
            [$row1, $col1] = $this->cellToPackedRowcol($cell1);
            [$row2, $col2] = $this->cellToPackedRowcol($cell2);
        } else { // It's a rows range (like 26:27)
            [$row1, $col1, $row2, $col2] = $this->rangeToPackedRange($cell1 . ':' . $cell2);
        }

        // The ptg value depends on the class of the ptg.
        $ptgArea = pack('C', $this->ptg['ptgArea3d']);

        return $ptgArea . $ext_ref . $row1 . $row2 . $col1 . $col2;
    }

    /**
     * Convert an Excel reference such as A1, $B2, C$3 or $D$4 to a ptgRefV.
     *
     * @param string $cell An Excel cell reference
     *
     * @return string The cell in packed() format with the corresponding ptg
     */
    private function convertRef2d($cell)
    {
        // Convert the cell reference
        $cell_array = $this->cellToPackedRowcol($cell);
        [$row, $col] = $cell_array;

        // The ptg value depends on the class of the ptg.
        $ptgRef = pack('C', $this->ptg['ptgRefA']);

        return $ptgRef . $row . $col;
    }

    /**
     * Convert an Excel 3d reference such as "Sheet1!A1" or "Sheet1:Sheet2!A1" to a
     * ptgRef3d.
     *
     * @param string $cell An Excel cell reference
     *
     * @return mixed the packed ptgRef3d token on success
     */
    private function convertRef3d($cell)
    {
        // Split the ref at the ! symbol
        [$ext_ref, $cell] = PhpspreadsheetWorksheet::extractSheetTitle($cell, true);

        // Convert the external reference part (different for BIFF8)
        $ext_ref = $this->getRefIndex($ext_ref);

        // Convert the cell reference part
        [$row, $col] = $this->cellToPackedRowcol($cell);

        // The ptg value depends on the class of the ptg.
        $ptgRef = pack('C', $this->ptg['ptgRef3dA']);

        return $ptgRef . $ext_ref . $row . $col;
    }

    /**
     * Convert an error code to a ptgErr.
     *
     * @param string $errorCode The error code for conversion to its ptg value
     *
     * @return string The error code ptgErr
     */
    private function convertError($errorCode)
    {
        switch ($errorCode) {
            case '#NULL!':
                return pack('C', 0x00);
            case '#DIV/0!':
                return pack('C', 0x07);
            case '#VALUE!':
                return pack('C', 0x0F);
            case '#REF!':
                return pack('C', 0x17);
            case '#NAME?':
                return pack('C', 0x1D);
            case '#NUM!':
                return pack('C', 0x24);
            case '#N/A':
                return pack('C', 0x2A);
        }

        return pack('C', 0xFF);
    }

    private function convertDefinedName(string $name): string
    {
        if (strlen($name) > 255) {
            throw new WriterException('Defined Name is too long');
        }

        $nameReference = 1;
        foreach ($this->spreadsheet->getDefinedNames() as $definedName) {
            if ($name === $definedName->getName()) {
                break;
            }
            ++$nameReference;
        }

        $ptgRef = pack('Cvxx', $this->ptg['ptgName'], $nameReference);

        throw new WriterException('Cannot yet write formulae with defined names to Xls');

        return $ptgRef;
    }

    /**
     * Look up the REF index that corresponds to an external sheet name
     * (or range). If it doesn't exist yet add it to the workbook's references
     * array. It assumes all sheet names given must exist.
     *
     * @param string $ext_ref The name of the external reference
     *
     * @return mixed The reference index in packed() format on success
     */
    private function getRefIndex($ext_ref)
    {
        $ext_ref = preg_replace("/^'/", '', $ext_ref); // Remove leading  ' if any.
        $ext_ref = preg_replace("/'$/", '', $ext_ref); // Remove trailing ' if any.
        $ext_ref = str_replace('\'\'', '\'', $ext_ref); // Replace escaped '' with '

        // Check if there is a sheet range eg., Sheet1:Sheet2.
        if (preg_match('/:/', $ext_ref)) {
            [$sheet_name1, $sheet_name2] = explode(':', $ext_ref);

            $sheet1 = $this->getSheetIndex($sheet_name1);
            if ($sheet1 == -1) {
                throw new WriterException("Unknown sheet name $sheet_name1 in formula");
            }
            $sheet2 = $this->getSheetIndex($sheet_name2);
            if ($sheet2 == -1) {
                throw new WriterException("Unknown sheet name $sheet_name2 in formula");
            }

            // Reverse max and min sheet numbers if necessary
            if ($sheet1 > $sheet2) {
                [$sheet1, $sheet2] = [$sheet2, $sheet1];
            }
        } else { // Single sheet name only.
            $sheet1 = $this->getSheetIndex($ext_ref);
            if ($sheet1 == -1) {
                throw new WriterException("Unknown sheet name $ext_ref in formula");
            }
            $sheet2 = $sheet1;
        }

        // assume all references belong to this document
        $supbook_index = 0x00;
        $ref = pack('vvv', $supbook_index, $sheet1, $sheet2);
        $totalreferences = count($this->references);
        $index = -1;
        for ($i = 0; $i < $totalreferences; ++$i) {
            if ($ref == $this->references[$i]) {
                $index = $i;

                break;
            }
        }
        // if REF was not found add it to references array
        if ($index == -1) {
            $this->references[$totalreferences] = $ref;
            $index = $totalreferences;
        }

        return pack('v', $index);
    }

    /**
     * Look up the index that corresponds to an external sheet name. The hash of
     * sheet names is updated by the addworksheet() method of the
     * \PhpOffice\PhpSpreadsheet\Writer\Xls\Workbook class.
     *
     * @param string $sheet_name Sheet name
     *
     * @return int The sheet index, -1 if the sheet was not found
     */
    private function getSheetIndex($sheet_name)
    {
        if (!isset($this->externalSheets[$sheet_name])) {
            return -1;
        }

        return $this->externalSheets[$sheet_name];
    }

    /**
     * This method is used to update the array of sheet names. It is
     * called by the addWorksheet() method of the
     * \PhpOffice\PhpSpreadsheet\Writer\Xls\Workbook class.
     *
     * @param string $name The name of the worksheet being added
     * @param int $index The index of the worksheet being added
     *
     * @see \PhpOffice\PhpSpreadsheet\Writer\Xls\Workbook::addWorksheet()
     */
    public function setExtSheet($name, $index): void
    {
        $this->externalSheets[$name] = $index;
    }

    /**
     * pack() row and column into the required 3 or 4 byte format.
     *
     * @param string $cell The Excel cell reference to be packed
     *
     * @return array Array containing the row and column in packed() format
     */
    private function cellToPackedRowcol($cell)
    {
        $cell = strtoupper($cell);
        [$row, $col, $row_rel, $col_rel] = $this->cellToRowcol($cell);
        if ($col >= 256) {
            throw new WriterException("Column in: $cell greater than 255");
        }
        if ($row >= 65536) {
            throw new WriterException("Row in: $cell greater than 65536 ");
        }

        // Set the high bits to indicate if row or col are relative.
        $col |= $col_rel << 14;
        $col |= $row_rel << 15;
        $col = pack('v', $col);

        $row = pack('v', $row);

        return [$row, $col];
    }

    /**
     * pack() row range into the required 3 or 4 byte format.
     * Just using maximum col/rows, which is probably not the correct solution.
     *
     * @param string $range The Excel range to be packed
     *
     * @return array Array containing (row1,col1,row2,col2) in packed() format
     */
    private function rangeToPackedRange($range)
    {
        preg_match('/(\$)?(\d+)\:(\$)?(\d+)/', $range, $match);
        // return absolute rows if there is a $ in the ref
        $row1_rel = empty($match[1]) ? 1 : 0;
        $row1 = $match[2];
        $row2_rel = empty($match[3]) ? 1 : 0;
        $row2 = $match[4];
        // Convert 1-index to zero-index
        --$row1;
        --$row2;
        // Trick poor inocent Excel
        $col1 = 0;
        $col2 = 65535; // FIXME: maximum possible value for Excel 5 (change this!!!)

        // FIXME: this changes for BIFF8
        if (($row1 >= 65536) || ($row2 >= 65536)) {
            throw new WriterException("Row in: $range greater than 65536 ");
        }

        // Set the high bits to indicate if rows are relative.
        $col1 |= $row1_rel << 15;
        $col2 |= $row2_rel << 15;
        $col1 = pack('v', $col1);
        $col2 = pack('v', $col2);

        $row1 = pack('v', $row1);
        $row2 = pack('v', $row2);

        return [$row1, $col1, $row2, $col2];
    }

    /**
     * Convert an Excel cell reference such as A1 or $B2 or C$3 or $D$4 to a zero
     * indexed row and column number. Also returns two (0,1) values to indicate
     * whether the row or column are relative references.
     *
     * @param string $cell the Excel cell reference in A1 format
     *
     * @return array
     */
    private function cellToRowcol($cell)
    {
        preg_match('/(\$)?([A-I]?[A-Z])(\$)?(\d+)/', $cell, $match);
        // return absolute column if there is a $ in the ref
        $col_rel = empty($match[1]) ? 1 : 0;
        $col_ref = $match[2];
        $row_rel = empty($match[3]) ? 1 : 0;
        $row = $match[4];

        // Convert base26 column string to a number.
        $expn = strlen($col_ref) - 1;
        $col = 0;
        $col_ref_length = strlen($col_ref);
        for ($i = 0; $i < $col_ref_length; ++$i) {
            $col += (ord($col_ref[$i]) - 64) * 26 ** $expn;
            --$expn;
        }

        // Convert 1-index to zero-index
        --$row;
        --$col;

        return [$row, $col, $row_rel, $col_rel];
    }

    /**
     * Advance to the next valid token.
     */
    private function advance()
    {
        $token = '';
        $i = $this->currentCharacter;
        $formula_length = strlen($this->formula);
        // eat up white spaces
        if ($i < $formula_length) {
            while ($this->formula[$i] == ' ') {
                ++$i;
            }

            if ($i < ($formula_length - 1)) {
                $this->lookAhead = $this->formula[$i + 1];
            }
            $token = '';
        }

        while ($i < $formula_length) {
            $token .= $this->formula[$i];

            if ($i < ($formula_length - 1)) {
                $this->lookAhead = $this->formula[$i + 1];
            } else {
                $this->lookAhead = '';
            }

            if ($this->match($token) != '') {
                $this->currentCharacter = $i + 1;
                $this->currentToken = $token;

                return 1;
            }

            if ($i < ($formula_length - 2)) {
                $this->lookAhead = $this->formula[$i + 2];
            } else { // if we run out of characters lookAhead becomes empty
                $this->lookAhead = '';
            }
            ++$i;
        }
        //die("Lexical error ".$this->currentCharacter);
    }

    /**
     * Checks if it's a valid token.
     *
     * @param mixed $token the token to check
     *
     * @return mixed The checked token or false on failure
     */
    private function match($token)
    {
        switch ($token) {
            case '+':
            case '-':
            case '*':
            case '/':
            case '(':
            case ')':
            case ',':
            case ';':
            case '>=':
            case '<=':
            case '=':
            case '<>':
            case '^':
            case '&':
            case '%':
                return $token;

                break;
            case '>':
                if ($this->lookAhead === '=') { // it's a GE token
                    break;
                }

                return $token;

                break;
            case '<':
                // it's a LE or a NE token
                if (($this->lookAhead === '=') || ($this->lookAhead === '>')) {
                    break;
                }

                return $token;

                break;
            default:
                // if it's a reference A1 or $A$1 or $A1 or A$1
                if (preg_match('/^\$?[A-Ia-i]?[A-Za-z]\$?\d+$/', $token) && !preg_match('/\d/', $this->lookAhead) && ($this->lookAhead !== ':') && ($this->lookAhead !== '.') && ($this->lookAhead !== '!')) {
                    return $token;
                } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?[A-Ia-i]?[A-Za-z]\$?\\d+$/u', $token) && !preg_match('/\d/', $this->lookAhead) && ($this->lookAhead !== ':') && ($this->lookAhead !== '.')) {
                    // If it's an external reference (Sheet1!A1 or Sheet1:Sheet2!A1 or Sheet1!$A$1 or Sheet1:Sheet2!$A$1)
                    return $token;
                } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?[A-Ia-i]?[A-Za-z]\\$?\\d+$/u", $token) && !preg_match('/\d/', $this->lookAhead) && ($this->lookAhead !== ':') && ($this->lookAhead !== '.')) {
                    // If it's an external reference ('Sheet1'!A1 or 'Sheet1:Sheet2'!A1 or 'Sheet1'!$A$1 or 'Sheet1:Sheet2'!$A$1)
                    return $token;
                } elseif (preg_match('/^(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+:(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+$/', $token) && !preg_match('/\d/', $this->lookAhead)) {
                    // if it's a range A1:A2 or $A$1:$A$2
                    return $token;
                } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?([A-Ia-i]?[A-Za-z])?\$?\\d+:\$?([A-Ia-i]?[A-Za-z])?\$?\\d+$/u', $token) && !preg_match('/\d/', $this->lookAhead)) {
                    // If it's an external range like Sheet1!A1:B2 or Sheet1:Sheet2!A1:B2 or Sheet1!$A$1:$B$2 or Sheet1:Sheet2!$A$1:$B$2
                    return $token;
                } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?([A-Ia-i]?[A-Za-z])?\\$?\\d+:\\$?([A-Ia-i]?[A-Za-z])?\\$?\\d+$/u", $token) && !preg_match('/\d/', $this->lookAhead)) {
                    // If it's an external range like 'Sheet1'!A1:B2 or 'Sheet1:Sheet2'!A1:B2 or 'Sheet1'!$A$1:$B$2 or 'Sheet1:Sheet2'!$A$1:$B$2
                    return $token;
                } elseif (is_numeric($token) && (!is_numeric($token . $this->lookAhead) || ($this->lookAhead == '')) && ($this->lookAhead !== '!') && ($this->lookAhead !== ':')) {
                    // If it's a number (check that it's not a sheet name or range)
                    return $token;
                } elseif (preg_match('/"([^"]|""){0,255}"/', $token) && $this->lookAhead !== '"' && (substr_count($token, '"') % 2 == 0)) {
                    // If it's a string (of maximum 255 characters)
                    return $token;
                } elseif (preg_match('/^#[A-Z0\\/]{3,5}[!?]{1}$/', $token) || $token === '#N/A') {
                    // If it's an error code
                    return $token;
                } elseif (preg_match("/^[A-Z0-9\xc0-\xdc\\.]+$/i", $token) && ($this->lookAhead === '(')) {
                    // if it's a function call
                    return $token;
                } elseif (preg_match('/^' . Calculation::CALCULATION_REGEXP_DEFINEDNAME . '$/miu', $token) && $this->spreadsheet->getDefinedName($token) !== null) {
                    return $token;
                } elseif (substr($token, -1) === ')') {
                    //    It's an argument of some description (e.g. a named range),
                    //        precise nature yet to be determined
                    return $token;
                }

                return '';
        }
    }

    /**
     * The parsing method. It parses a formula.
     *
     * @param string $formula the formula to parse, without the initial equal
     *                        sign (=)
     *
     * @return mixed true on success
     */
    public function parse($formula)
    {
        $this->currentCharacter = 0;
        $this->formula = (string) $formula;
        $this->lookAhead = $formula[1] ?? '';
        $this->advance();
        $this->parseTree = $this->condition();

        return true;
    }

    /**
     * It parses a condition. It assumes the following rule:
     * Cond -> Expr [(">" | "<") Expr].
     *
     * @return mixed The parsed ptg'd tree on success
     */
    private function condition()
    {
        $result = $this->expression();
        if ($this->currentToken == '<') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgLT', $result, $result2);
        } elseif ($this->currentToken == '>') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgGT', $result, $result2);
        } elseif ($this->currentToken == '<=') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgLE', $result, $result2);
        } elseif ($this->currentToken == '>=') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgGE', $result, $result2);
        } elseif ($this->currentToken == '=') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgEQ', $result, $result2);
        } elseif ($this->currentToken == '<>') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgNE', $result, $result2);
        }

        return $result;
    }

    /**
     * It parses a expression. It assumes the following rule:
     * Expr -> Term [("+" | "-") Term]
     *      -> "string"
     *      -> "-" Term : Negative value
     *      -> "+" Term : Positive value
     *      -> Error code.
     *
     * @return mixed The parsed ptg'd tree on success
     */
    private function expression()
    {
        // If it's a string return a string node
        if (preg_match('/"([^"]|""){0,255}"/', $this->currentToken)) {
            $tmp = str_replace('""', '"', $this->currentToken);
            if (($tmp == '"') || ($tmp == '')) {
                //    Trap for "" that has been used for an empty string
                $tmp = '""';
            }
            $result = $this->createTree($tmp, '', '');
            $this->advance();

            return $result;
        // If it's an error code
        } elseif (preg_match('/^#[A-Z0\\/]{3,5}[!?]{1}$/', $this->currentToken) || $this->currentToken == '#N/A') {
            $result = $this->createTree($this->currentToken, 'ptgErr', '');
            $this->advance();

            return $result;
        // If it's a negative value
        } elseif ($this->currentToken == '-') {
            // catch "-" Term
            $this->advance();
            $result2 = $this->expression();

            return $this->createTree('ptgUminus', $result2, '');
        // If it's a positive value
        } elseif ($this->currentToken == '+') {
            // catch "+" Term
            $this->advance();
            $result2 = $this->expression();

            return $this->createTree('ptgUplus', $result2, '');
        }
        $result = $this->term();
        while ($this->currentToken === '&') {
            $this->advance();
            $result2 = $this->expression();
            $result = $this->createTree('ptgConcat', $result, $result2);
        }
        while (
            ($this->currentToken == '+') ||
            ($this->currentToken == '-') ||
            ($this->currentToken == '^')
        ) {
            if ($this->currentToken == '+') {
                $this->advance();
                $result2 = $this->term();
                $result = $this->createTree('ptgAdd', $result, $result2);
            } elseif ($this->currentToken == '-') {
                $this->advance();
                $result2 = $this->term();
                $result = $this->createTree('ptgSub', $result, $result2);
            } else {
                $this->advance();
                $result2 = $this->term();
                $result = $this->createTree('ptgPower', $result, $result2);
            }
        }

        return $result;
    }

    /**
     * This function just introduces a ptgParen element in the tree, so that Excel
     * doesn't get confused when working with a parenthesized formula afterwards.
     *
     * @return array The parsed ptg'd tree
     *
     * @see fact()
     */
    private function parenthesizedExpression()
    {
        return $this->createTree('ptgParen', $this->expression(), '');
    }

    /**
     * It parses a term. It assumes the following rule:
     * Term -> Fact [("*" | "/") Fact].
     *
     * @return mixed The parsed ptg'd tree on success
     */
    private function term()
    {
        $result = $this->fact();
        while (
            ($this->currentToken == '*') ||
            ($this->currentToken == '/')
        ) {
            if ($this->currentToken == '*') {
                $this->advance();
                $result2 = $this->fact();
                $result = $this->createTree('ptgMul', $result, $result2);
            } else {
                $this->advance();
                $result2 = $this->fact();
                $result = $this->createTree('ptgDiv', $result, $result2);
            }
        }

        return $result;
    }

    /**
     * It parses a factor. It assumes the following rule:
     * Fact -> ( Expr )
     *       | CellRef
     *       | CellRange
     *       | Number
     *       | Function.
     *
     * @return mixed The parsed ptg'd tree on success
     */
    private function fact()
    {
        if ($this->currentToken === '(') {
            $this->advance(); // eat the "("
            $result = $this->parenthesizedExpression();
            if ($this->currentToken !== ')') {
                throw new WriterException("')' token expected.");
            }
            $this->advance(); // eat the ")"

            return $result;
        }
        // if it's a reference
        if (preg_match('/^\$?[A-Ia-i]?[A-Za-z]\$?\d+$/', $this->currentToken)) {
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?[A-Ia-i]?[A-Za-z]\$?\\d+$/u', $this->currentToken)) {
            // If it's an external reference (Sheet1!A1 or Sheet1:Sheet2!A1 or Sheet1!$A$1 or Sheet1:Sheet2!$A$1)
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?[A-Ia-i]?[A-Za-z]\\$?\\d+$/u", $this->currentToken)) {
            // If it's an external reference ('Sheet1'!A1 or 'Sheet1:Sheet2'!A1 or 'Sheet1'!$A$1 or 'Sheet1:Sheet2'!$A$1)
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (
            preg_match('/^(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+:(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+$/', $this->currentToken) ||
            preg_match('/^(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+\.\.(\$)?[A-Ia-i]?[A-Za-z](\$)?\d+$/', $this->currentToken)
        ) {
            // if it's a range A1:B2 or $A$1:$B$2
            // must be an error?
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (preg_match('/^' . self::REGEX_SHEET_TITLE_UNQUOTED . '(\\:' . self::REGEX_SHEET_TITLE_UNQUOTED . ')?\\!\$?([A-Ia-i]?[A-Za-z])?\$?\\d+:\$?([A-Ia-i]?[A-Za-z])?\$?\\d+$/u', $this->currentToken)) {
            // If it's an external range (Sheet1!A1:B2 or Sheet1:Sheet2!A1:B2 or Sheet1!$A$1:$B$2 or Sheet1:Sheet2!$A$1:$B$2)
            // must be an error?
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (preg_match("/^'" . self::REGEX_SHEET_TITLE_QUOTED . '(\\:' . self::REGEX_SHEET_TITLE_QUOTED . ")?'\\!\\$?([A-Ia-i]?[A-Za-z])?\\$?\\d+:\\$?([A-Ia-i]?[A-Za-z])?\\$?\\d+$/u", $this->currentToken)) {
            // If it's an external range ('Sheet1'!A1:B2 or 'Sheet1'!A1:B2 or 'Sheet1'!$A$1:$B$2 or 'Sheet1'!$A$1:$B$2)
            // must be an error?
            $result = $this->createTree($this->currentToken, '', '');
            $this->advance();

            return $result;
        } elseif (is_numeric($this->currentToken)) {
            // If it's a number or a percent
            if ($this->lookAhead === '%') {
                $result = $this->createTree('ptgPercent', $this->currentToken, '');
                $this->advance(); // Skip the percentage operator once we've pre-built that tree
            } else {
                $result = $this->createTree($this->currentToken, '', '');
            }
            $this->advance();

            return $result;
        } elseif (preg_match("/^[A-Z0-9\xc0-\xdc\\.]+$/i", $this->currentToken) && ($this->lookAhead === '(')) {
            // if it's a function call
            return $this->func();
        } elseif (preg_match('/^' . Calculation::CALCULATION_REGEXP_DEFINEDNAME . '$/miu', $this->currentToken) && $this->spreadsheet->getDefinedName($this->currentToken) !== null) {
            $result = $this->createTree('ptgName', $this->currentToken, '');
            $this->advance();

            return $result;
        }

        throw new WriterException('Syntax error: ' . $this->currentToken . ', lookahead: ' . $this->lookAhead . ', current char: ' . $this->currentCharacter);
    }

    /**
     * It parses a function call. It assumes the following rule:
     * Func -> ( Expr [,Expr]* ).
     *
     * @return mixed The parsed ptg'd tree on success
     */
    private function func()
    {
        $num_args = 0; // number of arguments received
        $function = strtoupper($this->currentToken);
        $result = ''; // initialize result
        $this->advance();
        $this->advance(); // eat the "("
        while ($this->currentToken !== ')') {
            if ($num_args > 0) {
                if ($this->currentToken === ',' || $this->currentToken === ';') {
                    $this->advance(); // eat the "," or ";"
                } else {
                    throw new WriterException("Syntax error: comma expected in function $function, arg #{$num_args}");
                }
                $result2 = $this->condition();
                $result = $this->createTree('arg', $result, $result2);
            } else { // first argument
                $result2 = $this->condition();
                $result = $this->createTree('arg', '', $result2);
            }
            ++$num_args;
        }
        if (!isset($this->functions[$function])) {
            throw new WriterException("Function $function() doesn't exist");
        }
        $args = $this->functions[$function][1];
        // If fixed number of args eg. TIME($i, $j, $k). Check that the number of args is valid.
        if (($args >= 0) && ($args != $num_args)) {
            throw new WriterException("Incorrect number of arguments in function $function() ");
        }

        $result = $this->createTree($function, $result, $num_args);
        $this->advance(); // eat the ")"

        return $result;
    }

    /**
     * Creates a tree. In fact an array which may have one or two arrays (sub-trees)
     * as elements.
     *
     * @param mixed $value the value of this node
     * @param mixed $left the left array (sub-tree) or a final node
     * @param mixed $right the right array (sub-tree) or a final node
     *
     * @return array A tree
     */
    private function createTree($value, $left, $right)
    {
        return ['value' => $value, 'left' => $left, 'right' => $right];
    }

    /**
     * Builds a string containing the tree in reverse polish notation (What you
     * would use in a HP calculator stack).
     * The following tree:.
     *
     *    +
     *   / \
     *  2   3
     *
     * produces: "23+"
     *
     * The following tree:
     *
     *    +
     *   / \
     *  3   *
     *     / \
     *    6   A1
     *
     * produces: "36A1*+"
     *
     * In fact all operands, functions, references, etc... are written as ptg's
     *
     * @param array $tree the optional tree to convert
     *
     * @return string The tree in reverse polish notation
     */
    public function toReversePolish($tree = [])
    {
        $polish = ''; // the string we are going to return
        if (empty($tree)) { // If it's the first call use parseTree
            $tree = $this->parseTree;
        }

        if (is_array($tree['left'])) {
            $converted_tree = $this->toReversePolish($tree['left']);
            $polish .= $converted_tree;
        } elseif ($tree['left'] != '') { // It's a final node
            $converted_tree = $this->convert($tree['left']);
            $polish .= $converted_tree;
        }
        if (is_array($tree['right'])) {
            $converted_tree = $this->toReversePolish($tree['right']);
            $polish .= $converted_tree;
        } elseif ($tree['right'] != '') { // It's a final node
            $converted_tree = $this->convert($tree['right']);
            $polish .= $converted_tree;
        }
        // if it's a function convert it here (so we can set it's arguments)
        if (
            preg_match("/^[A-Z0-9\xc0-\xdc\\.]+$/", $tree['value']) &&
            !preg_match('/^([A-Ia-i]?[A-Za-z])(\d+)$/', $tree['value']) &&
            !preg_match('/^[A-Ia-i]?[A-Za-z](\\d+)\\.\\.[A-Ia-i]?[A-Za-z](\\d+)$/', $tree['value']) &&
            !is_numeric($tree['value']) &&
            !isset($this->ptg[$tree['value']])
        ) {
            // left subtree for a function is always an array.
            if ($tree['left'] != '') {
                $left_tree = $this->toReversePolish($tree['left']);
            } else {
                $left_tree = '';
            }

            // add it's left subtree and return.
            return $left_tree . $this->convertFunction($tree['value'], $tree['right']);
        }
        $converted_tree = $this->convert($tree['value']);

        return $polish . $converted_tree;
    }
}
PK     «[a!e¿ü  ü    Style/CellFill.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Fill;

class CellFill
{
    /**
     * @var array<string, int>
     */
    protected static $fillStyleMap = [
        Fill::FILL_NONE => 0x00,
        Fill::FILL_SOLID => 0x01,
        Fill::FILL_PATTERN_MEDIUMGRAY => 0x02,
        Fill::FILL_PATTERN_DARKGRAY => 0x03,
        Fill::FILL_PATTERN_LIGHTGRAY => 0x04,
        Fill::FILL_PATTERN_DARKHORIZONTAL => 0x05,
        Fill::FILL_PATTERN_DARKVERTICAL => 0x06,
        Fill::FILL_PATTERN_DARKDOWN => 0x07,
        Fill::FILL_PATTERN_DARKUP => 0x08,
        Fill::FILL_PATTERN_DARKGRID => 0x09,
        Fill::FILL_PATTERN_DARKTRELLIS => 0x0A,
        Fill::FILL_PATTERN_LIGHTHORIZONTAL => 0x0B,
        Fill::FILL_PATTERN_LIGHTVERTICAL => 0x0C,
        Fill::FILL_PATTERN_LIGHTDOWN => 0x0D,
        Fill::FILL_PATTERN_LIGHTUP => 0x0E,
        Fill::FILL_PATTERN_LIGHTGRID => 0x0F,
        Fill::FILL_PATTERN_LIGHTTRELLIS => 0x10,
        Fill::FILL_PATTERN_GRAY125 => 0x11,
        Fill::FILL_PATTERN_GRAY0625 => 0x12,
        Fill::FILL_GRADIENT_LINEAR => 0x00, // does not exist in BIFF8
        Fill::FILL_GRADIENT_PATH => 0x00,   // does not exist in BIFF8
    ];

    public static function style(Fill $fill): int
    {
        $fillStyle = $fill->getFillType();

        if (is_string($fillStyle) && array_key_exists($fillStyle, self::$fillStyleMap)) {
            return self::$fillStyleMap[$fillStyle];
        }

        return self::$fillStyleMap[Fill::FILL_NONE];
    }
}
PK     «[ç*	CV  V    Style/CellBorder.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Border;

class CellBorder
{
    /**
     * @var array<string, int>
     */
    protected static $styleMap = [
        Border::BORDER_NONE => 0x00,
        Border::BORDER_THIN => 0x01,
        Border::BORDER_MEDIUM => 0x02,
        Border::BORDER_DASHED => 0x03,
        Border::BORDER_DOTTED => 0x04,
        Border::BORDER_THICK => 0x05,
        Border::BORDER_DOUBLE => 0x06,
        Border::BORDER_HAIR => 0x07,
        Border::BORDER_MEDIUMDASHED => 0x08,
        Border::BORDER_DASHDOT => 0x09,
        Border::BORDER_MEDIUMDASHDOT => 0x0A,
        Border::BORDER_DASHDOTDOT => 0x0B,
        Border::BORDER_MEDIUMDASHDOTDOT => 0x0C,
        Border::BORDER_SLANTDASHDOT => 0x0D,
    ];

    public static function style(Border $border): int
    {
        $borderStyle = $border->getBorderStyle();

        if (is_string($borderStyle) && array_key_exists($borderStyle, self::$styleMap)) {
            return self::$styleMap[$borderStyle];
        }

        return self::$styleMap[Border::BORDER_NONE];
    }
}
PK     «[‚oàÛ%
  %
    Style/ColorMap.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls\Style;

use PhpOffice\PhpSpreadsheet\Style\Color;

class ColorMap
{
    /**
     * @var array<string, int>
     */
    private static $colorMap = [
        '#000000' => 0x08,
        '#FFFFFF' => 0x09,
        '#FF0000' => 0x0A,
        '#00FF00' => 0x0B,
        '#0000FF' => 0x0C,
        '#FFFF00' => 0x0D,
        '#FF00FF' => 0x0E,
        '#00FFFF' => 0x0F,
        '#800000' => 0x10,
        '#008000' => 0x11,
        '#000080' => 0x12,
        '#808000' => 0x13,
        '#800080' => 0x14,
        '#008080' => 0x15,
        '#C0C0C0' => 0x16,
        '#808080' => 0x17,
        '#9999FF' => 0x18,
        '#993366' => 0x19,
        '#FFFFCC' => 0x1A,
        '#CCFFFF' => 0x1B,
        '#660066' => 0x1C,
        '#FF8080' => 0x1D,
        '#0066CC' => 0x1E,
        '#CCCCFF' => 0x1F,
        //        '#000080' => 0x20,
        //        '#FF00FF' => 0x21,
        //        '#FFFF00' => 0x22,
        //        '#00FFFF' => 0x23,
        //        '#800080' => 0x24,
        //        '#800000' => 0x25,
        //        '#008080' => 0x26,
        //        '#0000FF' => 0x27,
        '#00CCFF' => 0x28,
        //        '#CCFFFF' => 0x29,
        '#CCFFCC' => 0x2A,
        '#FFFF99' => 0x2B,
        '#99CCFF' => 0x2C,
        '#FF99CC' => 0x2D,
        '#CC99FF' => 0x2E,
        '#FFCC99' => 0x2F,
        '#3366FF' => 0x30,
        '#33CCCC' => 0x31,
        '#99CC00' => 0x32,
        '#FFCC00' => 0x33,
        '#FF9900' => 0x34,
        '#FF6600' => 0x35,
        '#666699' => 0x36,
        '#969696' => 0x37,
        '#003366' => 0x38,
        '#339966' => 0x39,
        '#003300' => 0x3A,
        '#333300' => 0x3B,
        '#993300' => 0x3C,
        //        '#993366' => 0x3D,
        '#333399' => 0x3E,
        '#333333' => 0x3F,
    ];

    public static function lookup(Color $color, int $defaultIndex = 0x00): int
    {
        $colorRgb = $color->getRGB();
        if (is_string($colorRgb) && array_key_exists("#{$colorRgb}", self::$colorMap)) {
            return self::$colorMap["#{$colorRgb}"];
        }

//      TODO Try and map RGB value to nearest colour within the define pallette
//        $red =  Color::getRed($colorRgb, false);
//        $green = Color::getGreen($colorRgb, false);
//        $blue = Color::getBlue($colorRgb, false);

//        $paletteSpace = 3;
//        $newColor = ($red * $paletteSpace / 256) * ($paletteSpace * $paletteSpace) +
//            ($green * $paletteSpace / 256) * $paletteSpace +
//            ($blue * $paletteSpace / 256);

        return $defaultIndex;
    }
}
PK     «[hD j“  “    Font.phpnu „[µü¤        <?php

namespace PhpOffice\PhpSpreadsheet\Writer\Xls;

use PhpOffice\PhpSpreadsheet\Shared\StringHelper;

class Font
{
    /**
     * Color index.
     *
     * @var int
     */
    private $colorIndex;

    /**
     * Font.
     *
     * @var \PhpOffice\PhpSpreadsheet\Style\Font
     */
    private $font;

    /**
     * Constructor.
     */
    public function __construct(\PhpOffice\PhpSpreadsheet\Style\Font $font)
    {
        $this->colorIndex = 0x7FFF;
        $this->font = $font;
    }

    /**
     * Set the color index.
     *
     * @param int $colorIndex
     */
    public function setColorIndex($colorIndex): void
    {
        $this->colorIndex = $colorIndex;
    }

    /**
     * Get font record data.
     *
     * @return string
     */
    public function writeFont()
    {
        $font_outline = 0;
        $font_shadow = 0;

        $icv = $this->colorIndex; // Index to color palette
        if ($this->font->getSuperscript()) {
            $sss = 1;
        } elseif ($this->font->getSubscript()) {
            $sss = 2;
        } else {
            $sss = 0;
        }
        $bFamily = 0; // Font family
        $bCharSet = \PhpOffice\PhpSpreadsheet\Shared\Font::getCharsetFromFontName($this->font->getName()); // Character set

        $record = 0x31; // Record identifier
        $reserved = 0x00; // Reserved
        $grbit = 0x00; // Font attributes
        if ($this->font->getItalic()) {
            $grbit |= 0x02;
        }
        if ($this->font->getStrikethrough()) {
            $grbit |= 0x08;
        }
        if ($font_outline) {
            $grbit |= 0x10;
        }
        if ($font_shadow) {
            $grbit |= 0x20;
        }

        $data = pack(
            'vvvvvCCCC',
            // Fontsize (in twips)
            $this->font->getSize() * 20,
            $grbit,
            // Colour
            $icv,
            // Font weight
            self::mapBold($this->font->getBold()),
            // Superscript/Subscript
            $sss,
            self::mapUnderline($this->font->getUnderline()),
            $bFamily,
            $bCharSet,
            $reserved
        );
        $data .= StringHelper::UTF8toBIFF8UnicodeShort($this->font->getName());

        $length = strlen($data);
        $header = pack('vv', $record, $length);

        return $header . $data;
    }

    /**
     * Map to BIFF5-BIFF8 codes for bold.
     *
     * @param bool $bold
     *
     * @return int
     */
    private static function mapBold($bold)
    {
        if ($bold) {
            return 0x2BC; //  700 = Bold font weight
        }

        return 0x190; //  400 = Normal font weight
    }

    /**
     * Map of BIFF2-BIFF8 codes for underline styles.
     *
     * @var int[]
     */
    private static $mapUnderline = [
        \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_NONE => 0x00,
        \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_SINGLE => 0x01,
        \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_DOUBLE => 0x02,
        \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_SINGLEACCOUNTING => 0x21,
        \PhpOffice\PhpSpreadsheet\Style\Font::UNDERLINE_DOUBLEACCOUNTING => 0x22,
    ];

    /**
     * Map underline.
     *
     * @param string $underline
     *
     * @return int
     */
    private static function mapUnderline($underline)
    {
        if (isset(self::$mapUnderline[$underline])) {
            return self::$mapUnderline[$underline];
        }

        return 0x00;
    }
}
PK       „«[rêog  g                  Color/BIFF5.phpnu „[µü¤        PK       „«[#íŒ¯ù  ù              ¦  Color/BuiltIn.phpnu „[µü¤        PK       „«[$pg  g              à
  Color/BIFF8.phpnu „[µü¤        PK       „«[Hl—Ž  Ž  	            †  Color.phpnu „[µü¤        PK       „«[Àÿ›Â  Â              M  RC4.phpnu „[µü¤        PK       „«[:Ì$M  M              F  MD5.phpnu „[µü¤        PK       „«[ŽiºŸ4  4              Ê7  ErrorCode.phpnu „[µü¤        PK       „«[Ä{îÈA  ÈA  
            ;:  Escher.phpnu „[µü¤        PK       „«[ñ?Û!¥  ¥              =|  Style/CellFont.phpnu „[µü¤        PK       „«[ð[æH  H              $€  Style/Border.phpnu „[µü¤        PK       „«[¬¸u¹›  ›              ¬„  Style/FillPattern.phpnu „[µü¤        PK       „«[•YòÃ                ŒŠ  Style/CellAlignment.phpnu „[µü¤        PK       «[s|dã”	  ”	              T‘  CellDataValidation.phpnu „[µü¤        PK       «[ÔØœÂ Â             .›  Worksheet.phpnu „[µü¤        PK       «[Ï*a«  «              †] BIFFwriter.phpnu „[µü¤        PK       «[¢(Ä0  0              oy Xf.phpnu „[µü¤        PK       «[ÜÂúò¡  ò¡              ´© Workbook.phpnu „[µü¤        PK       «[á„ü.¦Ó  ¦Ó  
            âK Parser.phpnu „[µü¤        PK       «[a!e¿ü  ü              Â Style/CellFill.phpnu „[µü¤        PK       «[ç*	CV  V               & Style/CellBorder.phpnu „[µü¤        PK       «[‚oàÛ%
  %
              š* Style/ColorMap.phpnu „[µü¤        PK       «[hD j“  “              5 Font.phpnu „[µü¤        PK      ¸  ÌB   